<- User:Beetstra/listing7 - User:Beetstra/Validation - User:Beetstra/listing9 ->

Data[edit]

1751 to 1800[edit]

Balofloxacin (1751)
```
Botcommand: addindex 355650440 Balofloxacin
```
```
For index : Balofloxacin=355650440
```
* 127294-70-6 -> 127294-70-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Balofloxacin not found on commonchemistry - Balofloxacin

* No ChemSpiderID

* PubChem: 65958

* No InChI

* No SMILES
Bamaluzole (1753)
```
Botcommand: addindex 355443210 Bamaluzole
```
```
For index : Bamaluzole=355443210
```
* 87034-87-5 -> 87034-87-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bamaluzole not found on commonchemistry - Bamaluzole

* ChemSpiderID: 2342913 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3086242

* No InChI - (ChemSpider: | InChI=InChI=1/C14H12ClN3O/c1-18-9-17-13-12(18)6-7-16-14(13)19-8-10-4-2-3-5-11(10)15/h2-7,9H,8H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Clc1ccccc1COc3nccc2c3ncn2C )
Bamethan (1755)
```
Botcommand: addindex 336531111 Bamethan
```
```
For index : Bamethan=336531111
```
* 3703-79-5 -> 3703-79-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bamethan not found on commonchemistry - Bamethan

* ChemSpiderID: 2204 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2292

* No InChI - (ChemSpider: | InChI=InChI=1/C12H19NO2/c1-2-3-8-13-9-12(15)10-4-6-11(14)7-5-10/h4-7,12-15H,2-3,8-9H2,1H3 )

* No SMILES - (ChemSpider: | smiles=OC(c1ccc(O)cc1)CNCCCC )
Bamifylline (1756)
```
Botcommand: addindex 345617238 Bamifylline
```
```
For index : Bamifylline=345617238
```
* 2016-63-9 -> 2016-63-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bamifylline not found on commonchemistry - Bamifylline

* ChemSpiderID: 15401 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 16229

* InChI: 1/C20H27N5O3/c1-4-24(12-13-26)10-11-25-16(14-15-8-6-5-7-9-15)21-18-17(25)19(27)23(3)20(28)22(18)2/h5-9,26H,4,10-14H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C20H27N5O3/c1-4-24(12-13-26)10-11-25-16(14-15-8-6-5-7-9-15)21-18-17(25)19(27)23(3)20(28)22(18)2/h5-9,26H,4,10-14H2,1-3H3 )

* SMILES: O=C2N(c1nc(n(c1C(=O)N2C)CCN(CC)CCO)Cc3ccccc3)C - (ChemSpider: | SMILES=O=C2N(c1nc(n(c1C(=O)N2C)CCN(CC)CCO)Cc3ccccc3)C )
Bamipine (1757)
```
Botcommand: addindex 347450701 Bamipine
```
```
For index : Bamipine=347450701
```
* 4945-47-5 -> 4945-47-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bamipine not found on commonchemistry - Bamipine

* ChemSpiderID: 65061 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 72075

* No InChI - (ChemSpider: | InChI=InChI=1/C19H24N2/c1-20-14-12-19(13-15-20)21(18-10-6-3-7-11-18)16-17-8-4-2-5-9-17/h2-11,19H,12-16H2,1H3 )

* No SMILES - (ChemSpider: | smiles=N(c1ccccc1)(Cc2ccccc2)C3CCN(C)CC3 )
Bapineuzumab (1758)
```
Botcommand: addindex 357658014 Bapineuzumab
```
```
For index : Bapineuzumab=357658014
```
* 648895-38-9 -> 648895-38-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bapineuzumab not found on commonchemistry - Bapineuzumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barakol (1759)
```
Botcommand: addindex 313591671 Barakol
```
```
For index : Barakol=313591671
```
* 24506-68-1 -> 24506-68-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Barakol not found on commonchemistry - Barakol

* No ChemSpiderID

* PubChem: 3080731

* No InChI

* No SMILES
Barbexaclone (1760)
```
Botcommand: addindex 332750913 Barbexaclone
```
```
For index : Barbexaclone=332750913
```
* 4388-82-3 -> 4388-82-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Barbexaclone not found on commonchemistry - Barbexaclone

* ChemSpiderID: 64332 (correct: 64332) - CORRECT - Retrieved data from ChemSpider

* PubChem: 71196

* No InChI - (ChemSpider: | InChI=InChI=1/C12H12N2O3.C10H21N/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;1-9(11-2)8-10-6-4-3-5-7-10/h3-7H,2H2,1H3,(H2,13,14,15,16,17);9-11H,3-8H2,1-2H3/t;9-/m.0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C1NC(=O)NC(=O)C1(c2ccccc2)CC.N(C)[C@@H](C)CC1CCCCC1 )
Barbigerone (1761)
```
Botcommand: addindex 356155757 Barbigerone
```
```
For index : Barbigerone=356155757
```
* 75425-27-3 -> 75425-27-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Barbigerone not found on commonchemistry - Barbigerone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C1C2=CC=C3C(C=CC(C)(C)O3)=C2OC=C1C4=CC(OC)=C(OC)C=C4OC
Bardoxolone_methyl (1764)
```
Botcommand: addindex 365068633 Bardoxolone_methyl
```
```
For index : Bardoxolone_methyl=365068633
```
* 218600-53-4 -> 218600-53-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bardoxolone+methyl not found on commonchemistry - Bardoxolone+methyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barium_bromide (1767)
```
Botcommand: addindex 347411952 Barium_bromide
```
```
For index : Barium_bromide=347411952
```
* 10553-31-8 -> 10553-31-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Barium+bromide not found on commonchemistry - Barium+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barium_chlorate (1769)
```
Botcommand: addindex 364880276 Barium_chlorate
```
```
For index : Barium_chlorate=364880276
```
* 13477-00-4 -> 13477-00-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Barium+chlorate not found on commonchemistry - Barium+chlorate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barium_ferrate (1772)
```
Botcommand: addindex 360134200 Barium_ferrate
```
```
For index : Barium_ferrate=360134200
```
* 13773-23-4 -> 13773-23-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Barium+ferrate found on commonchemistry - Barium+ferrate
* 12047-11-9 (exact match)
Name in list

All names: 16BA190, barium dodecairon nonadecaoxide, [[barium ferrate (BaFe12O19)]], Barium ferrite, Barium ferrite (BaFe12O19), Barium hexaferrite, Barium hexaferrite (BaFe12O19), Barium iron oxide (BaFe12O19), Bariumdodecaeisennonadecaoxid, Ferotop GP 500, Ferrate (Fe12O192-), barium (1:1), Ferroxdure, GP 300, GP 500, nonadecaoxido de bario y dodecahierro, nonadecaoxyde de baryum et de dodecafer

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barium_iodide (1775)
```
Botcommand: addindex 364881013 Barium_iodide
```
```
For index : Barium_iodide=364881013
```
* 13718-50-8 -> 13718-50-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Barium+iodide not found on commonchemistry - Barium+iodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barium_oxalate (1777)
```
Botcommand: addindex 364881450 Barium_oxalate
```
```
For index : Barium_oxalate=364881450
```
* 516-02-9 -> 516-02-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Barium+oxalate not found on commonchemistry - Barium+oxalate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barium_sulfite (1782)
```
Botcommand: addindex 364855508 Barium_sulfite
```
```
For index : Barium_sulfite=364855508
```
* 7787-39-5 -> 7787-39-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Barium+sulfite not found on commonchemistry - Barium+sulfite

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Barnidipine (1784)
```
Botcommand: addindex 346445582 Barnidipine
```
```
For index : Barnidipine=346445582
```
* 104713-75-9 -> 104713-75-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Barnidipine not found on commonchemistry - Barnidipine

* ChemSpiderID: 391959 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 65884

* No InChI - (ChemSpider: | InChI=InChI=1/C27H29N3O6/c1-17-23(26(31)35-3)25(20-10-7-11-21(14-20)30(33)34)24(18(2)28-17)27(32)36-22-12-13-29(16-22)15-19-8-5-4-6-9-19/h4-11,14,22,25,28H,12-13,15-16H2,1-3H3/t22-,25-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=[O-][N+](=O)c1cccc(c1)[C@H]4C(/C(=O)OC)=C(\N\C(=C4\C(=O)O[C@H]3CCN(Cc2ccccc2)C3)C)C )
Barrelene (1785)
```
Botcommand: addindex 319443962 Barrelene
```
```
For index : Barrelene=319443962
```
* 500-24-3 -> 500-24-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Barrelene not found on commonchemistry - Barrelene

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(C=C2)C=CC2C=C1
Basiliximab (1786)
```
Botcommand: addindex 362698123 Basiliximab
```
```
For index : Basiliximab=362698123
```
* 152923-56-3 -> 152923-56-3 - NOT VERIFIED

* CAS found on commonchemistry - 152923-56-3 - name not in list
All names: Immunoglobulin G1, anti-(human interleukin 2 receptor) (human-mouse monoclonal clone 1H4 Î³1-chain), disulfide with human-mouse monoclonal clone 1H4 light chain, dimer

* Basiliximab not found on commonchemistry - Basiliximab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Basketene (1787)

* No CASNo

* Basketene not found on commonchemistry - Basketene

* No ChemSpiderID

* No PubChem

* InChI: InChI=1/C10H10/c1-2-4-7-5-3(1)6-8(4)10(7)9(5)6/h1-10H

* SMILES: C2=CC5C1C4C3C1C2C3C45
Batanopride (1788)
```
Botcommand: addindex 351858135 Batanopride
```
```
For index : Batanopride=351858135
```
* 102670-46-2 -> 102670-46-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Batanopride not found on commonchemistry - Batanopride

* No ChemSpiderID

* PubChem: 59692

* No InChI

* No SMILES
Batoprazine (1789)
```
Botcommand: addindex 355987731 Batoprazine
```
```
For index : Batoprazine=355987731
```
* 105685-11-8 -> 105685-11-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Batoprazine not found on commonchemistry - Batoprazine

* ChemSpiderID: 160706 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 184839

* No InChI - (ChemSpider: | InChI=InChI=1/C13H14N2O2/c16-12-5-4-10-2-1-3-11(13(10)17-12)15-8-6-14-7-9-15/h1-5,14H,6-9H2 )

* No SMILES - (ChemSpider: | smiles=O=C/2Oc1c(cccc1\C=C\2)N3CCNCC3 )
Batrachotoxin (1790)
```
Botcommand: addindex 360447402 Batrachotoxin
```
```
For index : Batrachotoxin=360447402
```
* 23509-16-2 -> 23509-16-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Batrachotoxin not found on commonchemistry - Batrachotoxin

* No ChemSpiderID

* PubChem: 31958

* No InChI

* SMILES: CC1=CNC(=C1C(=O)OC(C)C2=CC[C@@]34C2(C[C@H](C56C3=CC[C@H]7[C@@]5(CC[C@@](C7)(O6)O)C)O)CN(CCO4)C)C
Batroxobin (1791)
* No CASNo

* Batroxobin not found on commonchemistry - Batroxobin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bavituximab (1792)
```
Botcommand: addindex 364935760 Bavituximab
```
```
For index : Bavituximab=364935760
```
* 648904-28-3 -> 648904-28-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bavituximab not found on commonchemistry - Bavituximab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bay_K8644 (1793)
```
Botcommand: addindex 333121618 Bay_K8644
```
```
For index : Bay_K8644=333121618
```
* 71145-03-4 -> 71145-03-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bay+K found on commonchemistry - Bay+K
* 63675-72-9 (exact match)
Name not in list

All names: [[(.+-.)-bay k 5552]], (.+-.)-Nisoldipine, 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, 3-methyl 5-(2-methylpropyl) ester, 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(2-nitrophenyl)-, methyl 2-methylpropyl ester, BAY-k 5552, Baymycard, Nisocor, Nisoldipin, Nisoldipin, nisoldipine, nisoldipino, Norvasc, Sular, Syscor, Zadipina

* No ChemSpiderID

* PubChem: 2303

* No InChI

* SMILES: CC1=C(C(C(=C(N1)C)[N+](=O)[O-])C2=CC=CC=C2C(F)(F)F)C(=O)OC
Becaplermin (1797)
* No CASNo

* Becaplermin found on commonchemistry - Becaplermin
* 165101-51-9 (exact match)
Name in list

All names: Becaplermin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bectumomab (1800)
```
Botcommand: addindex 348302827 Bectumomab
```
```
For index : Bectumomab=348302827
```
* 158318-63-9 -> 158318-63-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bectumomab not found on commonchemistry - Bectumomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

1801 to 1850[edit]

Befiradol (1801)
```
Botcommand: addindex 355007265 Befiradol
```
```
For index : Befiradol=355007265
```
* 208110-64-9 -> 208110-64-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Befiradol not found on commonchemistry - Befiradol

* No ChemSpiderID

* PubChem: 9865384

* No InChI

* No SMILES
Befloxatone (1802)
```
Botcommand: addindex 347851078 Befloxatone
```
```
For index : Befloxatone=347851078
```
* 134564-82-2 -> 134564-82-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Befloxatone not found on commonchemistry - Befloxatone

* ChemSpiderID: 54811 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 60824

* InChI: 1/C15H18F3NO5/c1-22-9-12-8-19(14(21)24-12)10-2-4-11(5-3-10)23-7-6-13(20)15(16,17)18/h2-5,12-13,20H,6-9H2,1H3/t12-,13-/m1/s1 - (ChemSpider: | InChI=InChI=1/C15H18F3NO5/c1-22-9-12-8-19(14(21)24-12)10-2-4-11(5-3-10)23-7-6-13(20)15(16,17)18/h2-5,12-13,20H,6-9H2,1H3/t12-,13-/m1/s1 )

* SMILES: O=C2O[C@H](CN2c1ccc(OCC[C@@H](O)C(F)(F)F)cc1)COC - (ChemSpider: | SMILES=O=C2O[C@H](CN2c1ccc(OCC[C@@H](O)C(F)(F)F)cc1)COC )
Bekanamycin (1807)
```
Botcommand: addindex 292867127 Bekanamycin
```
```
For index : Bekanamycin=292867127
```
* 4696-76-8 -> 4696-76-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bekanamycin not found on commonchemistry - Bekanamycin

* ChemSpiderID: 793 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71201

* No InChI - (ChemSpider: | InChI=InChI=1/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2 )

* No SMILES - (ChemSpider: | smiles=O(C2C(O)C(OC1OC(CN)C(O)C(O)C1N)C(N)CC2N)C3OC(C(O)C(N)C3O)CO )
Belatacept (1808)
* No CASNo

* Belatacept not found on commonchemistry - Belatacept

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Belimumab (1809)
```
Botcommand: addindex 345919065 Belimumab
```
```
For index : Belimumab=345919065
```
* 356547-88-1 -> 356547-88-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Belimumab not found on commonchemistry - Belimumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Belotecan (1810)
```
Botcommand: addindex 292867324 Belotecan
```
```
For index : Belotecan=292867324
```
* 256411-32-2 -> 256411-32-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Belotecan not found on commonchemistry - Belotecan

* No ChemSpiderID

* PubChem: 6456014

* No InChI

* No SMILES
Bemesetron (1812)
```
Botcommand: addindex 341373539 Bemesetron
```
```
For index : Bemesetron=341373539
```
* 40796-97-2 -> 40796-97-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bemesetron not found on commonchemistry - Bemesetron

* ChemSpiderID: 10498629 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 671690

* No InChI - (ChemSpider: | InChI=InChI=1/C15H17Cl2NO2/c1-18-12-2-3-13(18)8-14(7-12)20-15(19)9-4-10(16)6-11(17)5-9/h4-6,12-14H,2-3,7-8H2,1H3/t12-,13+,14+ )

* No SMILES - (ChemSpider: | smiles=CN3[C@@H]1CC[C@H]3C[C@H](C1)OC(=O)c2cc(Cl)cc(Cl)c2 )
Bemiparin_sodium (1813)
```
Botcommand: addindex 339261770 Bemiparin_sodium
```
```
For index : Bemiparin_sodium=339261770
```
* 91449-79-5 -> 91449-79-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bemiparin+sodium found on commonchemistry - Bemiparin+sodium
* 9041-08-1 (exact match)
Name in list

All names: Alfa 87-120, Alfa 87-163, Alfa 87-198, Alfa 87-81, Alfa 88-247, Ardeparin sodium, Badyket, [[bemiparin sodium]], Clivarin 1750, Dalteparin sodium, Deligoparin sodium, Depo-Heparin, Fragmin, Fragmin IV, H 2149, Hed-Heparin, Hepaflush, Hepagumin, Hepalean, Heparin Fragment Kabi 2165, Heparin sodium, Heparin, sodium salt, Heparine, sel de sodium, HEPARIN-NATRIUM, Hepathrom, Heprinar, Hepsal, Inno-Hep, Ivor, Kabi 2165, LHN 1, Lioton 1000, Lipo-Hepin, Lipo-Hepinette, Liquaemin sodium, Liquemin, Logiparin, Longheparin, Minihep, Minolteparin sodium, Monoparin, Nadroparine sodium, Normiflo, OP 2000, Panheprin, Parnaparin sodium, Pularin, Reviparin sodium, RO 11, RP 54563, Sodium acid heparin, Sodium heparin, Sodium heparinate, Sodium parnaparin, Thrombo-Hepin, Thromboliquine, Tinzaparin sodium, Unihep, Viatromb, WY 90493RD, Zibor

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bencyclane (1817)
```
Botcommand: addindex 345618118 Bencyclane
```
```
For index : Bencyclane=345618118
```
* 2179-37-5 -> 2179-37-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bencyclane not found on commonchemistry - Bencyclane

* ChemSpiderID: 2222 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2312

* InChI: 1/C19H31NO/c1-20(2)15-10-16-21-19(13-8-3-4-9-14-19)17-18-11-6-5-7-12-18/h5-7,11-12H,3-4,8-10,13-17H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C19H31NO/c1-20(2)15-10-16-21-19(13-8-3-4-9-14-19)17-18-11-6-5-7-12-18/h5-7,11-12H,3-4,8-10,13-17H2,1-2H3 )

* SMILES: O(CCCN(C)C)C1(CCCCCC1)Cc2ccccc2 - (ChemSpider: | SMILES=O(CCCN(C)C)C1(CCCCCC1)Cc2ccccc2 )
Bendamustine (1818)
```
Botcommand: addindex 353741593 Bendamustine
```
```
For index : Bendamustine=353741593
```
* 16506-27-7 -> 16506-27-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bendamustine not found on commonchemistry - Bendamustine

* No ChemSpiderID

* PubChem: 65628

* No InChI

* No SMILES
Bendectin (1820)
```
Botcommand: addindex 362256860 Bendectin
```
```
For index : Bendectin=362256860
```
* 99007-20-2 -> 99007-20-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bendectin not found on commonchemistry - Bendectin

* No ChemSpiderID (correct: 10750)

* PubChem: 163685

* No InChI

* No SMILES
Bendiocarb (1821)
```
Botcommand: addindex 352300745 Bendiocarb
```
```
For index : Bendiocarb=352300745
```
* 22781-23-3 -> 22781-23-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bendiocarb not found on commonchemistry - Bendiocarb

* ChemSpiderID: 2224 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2314

* InChI: 1/C11H13NO4/c1-11(2)15-8-6-4-5-7(9(8)16-11)14-10(13)12-3/h4-6H,1-3H3,(H,12,13) - (ChemSpider: | InChI=InChI=1/C11H13NO4/c1-11(2)15-8-6-4-5-7(9(8)16-11)14-10(13)12-3/h4-6H,1-3H3,(H,12,13) )

* SMILES: O=C(Oc1cccc2OC(Oc12)(C)C)NC - (ChemSpider: | SMILES=O=C(Oc1cccc2OC(Oc12)(C)C)NC )
Benexate (1823)
```
Botcommand: addindex 332752909 Benexate
```
```
For index : Benexate=332752909
```
* 78718-52-2 -> 78718-52-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Benexate not found on commonchemistry - Benexate

* ChemSpiderID: 2226 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2316

* No InChI - (ChemSpider: | InChI=InChI=1/C23H27N3O4/c24-23(25)26-14-16-10-12-18(13-11-16)21(27)30-20-9-5-4-8-19(20)22(28)29-15-17-6-2-1-3-7-17/h1-9,16,18H,10-15H2,(H4,24,25,26) )

* No SMILES - (ChemSpider: | smiles=O=C(OCc1ccccc1)c3ccccc3OC(=O)C2CCC(C/N=C(\N)N)CC2 )
Benidipine (1826)

* No CASNo

* Benidipine not found on commonchemistry - Benidipine

* No ChemSpiderID

* PubChem: 60065

* No InChI

* No SMILES
Benmoxin (1827)
```
Botcommand: addindex 360722128 Benmoxin
```
```
For index : Benmoxin=360722128
```
* 7654-03-7 -> 7654-03-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Benmoxin not found on commonchemistry - Benmoxin

* ChemSpiderID: 64728 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71671

* No InChI - (ChemSpider: | InChI=InChI=1/C15H16N2O/c1-12(13-8-4-2-5-9-13)16-17-15(18)14-10-6-3-7-11-14/h2-12,16H,1H3,(H,17,18) )

* No SMILES - (ChemSpider: | smiles=O=C(NNC(c1ccccc1)C)c2ccccc2 )
Benocyclidine (1828)
```
Botcommand: addindex 359898452 Benocyclidine
```
```
For index : Benocyclidine=359898452
```
* 112726-66-6 -> 112726-66-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Benocyclidine not found on commonchemistry - Benocyclidine

* No ChemSpiderID

* PubChem: 123692

* No InChI

* No SMILES
Benoxaprofen (1831)
```
Botcommand: addindex 347662832 Benoxaprofen
```
```
For index : Benoxaprofen=347662832
```
* 67434-14-4 -> 67434-14-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Benoxaprofen not found on commonchemistry - Benoxaprofen

* No ChemSpiderID

* PubChem: 39941

* No InChI

* No SMILES
Benralizumab (1834)
```
Botcommand: addindex 353555689 Benralizumab
```
```
For index : Benralizumab=353555689
```
* 1044511-01-4 -> 1044511-01-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Benralizumab not found on commonchemistry - Benralizumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bensulide (1836)
```
Botcommand: addindex 363694637 Bensulide
```
```
For index : Bensulide=363694637
```
* 741-58-2 -> 741-58-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bensulide not found on commonchemistry - Bensulide

* No ChemSpiderID

* PubChem: 12932

* No InChI

* SMILES: CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)C1=CC=CC=C1
BenzaClin (1839)
* No CASNo

* BenzaClin not found on commonchemistry - BenzaClin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Benzal_chloride (1840)
```
Botcommand: addindex 338748578 Benzal_chloride
```
```
For index : Benzal_chloride=338748578
```
* 98-87-3 -> 98-87-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzal+chloride not found on commonchemistry - Benzal+chloride

* ChemSpiderID: 7133 - UNKNOWN

* PubChem: 24855098

* No InChI

* No SMILES
Benzamil (1845)
```
Botcommand: addindex 330281328 Benzamil
```
```
For index : Benzamil=330281328
```
* 2898-76-2 -> 2898-76-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzamil not found on commonchemistry - Benzamil

* No ChemSpiderID

* PubChem: 108107

* No InChI

* SMILES: Clc2nc(C(=O)\N=C(/N)NCc1ccccc1)c(N)nc2N
Benzathine (1848)
```
Botcommand: addindex 362997639 Benzathine
```
```
For index : Benzathine=362997639
```
* 140-28-3 -> 140-28-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzathine not found on commonchemistry - Benzathine

* No ChemSpiderID

* PubChem: 8793

* No InChI

* SMILES: C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2
Benzathine_benzylpenicillin (1849)
```
Botcommand: addindex 352467368 Benzathine_benzylpenicillin
```
```
For index : Benzathine_benzylpenicillin=352467368
```
* 54-35-3 -> 54-35-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzathine+benzylpenicillin not found on commonchemistry - Benzathine+benzylpenicillin

* No ChemSpiderID

* PubChem: 15232

* No InChI

* No SMILES
Benzathine_phenoxymethylpenicillin (1850)
```
Botcommand: addindex 288726880 Benzathine_phenoxymethylpenicillin
```
```
For index : Benzathine_phenoxymethylpenicillin=288726880
```
* 5928-84-7 -> 5928-84-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzathine+phenoxymethylpenicillin not found on commonchemistry - Benzathine+phenoxymethylpenicillin

* No ChemSpiderID

* PubChem: 64725

* No InChI

* No SMILES

1851 to 1900[edit]

Benzazepine (1852)

* No CASNo

* Benzazepine found on commonchemistry - Benzazepine
* 50-49-7 (Formula: C19H24N2; Name: 5H-Dibenz[b,f]azepine-5-propanamine, 10,11-dihydro-N,N-dimethyl-)

* 61337-67-5 (Formula: ; Name: Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepine, 1,2,3,4,10,14b-hexahydro-2-methyl-)

* 67227-57-0 (Formula: C16H16ClNO3.CH4O3S; Name: 1H-3-Benzazepine-7,8-diol, 6-chloro-2,3,4,5-tetrahydro-1-(4-hydroxyphenyl)-, methanesulfonate (salt))

* 86541-75-5 (Formula: C24H28N2O5; Name: 1H-1-Benzazepine-1-acetic acid, 3-[[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-, (3S)-)

* 249296-44-4 (Formula: C13H13N3; Name: 6,10-Methano-6H-pyrazino[2,3-h][3]benzazepine, 7,8,9,10-tetrahydro-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Benzazocine (1853)
```
Botcommand: addindex 356457484 Benzazocine
```
```
For index : Benzazocine=356457484
```
* 265-50-9 -> 265-50-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzazocine found on commonchemistry - Benzazocine
* 359-83-1 (exact match)
Name in list

All names: (.+-.)-Pentazocine, [[1,2,3,4,5,6-Hexahydro-3-(3-methyl-2-butenyl)-6,11-dimethyl-8-hydroxy-2,6-methano-3-benzazocine]], 1,2,3,4,5,6-Hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-2,6-methano-3-benzazocin-8-ol, 2,6-Methano-3-benzazocin-8-ol, 1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-buten-1-yl)-, (2R,6R,11R)-rel-, 2,6-Methano-3-benzazocin-8-ol, 1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-, (2R,6R,11R)-rel-, 2,6-Methano-3-benzazocin-8-ol, 1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-, (2Î±,6Î±,11R*)-, 2,6-Methano-3-benzazocin-8-ol,1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-,(2R,6R,11R)-rel-, 2-Dimethylallyl-5,9-dimethyl-2'-hydroxybenzomorphan, 2'-Hydroxy-5,9-dimethyl-2-(3,3-dimethylallyl)-6,7-benzomorphan, 3-(3-Methyl-2-butenyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-2,6-methano-3-benzazocin-8-ol, [[3-(3-Methyl-2-butenyl)-1,2,3,4,5,6-hexahydro-8-hydroxy-6,11-dimethyl-2,6-methano-3-benzazocine]], cis-(.+-.)-Pentazocine, dl-Pentazocine, Fortalgesic, Fortalin, Fortral, II-C 2, Lexir, NIH 7958, NSC 107430, Peltazon, Pentagin, Pentazocin, Pentazocin, pentazocina, pentazocine, PENTAZOCINE USP RECRYSTALLIZED, Sosegon, Soseton, Sosigon, Talwin, Win 20228

* ChemSpiderID: 14453507 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: InChI=1S/C11H9N/c1-2-5-11-7-9-12-8-3-6-10(11)4-1/h1-9H/b6-3-,8-3-,9-7-,10-6-,11-7-,12-8-,12-9- - (ChemSpider: | InChI=InChI=1/C11H9N/c1-2-5-11-7-9-12-8-3-6-10(11)4-1/h1-9H/b6-3-,8-3-,9-7-,10-6-,11-7-,12-8-,12-9- )

* SMILES: c1cccc2\C=C/N=C\C=C/c12 - (ChemSpider: | SMILES=c1cccc2\C=C/N=C\C=C/c12 )
Benzbromarone (1854)
```
Botcommand: addindex 359687199 Benzbromarone
```
```
For index : Benzbromarone=359687199
```
* 3562-84-3 -> 3562-84-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzbromarone not found on commonchemistry - Benzbromarone

* ChemSpiderID: 2243 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2333

* No InChI - (ChemSpider: | InChI=InChI=1/C17H12Br2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Brc1cc(cc(Br)c1O)C(=O)c2c3ccccc3oc2CC )
Benzenehexol (1858)
```
Botcommand: addindex 356735592 Benzenehexol
```
```
For index : Benzenehexol=356735592
```
* 608-80-0 -> 608-80-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzenehexol not found on commonchemistry - Benzenehexol

* No ChemSpiderID

* PubChem: 69102

* No InChI

* SMILES: C1(=C(C(=C(C(=C1O)O)O)O)O)O
Benzeneselenol (1859)
```
Botcommand: addindex 348101446 Benzeneselenol
```
```
For index : Benzeneselenol=348101446
```
* 645-96-5 -> 645-96-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzeneselenol not found on commonchemistry - Benzeneselenol

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: c1ccccc1Se
Benzilone (1866)
```
Botcommand: addindex 348543364 Benzilone
```
```
For index : Benzilone=348543364
```
* 16175-92-1 -> 16175-92-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzilone not found on commonchemistry - Benzilone

* No ChemSpiderID

* PubChem: 66248

* No InChI

* No SMILES
Benzimidazoline (1868)
```
Botcommand: addindex 353741455 Benzimidazoline
```
```
For index : Benzimidazoline=353741455
```
* 4746-67-2 -> 4746-67-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzimidazoline found on commonchemistry - Benzimidazoline
* 583-39-1 (Formula: C7H6N2S; Name: 2H-Benzimidazole-2-thione, 1,3-dihydro-)

* 934-32-7 (Formula: C7H7N3; Name: 1H-Benzimidazol-2-amine)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C12=CC=CC=C1NCN2
Benziodarone (1869)

* No CASNo

* Benziodarone not found on commonchemistry - Benziodarone

* No ChemSpiderID

* PubChem: 6237

* No InChI

* No SMILES
Benzisoxazole (1871)
```
Botcommand: addindex 356547361 Benzisoxazole
```
```
For index : Benzisoxazole=356547361
```
* 271-58-9 -> 271-58-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzisoxazole found on commonchemistry - Benzisoxazole
* 68291-97-4 (exact match)
Name in list

All names: 1,2-Benzisoxazole-3-methanesulfonamide

* ChemSpiderID: 64227 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 67498

* InChI: 1/C7H5NO/c1-2-4-7-6(3-1)5-8-9-7/h1-5H - (ChemSpider: | InChI=InChI=1/C7H5NO/c1-2-4-7-6(3-1)5-8-9-7/h1-5H )

* SMILES: n2oc1ccccc1c2 - (ChemSpider: | SMILES=n2oc1ccccc1c2 )
Benzo(b)fluoranthene (1875)

* No CASNo

* Benzo+b+fluoranthene not found on commonchemistry - Benzo+b+fluoranthene

* ChemSpiderID: 8799 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H - (ChemSpider: | InChI=InChI=1/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H )

* SMILES: c15ccccc1c2c4c(ccc2)c3ccccc3c4c5 - (ChemSpider: | SMILES=c15ccccc1c2c4c(ccc2)c3ccccc3c4c5 )
Benzo(c)cinnoline (1876)
```
Botcommand: addindex 358897320 Benzo(c)cinnoline
```
```
For index : Benzo(c)cinnoline=358897320
```
* 34524-78-2 -> 34524-78-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzo+c+cinnoline not found on commonchemistry - Benzo+c+cinnoline

* No ChemSpiderID

* PubChem: 9190

* No InChI

* SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3N=N2
Benzo(c)phenanthrene (1877)

* No CASNo

* Benzo+c+phenanthrene not found on commonchemistry - Benzo+c+phenanthrene

* ChemSpiderID: 8782 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C18H12/c1-3-7-16-13(5-1)9-11-15-12-10-14-6-2-4-8-17(14)18(15)16/h1-12H - (ChemSpider: | InChI=InChI=1/C18H12/c1-3-7-16-13(5-1)9-11-15-12-10-14-6-2-4-8-17(14)18(15)16/h1-12H )

* SMILES: c3cc2ccc1ccccc1c2c4ccccc34 - (ChemSpider: | SMILES=c3cc2ccc1ccccc1c2c4ccccc34 )
Benzo(c)thiophene (1878)
```
Botcommand: addindex 358895876 Benzo(c)thiophene
```
```
For index : Benzo(c)thiophene=358895876
```
* 270-82-6 -> 270-82-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzo+c+thiophene not found on commonchemistry - Benzo+c+thiophene

* ChemSpiderID: 119858 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C8H6S/c1-2-4-8-6-9-5-7(8)3-1/h1-6H - (ChemSpider: | InChI=InChI=1/C8H6S/c1-2-4-8-6-9-5-7(8)3-1/h1-6H )

* SMILES: s2cc1ccccc1c2 - (ChemSpider: | SMILES=s2cc1ccccc1c2 )
Benzo(e)pyrene (1879)

* No CASNo

* Benzo+e+pyrene not found on commonchemistry - Benzo+e+pyrene

* ChemSpiderID: 8774 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C20H12/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12H - (ChemSpider: | InChI=InChI=1/C20H12/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12H )

* SMILES: c3ccc2ccc1cccc4c1c2c3c5c4cccc5 - (ChemSpider: | SMILES=c3ccc2ccc1cccc4c1c2c3c5c4cccc5 )
Benzo(ghi)perylene (1880)

* No CASNo

* Benzo+ghi+perylene not found on commonchemistry - Benzo+ghi+perylene

* ChemSpiderID: 8763 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H - (ChemSpider: | InChI=InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H )

* SMILES: c36ccc2ccc1cccc4c1c2c3c5c4cccc5cc6 - (ChemSpider: | SMILES=c36ccc2ccc1cccc4c1c2c3c5c4cccc5cc6 )
Benzo(j)fluoranthene (1881)
```
Botcommand: addindex 358888022 Benzo(j)fluoranthene
```
```
For index : Benzo(j)fluoranthene=358888022
```
* 205-82-3 -> 205-82-3 - NOT VERIFIED

* CAS found on commonchemistry - 205-82-3 - name in list
All names: 10,11-Benzofluoranthene, 7,8-Benzfluoranthene, Benzo(j)fluoranthene, [[benzo[j]fluoranteno]], [[Benzo[j]fluoranthen]], [[benzo[j]fluoranthene]], [[benzo[j]fluoranthene]], Benzo-12,13-fluoranthene, [[Dibenzo[a,jk]fluorene]]

* Benzo+j+fluoranthene not found on commonchemistry - Benzo+j+fluoranthene

* ChemSpiderID: 8798 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C20H12/c1-2-8-15-13(5-1)11-12-17-16-9-3-6-14-7-4-10-18(19(14)16)20(15)17/h1-12H - (ChemSpider: | InChI=InChI=1/C20H12/c1-2-8-15-13(5-1)11-12-17-16-9-3-6-14-7-4-10-18(19(14)16)20(15)17/h1-12H )

* SMILES: c5c3c1cccc2c1c(ccc2)c3c4ccccc4c5 - (ChemSpider: | SMILES=c5c3c1cccc2c1c(ccc2)c3c4ccccc4c5 )
Benzo(k)fluoranthene (1882)

* No CASNo

* Benzo+k+fluoranthene not found on commonchemistry - Benzo+k+fluoranthene

* ChemSpiderID: 8804 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H - (ChemSpider: | InChI=InChI=1/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H )

* SMILES: c4c3c1cccc2c1c(ccc2)c3cc5ccccc45 - (ChemSpider: | SMILES=c4c3c1cccc2c1c(ccc2)c3cc5ccccc45 )
Benzocyclobutene (1885)
File:Benzene CycloButane.png
```
Botcommand: addindex 347944917 Benzocyclobutene
```
```
For index : Benzocyclobutene=347944917
```
* 694-87-1 -> 694-87-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzocyclobutene found on commonchemistry - Benzocyclobutene
* 124221-30-3 (exact match)
Name in list

All names: [[1,3-Bis(2-bicyclo[4.2.0.]octa-1,3,5-trien-3-ylethenyl)-1,1,3,3-tetramethyl-disiloxane, homopolymer]], BCB, BCB 300-65B, BCB 3022, BCB 3022-25, BCB 3022-57, BCB 4026, BCB Cyclotene, BCB resin, Cyclotene, Cyclotene (photopolymer), Cyclotene 3022, Cyclotene 3022-35, Cyclotene 3022-46, Cyclotene 3022-57, Cyclotene 3022-63, Cyclotene 4022, Cyclotene 4022-30, Cyclotene 4022-35, Cyclotene 4024, Cyclotene 4024-40, Cyclotene 4026, Cyclotene 4026-46, Cyclotene 5021, Cyclotene 5021-32, Cyclotene 7200, Cyclotene 7200-35, Cyclotene XU 35134, Cyclotene XU 71918.35, Cyclotene XUR, [[Disiloxane, 1,3-bis(2-bicyclo[4.2.0]octa-1,3,5-trien-3-ylethenyl)-1,1,3,3-tetramethyl-, homopolymer]], [[Divinylsiloxane-bis-benzocyclobutene]], Dow Cyclotene 5021, DVS-BCB, DVS-BCB 3022-57, [[DVS-bisbenzocyclobutene]], Photo-BCB, XU 13001L, XU 13005.01, XU 13005.02L, XU 71918.21

* No ChemSpiderID

* PubChem: 24850072

* No InChI

* No SMILES
Benzodioxolylbutanamine (1886)
```
Botcommand: addindex 358144770 Benzodioxolylbutanamine
```
```
For index : Benzodioxolylbutanamine=358144770
```
* 42542-07-4 -> 42542-07-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzodioxolylbutanamine not found on commonchemistry - Benzodioxolylbutanamine

* No ChemSpiderID

* PubChem: 129870

* No InChI

* No SMILES
Benzododecinium_bromide (1887)
```
Botcommand: addindex 332754703 Benzododecinium_bromide
```
```
For index : Benzododecinium_bromide=332754703
```
* 7281-04-1 -> 7281-04-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzododecinium+bromide not found on commonchemistry - Benzododecinium+bromide

* ChemSpiderID: 22165 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 23705

* InChI: 1/C21H38N.BrH/c1-4-5-6-7-8-9-10-11-12-16-19-22(2,3)20-21-17-14-13-15-18-21;/h13-15,17-18H,4-12,16,19-20H2,1-3H3;1H/q+1;/p-1 - (ChemSpider: | InChI=InChI=1/C21H38N.BrH/c1-4-5-6-7-8-9-10-11-12-16-19-22(2,3)20-21-17-14-13-15-18-21;/h13-15,17-18H,4-12,16,19-20H2,1-3H3;1H/q+1;/p-1 )

* SMILES: [Br-].c1ccccc1C[N+](C)(CCCCCCCCCCCC)C - (ChemSpider: | SMILES=[Br-].c1ccccc1C[N+](C)(CCCCCCCCCCCC)C )
Benzofuranylpropylaminopentane (1889)
```
Botcommand: addindex 358322353 Benzofuranylpropylaminopentane
```
```
For index : Benzofuranylpropylaminopentane=358322353
```
* 260550-89-8 -> 260550-89-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzofuranylpropylaminopentane not found on commonchemistry - Benzofuranylpropylaminopentane

* No ChemSpiderID

* PubChem: 9859674

* No InChI

* No SMILES
Benzoin (1891)
```
Botcommand: addindex 339047404 Benzoin
```
```
For index : Benzoin=339047404
```
* 119-53-9 -> 119-53-9 - NOT VERIFIED

* CAS found on commonchemistry - 119-53-9 - name in list
All names: (.+-.)-2-Hydroxy-1,2-diphenylethanone, (.+-.)-2-Hydroxy-2-phenylacetophenone, (.+-.)-Benzoin, (RS)-Benzoin, 1,2-Diphenyl-1-hydroxy-2-ethanone, 1,2-Diphenyl-2-hydroxyethanone, 1,2-Diphenyl-2-oxoethanol, 2-Hydroxy-1,2-diphenyl-1-ethanone, 2-Hydroxy-1,2-diphenylethanone, 2-Hydroxy-2-phenylacetophenone, ACETOPHENONE, 2-HYDROXY-2-PHENYL-, benzoin, BENZOIN, (+/-), benzoina, Benzoine, Benzoylphenylcarbinol, Desyl alcohol, dl-Benzoin, Ethanone, 2-hydroxy-1,2-diphenyl-, Nisso Cure MB, NSC 8082, S 19, S 19 (benzoin), Wy 42956, Î±-Benzoylbenzenemethanol, Î±-Hydroxybenzyl phenyl ketone, Î±-Hydroxy-Î±-phenylacetophenone

* Benzoin found on commonchemistry - Benzoin
* 119-53-9 (Formula: C14H12O2; Name: Ethanone, 2-hydroxy-1,2-diphenyl-) Matches CAS (119-53-9) on page

* 451-40-1 (Formula: C14H12O; Name: Ethanone, 1,2-diphenyl-)

* 614-33-5 (Formula: C24H20O6; Name: 1,2,3-Propanetriol, tribenzoate)

* 3599-32-4 (Formula: C43H48N2O6S2.Na; Name: 1H-Benz[e]indolium, 2-[7-[1,3-dihydro-1,1-dimethyl-3-(4-sulfobutyl)-2H-benz[e]indol-2-ylidene]-1,3,5-heptatrienyl]-1,1-dimethyl-3-(4-sulfobutyl)-, inner salt, sodium salt)

* 24650-42-8 (Formula: C16H16O3; Name: Ethanone, 2,2-dimethoxy-1,2-diphenyl-)

* No ChemSpiderID

* PubChem: 8400

* No InChI

* SMILES: O=C(c2ccccc2)C(O)c1ccccc1
Benzomorphan (1892)
```
Botcommand: addindex 356590930 Benzomorphan
```
```
For index : Benzomorphan=356590930
```
* 575-19-9 -> 575-19-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzomorphan found on commonchemistry - Benzomorphan
* 359-83-1 (exact match)
Name in list

All names: (.+-.)-Pentazocine, 1,2,3,4,5,6-Hexahydro-3-(3-methyl-2-butenyl)-6,11-dimethyl-8-hydroxy-2,6-methano-3-benzazocine, 1,2,3,4,5,6-Hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-2,6-methano-3-benzazocin-8-ol, 2,6-Methano-3-benzazocin-8-ol, 1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-buten-1-yl)-, (2R,6R,11R)-rel-, 2,6-Methano-3-benzazocin-8-ol, 1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-, (2R,6R,11R)-rel-, 2,6-Methano-3-benzazocin-8-ol, 1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-, (2Î±,6Î±,11R*)-, 2,6-Methano-3-benzazocin-8-ol,1,2,3,4,5,6-hexahydro-6,11-dimethyl-3-(3-methyl-2-butenyl)-,(2R,6R,11R)-rel-, [[2-Dimethylallyl-5,9-dimethyl-2'-hydroxybenzomorphan]], [[2'-Hydroxy-5,9-dimethyl-2-(3,3-dimethylallyl)-6,7-benzomorphan]], 3-(3-Methyl-2-butenyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-2,6-methano-3-benzazocin-8-ol, 3-(3-Methyl-2-butenyl)-1,2,3,4,5,6-hexahydro-8-hydroxy-6,11-dimethyl-2,6-methano-3-benzazocine, cis-(.+-.)-Pentazocine, dl-Pentazocine, Fortalgesic, Fortalin, Fortral, II-C 2, Lexir, NIH 7958, NSC 107430, Peltazon, Pentagin, Pentazocin, Pentazocin, pentazocina, pentazocine, PENTAZOCINE USP RECRYSTALLIZED, Sosegon, Soseton, Sosigon, Talwin, Win 20228

* No ChemSpiderID

* PubChem: 182394

* No InChI

* SMILES: C1CNC2CC1C3=CC=CC=C3C2
Benzonatate (1893)
```
Botcommand: addindex 361620117 Benzonatate
```
```
For index : Benzonatate=361620117
```
* 104-31-4 -> 104-31-4 - NOT VERIFIED

* CAS found on commonchemistry - 104-31-4 - name in list
All names: Benzoic acid, 4-(butylamino)-, 3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl ester, [[Benzoic acid, p-(butylamino)-, 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl ester]], Benzoic acid, p-(butylamino)-, ester with 2,5,8,11,14,17,20,23,26-nonaoxaoctacosan-28-ol, Benzonatat, benzonatate, benzonatato, Benzononantin, Benzononatine, Exangit, KM 65, Tesalon, Tessalin, Tessalon, Tessalon-Ciba, Ventussin, Ventussin-Loz

* Benzonatate found on commonchemistry - Benzonatate
* 104-31-4 (exact match) Matches CAS (104-31-4) on page
Name in list

All names: Benzoic acid, 4-(butylamino)-, 3,6,9,12,15,18,21,24,27-nonaoxaoctacos-1-yl ester, [[Benzoic acid, p-(butylamino)-, 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl ester]], Benzoic acid, p-(butylamino)-, ester with 2,5,8,11,14,17,20,23,26-nonaoxaoctacosan-28-ol, Benzonatat, [[benzonatate]], benzonatato, Benzononantin, Benzononatine, Exangit, KM 65, Tesalon, Tessalin, Tessalon, Tessalon-Ciba, Ventussin, Ventussin-Loz

* No ChemSpiderID

* PubChem: 7699

* No InChI

* No SMILES
Benzopyran (1896)
```
Botcommand: addindex 349758137 Benzopyran
```
```
For index : Benzopyran=349758137
```
* 254-04-6 -> 254-04-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzopyran found on commonchemistry - Benzopyran
* 56-72-4 (Formula: C14H16ClO5PS; Name: Phosphorothioic acid, O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl)O,O-diethyl ester)

* 58-95-7 (Formula: C31H52O3; Name: 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, acetate, (2R)-)

* 59-02-9 (Formula: C29H50O2; Name: 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)-)

* 66-76-2 (Formula: C19H12O6; Name: 2H-1-Benzopyran-2-one, 3,3'-methylenebis[4-hydroxy-)

* 66-97-7 (Formula: C11H6O3; Name: 7H-Furo[3,2-g][1]benzopyran-7-one)

* 81-81-2 (Formula: C19H16O4; Name: 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-)

* 83-79-4 (Formula: C23H22O6; Name: [1]Benzopyrano[3,4-b]furo[2,3-h][1]benzopyran-6(6aH)-one, 1,2,12,12a-tetrahydro-8,9-dimethoxy-2-(1-methylethenyl)-, (2R,6aS,12aS)-)

* 90-33-5 (Formula: C10H8O3; Name: 2H-1-Benzopyran-2-one, 7-hydroxy-4-methyl-)

* 91-44-1 (Formula: C14H17NO2; Name: 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-methyl-)

* 91-64-5 (Formula: C9H6O2; Name: 2H-1-Benzopyran-2-one)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Benzoquinonetetracarboxylic_acid (1897)

* No CASNo

* Benzoquinonetetracarboxylic+acid not found on commonchemistry - Benzoquinonetetracarboxylic+acid

* No ChemSpiderID

* PubChem: 350050

* No InChI

* SMILES: C1(=C(C(=O)C(=C(C1=O)C(=O)O)C(=O)O)C(=O)O)C(=O)O
Benzoquinonetetracarboxylic_dianhydride (1898)
```
Botcommand: addindex 353509231 Benzoquinonetetracarboxylic_dianhydride
```
```
For index : Benzoquinonetetracarboxylic_dianhydride=353509231
```
* 476-37-9 -> 476-37-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzoquinonetetracarboxylic+dianhydride not found on commonchemistry - Benzoquinonetetracarboxylic+dianhydride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Benzothiazine (1900)

* No CASNo

* Benzothiazine found on commonchemistry - Benzothiazine
* 92-84-2 (Formula: C12H9NS; Name: 10H-Phenothiazine)

* 36322-90-4 (Formula: C15H13N3O4S; Name: 2H-1,2-Benzothiazine-3-carboxamide, 4-hydroxy-2-methyl-N-2-pyridinyl-, 1,1-dioxide)

* 71125-38-7 (Formula: C14H13N3O4S2; Name: 2H-1,2-Benzothiazine-3-carboxamide, 4-hydroxy-2-methyl-N-(5-methyl-2-thiazolyl)-, 1,1-dioxide)

* No ChemSpiderID

* PubChem: 3088997, 12805862

* No InChI

* SMILES: C1C=NC2=CC=CC=C2S1

1901 to 1950[edit]

Benzvalene (1912)

* No CASNo

* Benzvalene not found on commonchemistry - Benzvalene

* No ChemSpiderID

* PubChem: 136470

* InChI: 1/C6H6/c1-2-4-5-3(1)6(4)5/h1-6H

* SMILES: C1=CC2C3C1C23
Benzyl_fluoride (1922)
```
Botcommand: addindex 351683989 Benzyl_fluoride
```
```
For index : Benzyl_fluoride=351683989
```
* 350-50-5 -> 350-50-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzyl+fluoride not found on commonchemistry - Benzyl+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: FCc1ccccc1
Benzyl_mercaptan (1923)
```
Botcommand: addindex 360870259 Benzyl_mercaptan
```
```
For index : Benzyl_mercaptan=360870259
```
* 100-53-8 -> 100-53-8 - NOT VERIFIED

* CAS found on commonchemistry - 100-53-8 - name in list
All names: (Mercaptomethyl)benzene, Benzenemethanethiol, Benzyl mercaptan, BENZYL THIOL, Benzylthiol, NSC 41897, Phenylmethanethiol, Phenylmethyl mercaptan, Thiobenzyl alcohol, Toluene-Î±-thiol, toluene-Î±-thiol, tolueno-Î±-tiol, Toluol-Î±-thiol, Î±-Mercaptotoluene, Î±-Toluenethiol, Î±-Toluolthiol, Î‘-TOLUOLTHIOL, Î±-Tolyl mercaptan

* Benzyl+mercaptan found on commonchemistry - Benzyl+mercaptan
* 100-53-8 (exact match) Matches CAS (100-53-8) on page
Name in list

All names: (Mercaptomethyl)benzene, Benzenemethanethiol, [[benzyl mercaptan]], BENZYL THIOL, Benzylthiol, NSC 41897, Phenylmethanethiol, Phenylmethyl mercaptan, Thiobenzyl alcohol, Toluene-Î±-thiol, toluene-Î±-thiol, tolueno-Î±-tiol, Toluol-Î±-thiol, Î±-Mercaptotoluene, Î±-Toluenethiol, Î±-Toluolthiol, Î‘-TOLUOLTHIOL, Î±-Tolyl mercaptan

* ChemSpiderID: 13851383 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 7509

* InChI: 1/C7H8S/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2 - (ChemSpider: | InChI=InChI=1/C7H8S/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2 )

* SMILES: SCc1ccccc1 - (ChemSpider: | SMILES=SCc1ccccc1 )
Benzyl_salicylate (1924)
```
Botcommand: addindex 356582292 Benzyl_salicylate
```
```
For index : Benzyl_salicylate=356582292
```
* 118-58-1 -> 118-58-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzyl+salicylate not found on commonchemistry - Benzyl+salicylate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(OCc1ccccc1)c2ccccc2O
Benzylbutylbarbiturate (1927)
```
Botcommand: addindex 298094946 Benzylbutylbarbiturate
```
```
For index : Benzylbutylbarbiturate=298094946
```
* 66941-94-4 -> 66941-94-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzylbutylbarbiturate not found on commonchemistry - Benzylbutylbarbiturate

* No ChemSpiderID

* PubChem: 48575

* No InChI

* No SMILES
Benzylideneacetone (1928)
```
Botcommand: addindex 332755073 Benzylideneacetone
```
```
For index : Benzylideneacetone=332755073
```
* 122-57-6 -> 122-57-6 - NOT VERIFIED

* CAS found on commonchemistry - 122-57-6 - name in list
All names: 1-Phenyl-1-buten-3-one, 2-Butenone, 4-phenyl-, 2-Phenylethenyl methyl ketone, 2-Phenylvinyl methyl ketone, 3-Buten-2-one, 4-phenyl-, 4-fenilbutenona, 4-Phenyl-3-buten-2-one, 4-Phenyl-3-butene-2-one, 4-Phenyl-3-butene-2-one, Benzylideneacetone, 4-Phenylbutenon, 4-Phenylbutenone, Acetocinnamone, Benzalacetone, BENZYLIDEN ACETONE, BENZYLIDENE ACETONE, Benzylideneacetone, BUT-3-EN-2-ONE, 4-PHENYL-, Ketone, methyl styryl, Methyl 2-phenylvinyl ketone, Methyl phenylvinyl ketone, Methyl styryl ketone, Methyl Î²-styryl ketone, NSC 5605, Styryl methyl ketone

* Benzylideneacetone found on commonchemistry - Benzylideneacetone
* 122-57-6 (Formula: C10H10O; Name: 3-Buten-2-one, 4-phenyl-) Matches CAS (122-57-6) on page

* 1896-62-4 (Formula: C10H10O; Name: 3-Buten-2-one, 4-phenyl-, (3E)-)

* 51364-51-3 (Formula: C51H42O3Pd2; Name: Palladium, tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]di-)

* ChemSpiderID: 553345 - UNKNOWN

* No PubChem

* No InChI

* No SMILES
Benzylisoquinoline (1929)
```
Botcommand: addindex 316300921 Benzylisoquinoline
```
```
For index : Benzylisoquinoline=316300921
```
* 6907-59-1 -> 6907-59-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzylisoquinoline found on commonchemistry - Benzylisoquinoline
* 61-25-6 (exact match)
Name in list

All names: 1-(3,4-Dimethoxybenzyl)-6,7-dimethoxyisoquinoline hydrochloride, [[6,7,3',4'-Tetramethoxy-1-benzylisoquinoline hydrochloride]], 6,7-Dimethoxy-1-(3,4-dimethoxybenzyl)isoquinoline hydrochloride, 6,7-Dimethoxy-1-veratrylisoquinoline hydrochloride, Artegodan, Cardiospan, Cardoverina, Cepaverin, Cerebid, Cerespan, Dispamil, Drapavel, Dynovas, [[Isoquinmoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride]], [[Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride]], [[Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-, hydrochloride (1:1)]], Isoquinoline, 6,7-dimethoxy-1-veratryl-, hydrochloride, Myobid, Optenyl, Pameion, Panergon, Papavarine chlorhydrate, papaverina, clorhidrato, papaverine hydrochloride, Papaverine, chlorhydrate, Papaverinhydrochlorid, Papaverinium chloride, Papaversan, Paptial TR, Pavabid, Pavacap, Pavacen, Pavadel, Pavagen, Pavakey, Pavased, Paveron, Ro-Papav, Spasmo Nit, Therapav, Vasal, Vasorin, Vasospan

* No ChemSpiderID

* PubChem: 23345

* No InChI

* SMILES: c13ccccc3ccnc1Cc2ccccc2
Benzylmercapturic_acid (1930)
```
Botcommand: addindex 331998809 Benzylmercapturic_acid
```
```
For index : Benzylmercapturic_acid=331998809
```
* 19542-77-9 -> 19542-77-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzylmercapturic+acid not found on commonchemistry - Benzylmercapturic+acid

* No ChemSpiderID

* PubChem: 107816

* No InChI

* SMILES: CC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O
Benzylthiouracil (1934)
```
Botcommand: addindex 290491572 Benzylthiouracil
```
```
For index : Benzylthiouracil=290491572
```
* 6336-50-1 -> 6336-50-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzylthiouracil not found on commonchemistry - Benzylthiouracil

* No ChemSpiderID

* PubChem: 685814

* No InChI

* No SMILES
Benzyltrimethylammonium_fluoride (1935)
```
Botcommand: addindex 324345546 Benzyltrimethylammonium_fluoride
```
```
For index : Benzyltrimethylammonium_fluoride=324345546
```
* 329-97-5 -> 329-97-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Benzyltrimethylammonium+fluoride not found on commonchemistry - Benzyltrimethylammonium+fluoride

* No ChemSpiderID

* PubChem: 16211989

* InChI: InChI=1/C10H16N.FH.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;;/h4-8H,9H2,1-3H3;1H;1H2/q+1;;/p-1/fC10H16N.F.H2O/h;1h;/qm;-1;

* SMILES: C[N+](C)(C)CC1=CC=CC=C1.O.[F-]
Bephenium (1936)
```
Botcommand: addindex 332755292 Bephenium
```
```
For index : Bephenium=332755292
```
* 7181-73-9 -> 7181-73-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bephenium not found on commonchemistry - Bephenium

* ChemSpiderID: 18525 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 19667

* No InChI - (ChemSpider: | InChI=InChI=1/C17H22NO/c1-18(2,15-16-9-5-3-6-10-16)13-14-19-17-11-7-4-8-12-17/h3-12H,13-15H2,1-2H3/q+1 )

* No SMILES - (ChemSpider: | smiles=O(c1ccccc1)CC[N+](Cc2ccccc2)(C)C )
Bepotastine (1937)
```
Botcommand: addindex 347450864 Bepotastine
```
```
For index : Bepotastine=347450864
```
* 125602-71-3 -> 125602-71-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bepotastine not found on commonchemistry - Bepotastine

* ChemSpiderID: 2260 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2350

* No InChI - (ChemSpider: | InChI=InChI=1/C21H25ClN2O3/c22-17-8-6-16(7-9-17)21(19-4-1-2-12-23-19)27-18-10-14-24(15-11-18)13-3-5-20(25)26/h1-2,4,6-9,12,18,21H,3,5,10-11,13-15H2,(H,25,26) )

* No SMILES - (ChemSpider: | smiles=Clc1ccc(cc1)C(OC2CCN(CCCC(=O)O)CC2)c3ncccc3 )
Beraprost (1939)
```
Botcommand: addindex 360229286 Beraprost
```
```
For index : Beraprost=360229286
```
* 88430-50-6 -> 88430-50-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Beraprost not found on commonchemistry - Beraprost

* No ChemSpiderID

* PubChem: 5282428

* No InChI

* No SMILES
Berbamine (1940)
```
Botcommand: addindex 346449076 Berbamine
```
```
For index : Berbamine=346449076
```
* 478-61-5 -> 478-61-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Berbamine not found on commonchemistry - Berbamine

* ChemSpiderID: 9764 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10170

* InChI: 1/C37H40N2O6/c1-38-14-12-24-19-32(41-3)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-31-18-23(8-11-30(31)40)17-29-35-25(13-15-39(29)2)20-34(42-4)36(43-5)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3 - (ChemSpider: | InChI=InChI=1/C37H40N2O6/c1-38-14-12-24-19-32(41-3)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-31-18-23(8-11-30(31)40)17-29-35-25(13-15-39(29)2)20-34(42-4)36(43-5)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3 )

* SMILES: O(c7c(OC)cc4c5c7Oc1cc2c(cc1OC)CCN(C)C2Cc6ccc(Oc3cc(ccc3O)CC5N(C)CC4)cc6)C - (ChemSpider: | SMILES=O(c7c(OC)cc4c5c7Oc1cc2c(cc1OC)CCN(C)C2Cc6ccc(Oc3cc(ccc3O)CC5N(C)CC4)cc6)C )
Berberine (1941)
```
Botcommand: addindex 363210206 Berberine
```
```
For index : Berberine=363210206
```
* 633-66-9 -> 633-66-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Berberine found on commonchemistry - Berberine
* 2086-83-1 (exact match)
Name in list

All names: [[5,6-Dihydro-9,10-dimethoxybenzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium]], [[Benzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium, 5,6-dihydro-9,10-dimethoxy-]], Berbericine, Berberin, Berberin, berberina, [[berberine]], Berbinium, 7,8,13,13a-tetradehydro-9,10-dimethoxy-2,3-(methylenedioxy)-, Majarine, Thalsine, Umbellatin, Umbellatine

* ChemSpiderID: 2263 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2353

* InChI: 1/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 - (ChemSpider: | InChI=InChI=1/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 )

* SMILES: O1c2c(OC1)cc5c(c2)c4cc3ccc(OC)c(OC)c3c[n+]4CC5 - (ChemSpider: | SMILES=O1c2c(OC1)cc5c(c2)c4cc3ccc(OC)c(OC)c3c[n+]4CC5 )
Bergamottin (1942)
```
Botcommand: addindex 347508402 Bergamottin
```
```
For index : Bergamottin=347508402
```
* 7380-40-7 -> 7380-40-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bergamottin not found on commonchemistry - Bergamottin

* No ChemSpiderID

* PubChem: 5471349

* No InChI

* SMILES: CC(=CCC/C(=C/COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)/C)C
Bertilimumab (1944)
```
Botcommand: addindex 345919192 Bertilimumab
```
```
For index : Bertilimumab=345919192
```
* 375348-49-5 -> 375348-49-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bertilimumab not found on commonchemistry - Bertilimumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Beryllium_bromide (1945)
```
Botcommand: addindex 364881988 Beryllium_bromide
```
```
For index : Beryllium_bromide=364881988
```
* 7787-46-4 -> 7787-46-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+bromide not found on commonchemistry - Beryllium+bromide

* ChemSpiderID: 74208 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 82230

* InChI: 1/Be.2BrH/h;2*1H/q+2;;/p-2 - (ChemSpider: | InChI=InChI=1/Be.2BrH/h;2*1H/q+2;;/p-2 )

* SMILES: [Be+2].[Br-].[Br-] - (ChemSpider: | SMILES=[Be+2].[Br-].[Br-] )
Beryllium_carbide (1946)
```
Botcommand: addindex 364882659 Beryllium_carbide
```
```
For index : Beryllium_carbide=364882659
```
* 506-66-1 -> 506-66-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+carbide not found on commonchemistry - Beryllium+carbide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Beryllium_carbonate (1947)
```
Botcommand: addindex 332757088 Beryllium_carbonate
```
```
For index : Beryllium_carbonate=332757088
```
* 13106-47-3 -> 13106-47-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+carbonate not found on commonchemistry - Beryllium+carbonate

* ChemSpiderID: 55490 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 61577

* InChI: 1/CH2O3.Be/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 - (ChemSpider: | InChI=InChI=1/CH2O3.Be/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 )

* SMILES: [Be+2].[O-]C([O-])=O - (ChemSpider: | SMILES=[Be+2].[O-]C([O-])=O )
Beryllium_chloride (1948)
```
Botcommand: addindex 363553898 Beryllium_chloride
```
```
For index : Beryllium_chloride=363553898
```
* 7787-47-5 -> 7787-47-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+chloride not found on commonchemistry - Beryllium+chloride

* No ChemSpiderID

* PubChem: 24588

* No InChI

* No SMILES
Beryllium_hydride (1950)
```
Botcommand: addindex 362940703 Beryllium_hydride
```
```
For index : Beryllium_hydride=362940703
```
* 7787-52-2 -> 7787-52-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+hydride not found on commonchemistry - Beryllium+hydride

* No ChemSpiderID

* PubChem: 139073

* No InChI

* No SMILES

1951 to 2000[edit]

Beryllium_hydroxide (1951)
```
Botcommand: addindex 356029972 Beryllium_hydroxide
```
```
For index : Beryllium_hydroxide=356029972
```
* 13327-32-7 -> 13327-32-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+hydroxide not found on commonchemistry - Beryllium+hydroxide

* No ChemSpiderID

* PubChem: 25879

* No InChI

* No SMILES
Beryllium_iodide (1952)
```
Botcommand: addindex 364805546 Beryllium_iodide
```
```
For index : Beryllium_iodide=364805546
```
* 7787-53-3 -> 7787-53-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+iodide not found on commonchemistry - Beryllium+iodide

* ChemSpiderID: 74209 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 82231

* InChI: 1/Be.2HI/h;2*1H/q+2;;/p-2 - (ChemSpider: | InChI=InChI=1/Be.2HI/h;2*1H/q+2;;/p-2 )

* SMILES: [Be+2].[I-].[I-] - (ChemSpider: | SMILES=[Be+2].[I-].[I-] )
Beryllium_nitride (1953)
```
Botcommand: addindex 320254289 Beryllium_nitride
```
```
For index : Beryllium_nitride=320254289
```
* 1304-54-7 -> 1304-54-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+nitride not found on commonchemistry - Beryllium+nitride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Beryllium_sulfate (1955)
```
Botcommand: addindex 343604079 Beryllium_sulfate
```
```
For index : Beryllium_sulfate=343604079
```
* 13510-49-1 -> 13510-49-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+sulfate not found on commonchemistry - Beryllium+sulfate

* ChemSpiderID: 24291 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 26077

* InChI: 1/Be.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2 - (ChemSpider: | InChI=InChI=1/Be.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2 )

* SMILES: [Be+2].[O-]S([O-])(=O)=O - (ChemSpider: | SMILES=[Be+2].[O-]S([O-])(=O)=O )
Beryllium_telluride (1956)
```
Botcommand: addindex 299844776 Beryllium_telluride
```
```
For index : Beryllium_telluride=299844776
```
* 12232-27-8 -> 12232-27-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Beryllium+telluride not found on commonchemistry - Beryllium+telluride

* No ChemSpiderID

* PubChem: 82991

* No InChI

* No SMILES
Besifloxacin (1957)
```
Botcommand: addindex 329850115 Besifloxacin
```
```
For index : Besifloxacin=329850115
```
* 141388-76-3 -> 141388-76-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Besifloxacin not found on commonchemistry - Besifloxacin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Besilesomab (1958)
```
Botcommand: addindex 359264597 Besilesomab
```
```
For index : Besilesomab=359264597
```
* 537694-98-7 -> 537694-98-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Besilesomab not found on commonchemistry - Besilesomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Besipirdine (1959)
```
Botcommand: addindex 358169893 Besipirdine
```
```
For index : Besipirdine=358169893
```
* 119257-34-0 -> 119257-34-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Besipirdine not found on commonchemistry - Besipirdine

* No ChemSpiderID

* PubChem: 60691

* No InChI

* No SMILES
Beta-2-Thienylalanine (1960)
```
Botcommand: addindex 335845771 Beta-2-Thienylalanine
```
```
For index : Beta-2-Thienylalanine=335845771
```
* 139-86-6 -> 139-86-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Thienylalanine not found on commonchemistry - Beta+Thienylalanine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Beta-Alanine_ethyl_ester (1962)
```
Botcommand: addindex 339385964 Beta-Alanine_ethyl_ester
```
```
For index : Beta-Alanine_ethyl_ester=339385964
```
* 924-73-2 -> 924-73-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Alanine+ethyl+ester not found on commonchemistry - Beta+Alanine+ethyl+ester

* No ChemSpiderID

* PubChem: 458475

* No InChI

* SMILES: CCOC(=O)CCN
Beta-Amanitin (1963)
```
Botcommand: addindex 335844681 Beta-Amanitin
```
```
For index : Beta-Amanitin=335844681
```
* 21150-22-1 -> 21150-22-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Amanitin not found on commonchemistry - Beta+Amanitin

* No ChemSpiderID

* PubChem: 2276

* No InChI

* SMILES: O=C(NCC(N[C@@](C(NCC(N[C@@H](C3)C(N[C@@H](CC(O)=O)C(N5[C@H]4C[C@@H](O)C5)=O)=O)=O)=O)([H])[C@@H](C)CC)=O)[C@H](CC1=C(S3=O)NC2=C1C=CC(O)=C2)NC([C@@]([C@@H](C)[C@@H](O)CO)([H])N[C@@]4=O)=O
Beta-Hydroxybutyryl-CoA (1970)

* No CASNo

* Beta+Hydroxybutyryl+CoA not found on commonchemistry - Beta+Hydroxybutyryl+CoA

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Beta-Methylamino-L-alanine (1971)
```
Botcommand: addindex 334280114 Beta-Methylamino-L-alanine
```
```
For index : Beta-Methylamino-L-alanine=334280114
```
* 15920-93-1 -> 15920-93-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Methylamino+L+alanine not found on commonchemistry - Beta+Methylamino+L+alanine

* No ChemSpiderID

* PubChem: 105089

* No InChI

* SMILES: OC([C@@H](N)CNC)=O
Beta-Phenylmethamphetamine (1974)
```
Botcommand: addindex 358126378 Beta-Phenylmethamphetamine
```
```
For index : Beta-Phenylmethamphetamine=358126378
```
* 768295-94-9 -> 768295-94-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Phenylmethamphetamine not found on commonchemistry - Beta+Phenylmethamphetamine

* No ChemSpiderID

* PubChem: 201042

* No InChI

* No SMILES
Beta-Tocopherol (1978)
```
Botcommand: addindex 333261469 Beta-Tocopherol
```
```
For index : Beta-Tocopherol=333261469
```
* 490-23-3 -> 490-23-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Tocopherol not found on commonchemistry - Beta+Tocopherol

* No ChemSpiderID

* PubChem: 86052

* No InChI

* SMILES: C[C@H](CCC[C@H](C)CCCC(C)C)CCC[C@@]2(C)OC1=C(C)C=C(O)C(C)=C1CC2
Beta-Ureidoisobutyric_acid (1979)
```
Botcommand: addindex 335844205 Beta-Ureidoisobutyric_acid
```
```
For index : Beta-Ureidoisobutyric_acid=335844205
```
* 2905-86-4 -> 2905-86-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+Ureidoisobutyric+acid not found on commonchemistry - Beta+Ureidoisobutyric+acid

* ChemSpiderID: 141172 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 160663

* InChI: 1/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10) - (ChemSpider: | InChI=InChI=1/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10) )

* SMILES: O=C(O)C(C)CNC(=O)N - (ChemSpider: | SMILES=O=C(O)C(C)CNC(=O)N )
Beta-lysine (1980)
```
Botcommand: addindex 357406562 Beta-lysine
```
```
For index : Beta-lysine=357406562
```
* 4299-56-3 -> 4299-56-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Beta+lysine not found on commonchemistry - Beta+lysine

* No ChemSpiderID

* PubChem: 392

* No InChI

* SMILES: C(CC(CC(=O)O)N)CN
Betaenone_B (1981)
```
Botcommand: addindex 360310671 Betaenone_B
```
```
For index : Betaenone_B=360310671
```
* 85269-23-4 -> 85269-23-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Betaenone+B not found on commonchemistry - Betaenone+B

* No ChemSpiderID

* PubChem: 158750

* No InChI

* No SMILES
Betamethasone_17-valerate (1986)
```
Botcommand: addindex 332825400 Betamethasone_17-valerate
```
```
For index : Betamethasone_17-valerate=332825400
```
* 2152-44-5 -> 2152-44-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Betamethasone+valerate not found on commonchemistry - Betamethasone+valerate

* ChemSpiderID: 15673 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 16533

* InChI: 1/C27H37FO6/c1-5-6-7-23(33)34-27(22(32)15-29)16(2)12-20-19-9-8-17-13-18(30)10-11-24(17,3)26(19,28)21(31)14-25(20,27)4/h10-11,13,16,19-21,29,31H,5-9,12,14-15H2,1-4H3/t16-,19-,20-,21-,24-,25-,26-,27-/m0/s1 - (ChemSpider: | InChI=InChI=1/C27H37FO6/c1-5-6-7-23(33)34-27(22(32)15-29)16(2)12-20-19-9-8-17-13-18(30)10-11-24(17,3)26(19,28)21(31)14-25(20,27)4/h10-11,13,16,19-21,29,31H,5-9,12,14-15H2,1-4H3/t16-,19-,20-,21-,24-,25-,26-,27-/m0/s1 )

* SMILES: O=C(O[C@@]3(C(=O)CO)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)CC[C@H]4[C@@H]2C[C@@H]3C)C)C)CCCC - (ChemSpider: | SMILES=O=C(O[C@@]3(C(=O)CO)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)CC[C@H]4[C@@H]2C[C@@H]3C)C)C)CCCC )
Betamethasone_dipropionate (1987)
```
Botcommand: addindex 359476554 Betamethasone_dipropionate
```
```
For index : Betamethasone_dipropionate=359476554
```
* 5593-20-4 -> 5593-20-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Betamethasone+dipropionate not found on commonchemistry - Betamethasone+dipropionate

* ChemSpiderID: 20490 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 21800

* No InChI - (ChemSpider: | InChI=InChI=1/C28H37FO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(OCC(=O)[C@]3(OC(=O)CC)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)CC[C@H]4[C@@H]2C[C@@H]3C)C)C)CC )
Betamipron (1989)

* No CASNo

* Betamipron not found on commonchemistry - Betamipron

* No ChemSpiderID

* PubChem: 71651

* No InChI

* No SMILES
Betanin (1990)
```
Botcommand: addindex 364365442 Betanin
```
```
For index : Betanin=364365442
```
* 7659-95-2 -> 7659-95-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Betanin not found on commonchemistry - Betanin

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OCC1[C@@H](O) [C@@H](O)[C@H] (O)[C@@H](OC2=C(O) C=C (/[N+]([C@@H] ([C@]([O-])=O) C4)=C/C=C3\C [C@H]([C@] (O)=O) NC(C(O)=O) =C3 )C4=C2)O1
Bethanidine (1994)
```
Botcommand: addindex 351150476 Bethanidine
```
```
For index : Bethanidine=351150476
```
* 55-73-2 -> 55-73-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bethanidine not found on commonchemistry - Bethanidine

* No ChemSpiderID

* PubChem: 2368

* No InChI

* No SMILES
Bevacizumab (1997)
```
Botcommand: addindex 364494904 Bevacizumab
```
```
For index : Bevacizumab=364494904
```
* 216974-75-3 -> 216974-75-3 - NOT VERIFIED

* CAS found on commonchemistry - 216974-75-3 - name not in list
All names: Immunoglobulin G1, anti-(human vascular endothelial growth factor) (human-mouse monoclonal rhuMAb-VEGF Î³1-chain), disulfide with human-mouse monoclonal rhuMAb-VEGF light chain, dimer

* Bevacizumab not found on commonchemistry - Bevacizumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bevirimat (1999)
```
Botcommand: addindex 355639218 Bevirimat
```
```
For index : Bevirimat=355639218
```
* 174022-42-5 -> 174022-42-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bevirimat not found on commonchemistry - Bevirimat

* No ChemSpiderID

* PubChem: 457928

* No InChI

* No SMILES
Bevonium (2000)
```
Botcommand: addindex 348545694 Bevonium
```
```
For index : Bevonium=348545694
```
* 33371-53-8 -> 33371-53-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bevonium not found on commonchemistry - Bevonium

* No ChemSpiderID

* PubChem: 31800

* No InChI

* No SMILES