<- User:Beetstra/listing41 - User:Beetstra/Validation - User:Beetstra/listing43 ->

Data[edit]

10251 to 10300[edit]

Tolpiprazole (10251)
```
Botcommand: addindex 358715502 Tolpiprazole
```
```
For index : Tolpiprazole=358715502
```
* 20326-13-0 -> 20326-13-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolpiprazole not found on commonchemistry - Tolpiprazole

* ChemSpiderID: 2341419 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3084338

* No InChI - (ChemSpider: | InChI=InChI=1/C17H24N4/c1-14-4-3-5-17(12-14)21-10-8-20(9-11-21)7-6-16-13-15(2)18-19-16/h3-5,12-13H,6-11H2,1-2H3,(H,18,19) )

* No SMILES - (ChemSpider: | smiles=n1c(cc(n1)C)CCN3CCN(c2cc(ccc2)C)CC3 )
Tolpropamine (10252)
```
Botcommand: addindex 337161567 Tolpropamine
```
```
For index : Tolpropamine=337161567
```
* 5632-44-0 -> 5632-44-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolpropamine not found on commonchemistry - Tolpropamine

* No ChemSpiderID

* PubChem: 72141

* No InChI

* No SMILES
Tolrestat (10253)
```
Botcommand: addindex 350101019 Tolrestat
```
```
For index : Tolrestat=350101019
```
* 82964-04-3 -> 82964-04-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolrestat not found on commonchemistry - Tolrestat

* No ChemSpiderID

* PubChem: 53359

* No InChI

* No SMILES
Toltrazuril (10255)
```
Botcommand: addindex 341850489 Toltrazuril
```
```
For index : Toltrazuril=341850489
```
* 69004-03-1 -> 69004-03-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Toltrazuril not found on commonchemistry - Toltrazuril

* No ChemSpiderID

* PubChem: 68591

* No InChI

* No SMILES
Toluene_diisocyanate (10257)
```
Botcommand: addindex 354165853 Toluene_diisocyanate
```
```
For index : Toluene_diisocyanate=354165853
```
* 584-84-9 -> 584-84-9 - NOT VERIFIED

* CAS found on commonchemistry - 584-84-9 - name in list
All names: 1,3-Diisocyanato-4-methylbenzene, 2,4-Diisocyanato-1-methylbenzene, 2,4-Diisocyanatotoluene, 2,4-DIISOCYANATOTOLUOL, 2,4-TDI, 2,4-TOLUENE DIISOCYANATE, 2,4-Toluene diisocyanate (2,4-TDI), 2,4-Toluylene diisocyanate, 2,4-Tolylene diisocyanate, 4-Methyl-1,3-phenylene diisocyanate, 4-Methyl-meta-phenylene diisocyanate, 4-Methyl-m-phenylendiisocyanat, 4-methyl-m-phenylene diisocyanate, 4-Methyl-m-phenylene isocyanate, BENZENE, 2,4-DIISOCYANATO-1-METHYL, Benzene, 2,4-diisocyanato-1-methyl-, diisocianato de 4-metil-m-fenileno, Diisocyanate de 4-methyl-m-phenylene, Isocyanic acid, 4-methyl-m-phenylene ester, NSC 4791, NSC 56759, See also 91-08-7, See also Isocyanate, TDI 100, Toluene 2,4-diisocyanate, TOLUENE, 2,4-DIISOCYANATE-, Toluene-2,4-diisocyanate, Tolulene-2,4-diisocyanate, UN 2078, UN 2078

* Toluene+diisocyanate found on commonchemistry - Toluene+diisocyanate
* 26471-62-5 (Formula: C9H6N2O2; Name: Benzene, 1,3-diisocyanatomethyl-)

* 584-84-9 (Formula: C9H6N2O2; Name: Benzene, 2,4-diisocyanato-1-methyl-) Matches CAS (584-84-9) on page

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: c1(C)c(N=C=O)cc(N=C=O)cc1
Tolufazepam (10258)
```
Botcommand: addindex 347849448 Tolufazepam
```
```
For index : Tolufazepam=347849448
```
* 86273-92-9 -> 86273-92-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolufazepam not found on commonchemistry - Tolufazepam

* No ChemSpiderID

* PubChem: 65647

* No InChI

* No SMILES
Tolvaptan (10259)
```
Botcommand: addindex 356551240 Tolvaptan
```
```
For index : Tolvaptan=356551240
```
* 150683-30-0 -> 150683-30-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tolvaptan not found on commonchemistry - Tolvaptan

* No ChemSpiderID

* PubChem: 443894

* No InChI

* No SMILES
Tomatine (10260)
```
Botcommand: addindex 352611588 Tomatine
```
```
For index : Tomatine=352611588
```
* 17406-45-0 -> 17406-45-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tomatine not found on commonchemistry - Tomatine

* No ChemSpiderID

* PubChem: 623058

* No InChI

* SMILES: [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])C[C@]3([H])O[C@@]5(CC[C@H](C)CN5)[C@@H](C)[C@]43[H])[C@@]1(C)CC[C@@H](C2)O[C@@H]1O[C@H](CO)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O
Topotecan (10262)
```
Botcommand: addindex 362002475 Topotecan
```
```
For index : Topotecan=362002475
```
* 123948-87-8 -> 123948-87-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Topotecan not found on commonchemistry - Topotecan

* No ChemSpiderID

* PubChem: 6419854

* No InChI

* No SMILES
Toralizumab (10263)
```
Botcommand: addindex 354152041 Toralizumab
```
```
For index : Toralizumab=354152041
```
* 252662-47-8 -> 252662-47-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Toralizumab not found on commonchemistry - Toralizumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Torcetrapib (10265)
```
Botcommand: addindex 355613538 Torcetrapib
```
```
For index : Torcetrapib=355613538
```
* 262352-17-0 -> 262352-17-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Torcetrapib not found on commonchemistry - Torcetrapib

* No ChemSpiderID

* PubChem: 159325

* No InChI

* No SMILES
Torezolid (10267)
```
Botcommand: addindex 353053470 Torezolid
```
```
For index : Torezolid=353053470
```
* 856866-72-3 -> 856866-72-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Torezolid not found on commonchemistry - Torezolid

* ChemSpiderID: 9409096 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C17H15FN6O3/c1-23-21-16(20-22-23)15-5-2-10(7-19-15)13-4-3-11(6-14(13)18)24-8-12(9-25)27-17(24)26/h2-7,12,25H,8-9H2,1H3/t12-/m1/s1 )

* No SMILES - (ChemSpider: | smiles=O=C4O[C@H](CN4c3cc(F)c(c1ccc(nc1)c2nn(nn2)C)cc3)CO )
Tositumomab (10268)
```
Botcommand: addindex 354152328 Tositumomab
```
```
For index : Tositumomab=354152328
```
* 192391-48-3 -> 192391-48-3 - NOT VERIFIED

* CAS found on commonchemistry - 192391-48-3 - name not in list
All names: Immunoglobulin G2a, anti-(human CD20 (antigen)) (mouse monoclonal clone B1R1 Î³2a-chain), disulfide with mouse monoclonal clone B1R1 Î»x-chain, dimer, iodine-131I salt

* Tositumomab not found on commonchemistry - Tositumomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tosufloxacin (10269)
```
Botcommand: addindex 356395584 Tosufloxacin
```
```
For index : Tosufloxacin=356395584
```
* 100490-36-6 -> 100490-36-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tosufloxacin not found on commonchemistry - Tosufloxacin

* No ChemSpiderID

* PubChem: 5517

* No InChI

* No SMILES
Tosyl_phenylalanyl_chloromethyl_ketone (10270)
```
Botcommand: addindex 332542285 Tosyl_phenylalanyl_chloromethyl_ketone
```
```
For index : Tosyl_phenylalanyl_chloromethyl_ketone=332542285
```
* 402-71-1 -> 402-71-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tosyl+phenylalanyl+chloromethyl+ketone not found on commonchemistry - Tosyl+phenylalanyl+chloromethyl+ketone

* No ChemSpiderID

* PubChem: 439647

* No InChI

* No SMILES
Totarol (10272)
```
Botcommand: addindex 355909014 Totarol
```
```
For index : Totarol=355909014
```
* 511-15-9 -> 511-15-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Totarol not found on commonchemistry - Totarol

* No ChemSpiderID

* PubChem: 92783

* No InChI

* SMILES: CC(C)C1=C(C=CC2=C1CC[C@@H]3[C@@]2(CCCC3(C)C)C)O
Toxaphene (10273)
```
Botcommand: addindex 362095647 Toxaphene
```
```
For index : Toxaphene=362095647
```
* 8001-35-2 -> 8001-35-2 - NOT VERIFIED

* CAS found on commonchemistry - 8001-35-2 - name in list
All names: Alltox, Anatox, Camphechlor, Camphene, octachloro-, Camphochlor, Canfeclor, Chlorinated camphene, Estonox, Geniphene, Hercules 3956, Kamfochlor, M 5055, Melipax, Octachlorocamphene, PCC, PChK, PChK (insecticide), Phenacide, Phenatox, PKhF, [[Polychloro-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane]], Polychlorocamphene, Strobane T, toxafeno, Toxakil, Toxaphen, Toxaphen, toxaphene, Toxaphene, Toxyphen, UN 2761

* Toxaphene found on commonchemistry - Toxaphene
* 8001-35-2 (exact match) Matches CAS (8001-35-2) on page
Name in list

All names: Alltox, Anatox, Camphechlor, Camphene, octachloro-, Camphochlor, Canfeclor, Chlorinated camphene, Estonox, Geniphene, Hercules 3956, Kamfochlor, M 5055, Melipax, Octachlorocamphene, PCC, PChK, PChK (insecticide), Phenacide, Phenatox, PKhF, [[Polychloro-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane]], Polychlorocamphene, Strobane T, toxafeno, Toxakil, Toxaphen, Toxaphen, [[toxaphene]], [[toxaphene]], Toxyphen, UN 2761

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C=C1C(C2(C(C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)(CCl)CCl
Toxiferine (10274)
```
Botcommand: addindex 351596138 Toxiferine
```
```
For index : Toxiferine=351596138
```
* 302-30-7 -> 302-30-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Toxiferine not found on commonchemistry - Toxiferine

* ChemSpiderID: 4444760 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5281411

* No InChI - (ChemSpider: | InChI=InChI=1/C40H46N4O2/c1-43-15-13-39-31-7-3-5-9-33(31)41-22-30-28-20-36-40(14-16-44(36,2)24-26(28)12-18-46)32-8-4-6-10-34(32)42(38(30)40)21-29(37(39)41)27(19-35(39)43)25(23-43)11-17-45/h3-12,21-22,27-28,35-38,45-46H,13-20,23-24H2,1-2H3/q+2/b25-11-,26-12-,29-21-,30-22-/t27-,28-,35-,36-,37-,38-,39+,40+,43-,44-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=OC/C=C8/C[N@+]9(C)CC[C@]7%10c%11ccccc%11N6\C=C3/[C@@H]2N(c1ccccc1[C@@]25CC[N@@+]4(C)C/C(=C/CO)[C@@H]3C[C@H]45)/C=C(\[C@H]67)[C@H]8C[C@H]9%10 )
Tppts (10275)
```
Botcommand: addindex 300447053 Tppts
```
```
For index : Tppts=300447053
```
* 63995-70-0 -> 63995-70-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tppts not found on commonchemistry - Tppts

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trabectedin (10276)
```
Botcommand: addindex 355099751 Trabectedin
```
```
For index : Trabectedin=355099751
```
* 114899-77-3 -> 114899-77-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trabectedin not found on commonchemistry - Trabectedin

* No ChemSpiderID

* PubChem: 108150

* No InChI

* No SMILES
Tracazolate (10277)
```
Botcommand: addindex 345429924 Tracazolate
```
```
For index : Tracazolate=345429924
```
* 41094-88-6 -> 41094-88-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tracazolate not found on commonchemistry - Tracazolate

* No ChemSpiderID

* PubChem: 5522

* No InChI

* No SMILES
Tramazoline (10280)
```
Botcommand: addindex 354506799 Tramazoline
```
```
For index : Tramazoline=354506799
```
* 1082-57-1 -> 1082-57-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tramazoline not found on commonchemistry - Tramazoline

* No ChemSpiderID

* PubChem: 5524

* No InChI

* No SMILES
Tranilast (10283)
```
Botcommand: addindex 343865534 Tranilast
```
```
For index : Tranilast=343865534
```
* 53902-12-8 -> 53902-12-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tranilast not found on commonchemistry - Tranilast

* No ChemSpiderID

* PubChem: 5282230

* No InChI

* No SMILES
Trans-1,2-Diaminocyclohexane (10284)
```
Botcommand: addindex 321639713 Trans-1,2-Diaminocyclohexane
```
```
For index : Trans-1,2-Diaminocyclohexane=321639713
```
* 1121-22-8 -> 1121-22-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Trans+Diaminocyclohexane not found on commonchemistry - Trans+Diaminocyclohexane

* No ChemSpiderID

* PubChem: 24856187

* No InChI

* No SMILES
Trans-2,3-Butylene_carbonate (10285)
```
Botcommand: addindex 363312496 Trans-2,3-Butylene_carbonate
```
```
For index : Trans-2,3-Butylene_carbonate=363312496
```
* 51260-48-1 -> 51260-48-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trans+Butylene+carbonate not found on commonchemistry - Trans+Butylene+carbonate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C1O[C@@H](C)[C@H](C)O1
Trans-2-Methyl-2-butenal (10286)
```
Botcommand: addindex 331578576 Trans-2-Methyl-2-butenal
```
```
For index : Trans-2-Methyl-2-butenal=331578576
```
* 497-03-0 -> 497-03-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Trans+Methyl+butenal not found on commonchemistry - Trans+Methyl+butenal

* No ChemSpiderID

* PubChem: 24901527

* No InChI

* No SMILES
Trans-2-Phenyl-1-cyclohexanol (10287)
```
Botcommand: addindex 321639787 Trans-2-Phenyl-1-cyclohexanol
```
```
For index : Trans-2-Phenyl-1-cyclohexanol=321639787
```
* 34281-92-0 -> 34281-92-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Trans+Phenyl+cyclohexanol not found on commonchemistry - Trans+Phenyl+cyclohexanol

* No ChemSpiderID

* PubChem: 9898975

* No InChI

* SMILES: C1CCC(C(C1)C2=CC=CC=C2)O
Trans-diptoindonesin_B (10288)
* No CASNo

* Trans+diptoindonesin+B not found on commonchemistry - Trans+diptoindonesin+B

* No ChemSpiderID

* PubChem: 643710

* No InChI

* SMILES: C1=CC(=CC=C1C2C(C3=C(O2)C=C(C=C3C4C(OC5=C4C=C(C=C5)C=CC6=CC(=CC(=C6)O)O)C7=CC=C(C=C7)O)O)C8=CC(=CC(=C8)O)O)O
Transfluthrin (10289)
```
Botcommand: addindex 362255325 Transfluthrin
```
```
For index : Transfluthrin=362255325
```
* 118712-89-3 -> 118712-89-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Transfluthrin not found on commonchemistry - Transfluthrin

* No ChemSpiderID

* PubChem: 656612

* No InChI

* SMILES: CC1(C(C1C(=O)OCC2=C(C(=CC(=C2F)F)F)F)C=C(Cl)Cl)C
Trapidil (10291)

* No CASNo

* Trapidil not found on commonchemistry - Trapidil

* No ChemSpiderID

* PubChem: 5531

* No InChI

* No SMILES
Trastuzumab (10292)
```
Botcommand: addindex 364037150 Trastuzumab
```
```
For index : Trastuzumab=364037150
```
* 180288-69-1 -> 180288-69-1 - NOT VERIFIED

* CAS found on commonchemistry - 180288-69-1 - name not in list
All names: Immunoglobulin G1, anti-(human p185neureceptor) (human-mouse monoclonal rhuMab HER2 Î³1-chain), disulfide with human-mouse monoclonal rhuMab HER2 light chain, dimer

* Trastuzumab not found on commonchemistry - Trastuzumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Traumatic_acid (10293)
```
Botcommand: addindex 342888808 Traumatic_acid
```
```
For index : Traumatic_acid=342888808
```
* 6402-36-4 -> 6402-36-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Traumatic+acid not found on commonchemistry - Traumatic+acid

* No ChemSpiderID

* PubChem: 5283028

* No InChI

* SMILES: O=C(O)/C=C/CCCCCCCCC(O)=O
Traumatin (10294)
```
Botcommand: addindex 314974437 Traumatin
```
```
For index : Traumatin=314974437
```
* 65410-38-0 -> 65410-38-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Traumatin not found on commonchemistry - Traumatin

* No ChemSpiderID

* PubChem: 5312889

* No InChI

* SMILES: O=C/C=C/CCCCCCCCC(O)=O
Trazium (10296)
```
Botcommand: addindex 359756080 Trazium
```
```
For index : Trazium=359756080
```
* 97110-59-3 -> 97110-59-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trazium not found on commonchemistry - Trazium

* ChemSpiderID: 65139 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 72166

* No InChI - (ChemSpider: | InChI=InChI=1/C17H13ClN3O.C2H6O3S/c18-14-7-5-13(6-8-14)17(22)16-15-4-2-1-3-12(15)9-10-21(16)20-11-19-17;1-2-6(3,4)5/h1-11,22H,(H,19,20);2H2,1H3,(H,3,4,5)/q+1;/p-1 )

* No SMILES - (ChemSpider: | smiles=[O-]S(=O)(=O)CC.Clc1ccc(cc1)C4(O)/N=C\N[n+]3c4c2c(cccc2)cc3 )
Trefentanil (10298)
```
Botcommand: addindex 344100039 Trefentanil
```
```
For index : Trefentanil=344100039
```
* 120656-93-1 -> 120656-93-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trefentanil not found on commonchemistry - Trefentanil

* No ChemSpiderID

* PubChem: 60728

* No InChI

* No SMILES
Trehalose_dimycolate (10300)

* No CASNo

* Trehalose+dimycolate not found on commonchemistry - Trehalose+dimycolate

* No ChemSpiderID

* PubChem: 451713

* No InChI

* SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCC(C(CCCCCCCCCCC1CC1CCCCCCCCCCCCCCCCCC)C(=O)OCC2C(C(C(C(O2)OC3C(C(C(C(O3)COC(=O)C(CCCCCCCCCCCCCCCCCCCCCCCC)C(CCCCCCCCCCCC4CC4CCCCCCCCCCCCCCCCCC)O)O)O)O)O)O)O)O

10301 to 10350[edit]

Tremelimumab (10301)
```
Botcommand: addindex 354151053 Tremelimumab
```
```
For index : Tremelimumab=354151053
```
* 745013-59-6 -> 745013-59-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tremelimumab not found on commonchemistry - Tremelimumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trenbolone (10302)
```
Botcommand: addindex 365269536 Trenbolone
```
```
For index : Trenbolone=365269536
```
* 10161-33-8 -> 10161-33-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Trenbolone not found on commonchemistry - Trenbolone

* ChemSpiderID: 23383 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 25015

* No InChI - (ChemSpider: | InChI=InChI=1/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-17,20H,2-7H2,1H3/t15-,16+,17+,18+/m1/s1 )

* No SMILES - (ChemSpider: | smiles=O=C4\C=C2/C(=C1/C=C\[C@@]3([C@@H](O)CC[C@H]3[C@@H]1CC2)C)CC4 )
Treosulfan (10303)

* No CASNo

* Treosulfan not found on commonchemistry - Treosulfan

* No ChemSpiderID

* PubChem: 9296

* No InChI

* No SMILES
Trepibutone (10304)
```
Botcommand: addindex 348542525 Trepibutone
```
```
For index : Trepibutone=348542525
```
* 41826-92-0 -> 41826-92-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Trepibutone not found on commonchemistry - Trepibutone

* No ChemSpiderID

* PubChem: 5536

* No InChI

* No SMILES
Treprostinil (10305)
* No CASNo

* Treprostinil not found on commonchemistry - Treprostinil

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trestolone (10306)
```
Botcommand: addindex 313583029 Trestolone
```
```
For index : Trestolone=313583029
```
* 3764-87-2 -> 3764-87-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Trestolone not found on commonchemistry - Trestolone

* No ChemSpiderID

* PubChem: 9838899

* No InChI

* No SMILES
Tretoquinol (10308)
```
Botcommand: addindex 350300423 Tretoquinol
```
```
For index : Tretoquinol=350300423
```
* 30418-38-3 -> 30418-38-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tretoquinol not found on commonchemistry - Tretoquinol

* No ChemSpiderID

* PubChem: 65772

* No InChI

* SMILES: COC1=CC(=CC(=C1OC)OC)C[C@H]2C3=CC(=C(C=C3CCN2)O)O
Triacetone_amine (10310)
```
Botcommand: addindex 265825344 Triacetone_amine
```
```
For index : Triacetone_amine=265825344
```
* 826-36-8 -> 826-36-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Triacetone+amine not found on commonchemistry - Triacetone+amine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C1CC(C)(C)NC(C)(C)C1
Triacsin_C (10312)
```
Botcommand: addindex 290570589 Triacsin_C
```
```
For index : Triacsin_C=290570589
```
* 76896-80-5 -> 76896-80-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Triacsin+C not found on commonchemistry - Triacsin+C

* No ChemSpiderID

* PubChem: 24900214

* No InChI

* No SMILES
Triazabicyclodecene (10316)
```
Botcommand: addindex 298634622 Triazabicyclodecene
```
```
For index : Triazabicyclodecene=298634622
```
* 5807-14-7 -> 5807-14-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Triazabicyclodecene not found on commonchemistry - Triazabicyclodecene

* No ChemSpiderID

* PubChem: 79873

* No InChI

* SMILES: C1CNC2=NCCCN2C1
Triaziquone (10317)
```
Botcommand: addindex 338850432 Triaziquone
```
```
For index : Triaziquone=338850432
```
* 68-76-8 -> 68-76-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Triaziquone not found on commonchemistry - Triaziquone

* No ChemSpiderID

* PubChem: 6235

* No InChI

* No SMILES
Tribendimidine (10319)
```
Botcommand: addindex 364865641 Tribendimidine
```
```
For index : Tribendimidine=364865641
```
* 115103-15-6 -> 115103-15-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tribendimidine not found on commonchemistry - Tribendimidine

* No ChemSpiderID

* PubChem: 3086564

* No InChI

* No SMILES
Tribenoside (10320)
```
Botcommand: addindex 266756366 Tribenoside
```
```
For index : Tribenoside=266756366
```
* 10310-32-4 -> 10310-32-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tribenoside not found on commonchemistry - Tribenoside

* No ChemSpiderID

* PubChem: 25145

* No InChI

* No SMILES
Tribromofluoromethane (10321)
```
Botcommand: addindex 341851183 Tribromofluoromethane
```
```
For index : Tribromofluoromethane=341851183
```
* 353-54-8 -> 353-54-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tribromofluoromethane not found on commonchemistry - Tribromofluoromethane

* No ChemSpiderID

* PubChem: 67707

* InChI: 1/CBr3F/c2-1(3,4)5

* SMILES: C(F)(Br)(Br)Br
Tribromoisocyanuric_acid (10322)
```
Botcommand: addindex 338910816 Tribromoisocyanuric_acid
```
```
For index : Tribromoisocyanuric_acid=338910816
```
* 17497-85-7 -> 17497-85-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tribromoisocyanuric+acid not found on commonchemistry - Tribromoisocyanuric+acid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(=O)N(C(=O)N(C(=O)N1Br)Br)Br
Tribromometacresol (10323)
```
Botcommand: addindex 273475563 Tribromometacresol
```
```
For index : Tribromometacresol=273475563
```
* 4619-74-3 -> 4619-74-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tribromometacresol not found on commonchemistry - Tribromometacresol

* No ChemSpiderID

* PubChem: 20737

* No InChI

* No SMILES
Tricaine_mesylate (10327)
```
Botcommand: addindex 356461561 Tricaine_mesylate
```
```
For index : Tricaine_mesylate=356461561
```
* 886-86-2 -> 886-86-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tricaine+mesylate not found on commonchemistry - Tricaine+mesylate

* No ChemSpiderID

* PubChem: 261501

* No InChI

* No SMILES
Tricalcium_aluminate (10328)
```
Botcommand: addindex 318704826 Tricalcium_aluminate
```
```
For index : Tricalcium_aluminate=318704826
```
* 12042-78-3 -> 12042-78-3 - NOT VERIFIED

* CAS found on commonchemistry - 12042-78-3 - name in list
All names: Aluminate (AlO33-), calcium (2:3), Aluminate, (AlO33-), calcium (2:3), Aluminum calcium oxide (Al2Ca3O6), Aluminum calcium oxide (Ca3Al2O6), C3A, C3A (cement component), Calcium aluminate, Calcium aluminate (Al2Ca3O6), Calcium aluminate (Ca3Al2O6), Calcium aluminum oxide (Ca3Al2O6), Denka Cosmic, dialuminium tricalcium hexaoxide, Dialuminiumtricalciumhexaoxid, hexaoxido de dialuminio y tricalcio, Hexaoxyde de dialuminium et de tricalcium, NCA 103, NCA 703, Tricalcium aluminate

* Tricalcium+aluminate found on commonchemistry - Tricalcium+aluminate
* 12042-78-3 (exact match) Matches CAS (12042-78-3) on page
Name in list

All names: Aluminate (AlO33-), calcium (2:3), Aluminate, (AlO33-), calcium (2:3), Aluminum calcium oxide (Al2Ca3O6), Aluminum calcium oxide (Ca3Al2O6), C3A, C3A (cement component), Calcium aluminate, Calcium aluminate (Al2Ca3O6), Calcium aluminate (Ca3Al2O6), Calcium aluminum oxide (Ca3Al2O6), Denka Cosmic, dialuminium tricalcium hexaoxide, Dialuminiumtricalciumhexaoxid, hexaoxido de dialuminio y tricalcio, Hexaoxyde de dialuminium et de tricalcium, NCA 103, NCA 703, [[tricalcium aluminate]]

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tricetinidin (10330)
```
Botcommand: addindex 343472416 Tricetinidin
```
```
For index : Tricetinidin=343472416
```
* 65618-21-5 -> 65618-21-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tricetinidin not found on commonchemistry - Tricetinidin

* No ChemSpiderID

* PubChem: 14496542

* No InChI

* SMILES: C1=CC(=[O+]C2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O.[Cl-]
Trichloro(dichlorophenyl)silane (10332)
```
Botcommand: addindex 357448868 Trichloro(dichlorophenyl)silane
```
```
For index : Trichloro(dichlorophenyl)silane=357448868
```
* 27137-85-5 -> 27137-85-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Trichloro+dichlorophenyl+silane not found on commonchemistry - Trichloro+dichlorophenyl+silane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trichloroethylsilane (10336)

* No CASNo

* Trichloroethylsilane not found on commonchemistry - Trichloroethylsilane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trichlorophenylsilane (10339)

* No CASNo

* Trichlorophenylsilane found on commonchemistry - Trichlorophenylsilane
* 98-13-5 (exact match)
Name in list

All names: (Trichlorosilyl)benzene, Benzene, (trichlorosilyl)-, KA 103, NSC 77080, PHENYL TRICHLOROSILANE, Phenylsilicon trichloride, Phenylsilyl trichloride, Phenyltrichlorosilane, Silane, trichlorophenyl-, Silicon phenyl trichloride, Trichlor(phenyl)silan, Trichloro(phenyl)silane, [[trichlorophenylsilane]], TRICHLOR-PHENYL-SILAN, tricloro(fenil)silano, TSL 8063, UN 1804

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trichodermin (10341)
```
Botcommand: addindex 337746819 Trichodermin
```
```
For index : Trichodermin=337746819
```
* 4682-50-2 -> 4682-50-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Trichodermin not found on commonchemistry - Trichodermin

* No ChemSpiderID

* PubChem: 20806

* No InChI

* SMILES: CC1=C[C@@H]2[C@](CC1)([C@]3([C@@H](C[C@H]([C@@]34CO4)O2)OC(=O)C)C)C
Trichostatin_A (10342)
```
Botcommand: addindex 356401000 Trichostatin_A
```
```
For index : Trichostatin_A=356401000
```
* 58880-19-6 -> 58880-19-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Trichostatin+A not found on commonchemistry - Trichostatin+A

* No ChemSpiderID

* PubChem: 444732

* No InChI

* No SMILES
Trichotomine (10343)
```
Botcommand: addindex 308090632 Trichotomine
```
```
For index : Trichotomine=308090632
```
* 53472-14-3 -> 53472-14-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trichotomine not found on commonchemistry - Trichotomine

* No ChemSpiderID

* PubChem: 5281412

* No InChI

* SMILES: C1[C@H](N2C(=C/C(=C\3/C=C4C5=C(C[C@H](N4C3=O)C(=O)O)C6=CC=CC=C6N5)/C2=O)C7=C1C8=CC=CC=C8N7)C(=O)O
Tricin (10344)
```
Botcommand: addindex 354916717 Tricin
```
```
For index : Tricin=354916717
```
* 520-32-1 -> 520-32-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tricin found on commonchemistry - Tricin
* 76-25-5 (Formula: C24H31FO6; Name: Pregna-1,4-diene-3,20-dione, 9-fluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-, (11Î²,16Î±)-)

* 546-46-3 (Formula: C6H8O7.3/2Zn; Name: 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, zinc salt (2:3))

* 1314-84-7 (Formula: P2Zn3; Name: Zinc phosphide, (Zn3P2))

* 7779-90-0 (Formula: H3O4P.3/2Zn; Name: Phosphoric acid, zinc salt (2:3))

* No ChemSpiderID

* PubChem: 5281702

* No InChI

* SMILES: COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)O)O
Tricine (10345)
```
Botcommand: addindex 354916315 Tricine
```
```
For index : Tricine=354916315
```
* 5704-04-1 -> 5704-04-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tricine not found on commonchemistry - Tricine

* No ChemSpiderID

* PubChem: 79784

* No InChI

* SMILES: OC(CNC(CO)(CO)CO)=O
Triclabendazole (10346)
```
Botcommand: addindex 359341164 Triclabendazole
```
```
For index : Triclabendazole=359341164
```
* 68786-66-3 -> 68786-66-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Triclabendazole not found on commonchemistry - Triclabendazole

* No ChemSpiderID

* PubChem: 50248

* No InChI

* No SMILES
Triclofos (10348)
```
Botcommand: addindex 349928527 Triclofos
```
```
For index : Triclofos=349928527
```
* 306-52-5 -> 306-52-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Triclofos not found on commonchemistry - Triclofos

* No ChemSpiderID

* PubChem: 5563

* No InChI

* No SMILES
Triclopyr (10349)
```
Botcommand: addindex 359438098 Triclopyr
```
```
For index : Triclopyr=359438098
```
* 55335-06-3 -> 55335-06-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Triclopyr found on commonchemistry - Triclopyr
* 57213-69-1 (Formula: C7H4Cl3NO3.C6H15N; Name: Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, compd. withN,N-diethylethanamine (1:1))

* 64700-56-7 (Formula: C13H16Cl3NO4; Name: Acetic acid, [(3,5,6-trichloro-2-pyridinyl)oxy]-, 2-butoxyethyl ester)

* No ChemSpiderID

* No PubChem

* InChI: 1/C7H4Cl3NO3/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13/h1H,2H2,(H,12,13)

* SMILES: ClC1=C(OCC(O)=O)N=C(Cl)C(Cl)=C1

10351 to 10400[edit]

Tricyanoaminopropene (10352)
```
Botcommand: addindex 356694419 Tricyanoaminopropene
```
```
For index : Tricyanoaminopropene=356694419
```
* 868-54-2 -> 868-54-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tricyanoaminopropene not found on commonchemistry - Tricyanoaminopropene

* No ChemSpiderID

* PubChem: 13356

* No InChI

* No SMILES
Tricyclobutabenzene (10353)

* No CASNo

* Tricyclobutabenzene not found on commonchemistry - Tricyclobutabenzene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triethyl_borate (10358)
```
Botcommand: addindex 352359497 Triethyl_borate
```
```
For index : Triethyl_borate=352359497
```
* 150-46-9 -> 150-46-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Triethyl+borate not found on commonchemistry - Triethyl+borate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCOB(OCC)OCC
Triethyl_orthoacetate (10360)
```
Botcommand: addindex 353152517 Triethyl_orthoacetate
```
```
For index : Triethyl_orthoacetate=353152517
```
* 78-39-7 -> 78-39-7 - NOT VERIFIED

* CAS found on commonchemistry - 78-39-7 - name in list
All names: 1,1,1-Triethoxyethane, Ethane, 1,1,1-triethoxy-, Ethyl orthoacetate, NSC 5596, orthoacetate de triethyle, Orthoacetic acid, triethyl ester, ortoacetato de trietilo, triethyl orthoacetate, Triethylorthoacetat

* Triethyl+orthoacetate found on commonchemistry - Triethyl+orthoacetate
* 78-39-7 (exact match) Matches CAS (78-39-7) on page
Name in list

All names: 1,1,1-Triethoxyethane, Ethane, 1,1,1-triethoxy-, Ethyl orthoacetate, NSC 5596, orthoacetate de triethyle, Orthoacetic acid, triethyl ester, ortoacetato de trietilo, [[triethyl orthoacetate]], Triethylorthoacetat

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triethylamine_hydrochloride (10367)
File:Triethylamine hydrochloride.gif
```
Botcommand: addindex 318746613 Triethylamine_hydrochloride
```
```
For index : Triethylamine_hydrochloride=318746613
```
* 554-68-7 -> 554-68-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Triethylamine+hydrochloride found on commonchemistry - Triethylamine+hydrochloride
* 134-80-5 (exact match)
Name in list

All names: 1-Phenyl-2-(diethylamino)propanone-1 hydrochloride, 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride, 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride (1:1), 2-(Diethylamino)propiophenone hydrochloride, Amfepramon hydrochloride, amfepramone hydrochloride, Amfepramone, chlorhydrate, Amfepramonhydrochlorid, Amphepramonum hydrochloride, Anfamon, anfepramona, clorhidrato, Anorex, Danylen, Diethylpropion hydrochloride, Diethylpropione hydrochloride, Dobesin, Fepranon, Frekentine, Keramik, Keramin, Moderatan, Modulor, Parabolin, Phepranon, Prefamone, Propiophenone, 2-(diethylamino)-, hydrochloride, Regenon, Regenon hydrochloride, Tenuate, Tenuate hydrochloride, Tenuate-Dospan, Tepanil, Tylinal, Î±-(Diethylamino)propiophenone hydrochloride, [[Î±-Benzoyltriethylamine hydrochloride]], Î±-Benzoyltriethylammonium chloride

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCN(CC)CC.Cl
Triethylammonium_acetate (10368)
```
Botcommand: addindex 323345057 Triethylammonium_acetate
```
```
For index : Triethylammonium_acetate=323345057
```
* 5204-74-0 -> 5204-74-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Triethylammonium+acetate not found on commonchemistry - Triethylammonium+acetate

* No ChemSpiderID

* PubChem: 165295

* No InChI

* SMILES: CC[NH](CC)CC.[O-]C(C)=O
Triethylcholine (10370)
```
Botcommand: addindex 272330603 Triethylcholine
```
```
For index : Triethylcholine=272330603
```
* 302-61-4 -> 302-61-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Triethylcholine not found on commonchemistry - Triethylcholine

* No ChemSpiderID

* PubChem: 80058

* No InChI

* SMILES: CC[N+](CC)(CC)CCO
Triethylene_glycol_dinitrate (10372)
```
Botcommand: addindex 316641775 Triethylene_glycol_dinitrate
```
```
For index : Triethylene_glycol_dinitrate=316641775
```
* 111-22-8 -> 111-22-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Triethylene+glycol+dinitrate not found on commonchemistry - Triethylene+glycol+dinitrate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C(CO[N+](=O)[O-])OCCOCCO[N+](=O)[O-]
Triethyloxonium_tetrafluoroborate (10375)
```
Botcommand: addindex 360871959 Triethyloxonium_tetrafluoroborate
```
```
For index : Triethyloxonium_tetrafluoroborate=360871959
```
* 368-39-8 -> 368-39-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Triethyloxonium+tetrafluoroborate not found on commonchemistry - Triethyloxonium+tetrafluoroborate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triflubazam (10377)
```
Botcommand: addindex 347853697 Triflubazam
```
```
For index : Triflubazam=347853697
```
* 22365-40-8 -> 22365-40-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Triflubazam not found on commonchemistry - Triflubazam

* No ChemSpiderID

* PubChem: 31157

* No InChI

* No SMILES
Trifluoromethanesulfonyl_azide (10384)
```
Botcommand: addindex 362802899 Trifluoromethanesulfonyl_azide
```
```
For index : Trifluoromethanesulfonyl_azide=362802899
```
* 3855-45-6 -> 3855-45-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Trifluoromethanesulfonyl+azide not found on commonchemistry - Trifluoromethanesulfonyl+azide

* ChemSpiderID: 9161983 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10986786

* InChI: InChI=1S/CF3N3O2S/c2-1(3,4)10(8,9)7-6-5 - (ChemSpider: | InChI=InChI=1/CF3N3O2S/c2-1(3,4)10(8,9)7-6-5 )

* SMILES: FC(F)(F)S(=O)(=O)\N=[N+]=[N-] - (ChemSpider: | SMILES=FC(F)(F)S(=O)(=O)\N=[N+]=[N-] )
Trifluoromethylaminoindane (10385)

* No CASNo

* Trifluoromethylaminoindane not found on commonchemistry - Trifluoromethylaminoindane

* No ChemSpiderID

* PubChem: 10420351

* No InChI

* No SMILES
Trifluoromethylisocyanide (10386)
```
Botcommand: addindex 293349321 Trifluoromethylisocyanide
```
```
For index : Trifluoromethylisocyanide=293349321
```
* 105879-13-8 -> 105879-13-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Trifluoromethylisocyanide not found on commonchemistry - Trifluoromethylisocyanide

* ChemSpiderID: 128288 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 145434

* No InChI - (ChemSpider: | InChI=InChI=1/C2F3N/c1-6-2(3,4)5 )

* SMILES: [C-]#[N+]C(F)(F)F - (ChemSpider: | SMILES=[C-]#[N+]C(F)(F)F )
Trifluoromethylphenylpiperazine (10387)
```
Botcommand: addindex 359819728 Trifluoromethylphenylpiperazine
```
```
For index : Trifluoromethylphenylpiperazine=359819728
```
* 15532-75-9 -> 15532-75-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Trifluoromethylphenylpiperazine not found on commonchemistry - Trifluoromethylphenylpiperazine

* ChemSpiderID: 4145 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 4296

* No InChI - (ChemSpider: | InChI=InChI=1/C11H13F3N2/c12-11(13,14)9-2-1-3-10(8-9)16-6-4-15-5-7-16/h1-3,8,15H,4-7H2 )

* No SMILES - (ChemSpider: | smiles=FC(F)(F)c1cc(ccc1)N2CCNCC2 )
Trifluoromethyltrimethylsilane (10388)
```
Botcommand: addindex 360331415 Trifluoromethyltrimethylsilane
```
```
For index : Trifluoromethyltrimethylsilane=360331415
```
* 81290-20-2 -> 81290-20-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Trifluoromethyltrimethylsilane not found on commonchemistry - Trifluoromethyltrimethylsilane

* No ChemSpiderID

* PubChem: 552549

* No InChI

* SMILES: C[Si](C)(C)C(F)(F)F
Trifluperidol (10390)
```
Botcommand: addindex 348273093 Trifluperidol
```
```
For index : Trifluperidol=348273093
```
* 749-13-3 -> 749-13-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trifluperidol not found on commonchemistry - Trifluperidol

* No ChemSpiderID

* PubChem: 5567

* No InChI

* No SMILES
Triflusal (10394)

* No CASNo

* Triflusal not found on commonchemistry - Triflusal

* No ChemSpiderID

* PubChem: 9458

* No InChI

* No SMILES
Trigonelline (10395)
```
Botcommand: addindex 362574138 Trigonelline
```
```
For index : Trigonelline=362574138
```
* 535-83-1 -> 535-83-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trigonelline not found on commonchemistry - Trigonelline

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C[N]1=CC(C([O])=O)=CC=C1
Triheptanoin (10396)
```
Botcommand: addindex 351966963 Triheptanoin
```
```
For index : Triheptanoin=351966963
```
* 620-67-7 -> 620-67-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Triheptanoin not found on commonchemistry - Triheptanoin

* No ChemSpiderID

* PubChem: 69286

* No InChI

* SMILES: CCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CCCCCC
Triisopropylamine (10400)
```
Botcommand: addindex 347129556 Triisopropylamine
```
```
For index : Triisopropylamine=347129556
```
* 3424-21-3 -> 3424-21-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Triisopropylamine not found on commonchemistry - Triisopropylamine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C)N(C(C)C)C(C)C

10401 to 10450[edit]

Triisopropylphosphine (10401)

* No CASNo

* Triisopropylphosphine not found on commonchemistry - Triisopropylphosphine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trilostane (10402)
```
Botcommand: addindex 354440490 Trilostane
```
```
For index : Trilostane=354440490
```
* 13647-35-3 -> 13647-35-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trilostane not found on commonchemistry - Trilostane

* No ChemSpiderID

* PubChem: 656583

* No InChI

* No SMILES
Trimagnesium_citrate (10403)
```
Botcommand: addindex 330868731 Trimagnesium_citrate
```
```
For index : Trimagnesium_citrate=330868731
```
* 3344-18-1 -> 3344-18-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimagnesium+citrate not found on commonchemistry - Trimagnesium+citrate

* No ChemSpiderID

* PubChem: 20835962

* No InChI

* SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Mg].[Mg].[Mg]
Trimazosin (10404)
```
Botcommand: addindex 355323108 Trimazosin
```
```
For index : Trimazosin=355323108
```
* 53746-46-6 -> 53746-46-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimazosin not found on commonchemistry - Trimazosin

* No ChemSpiderID

* PubChem: 37264

* No InChI

* No SMILES
Trimebutine (10405)
```
Botcommand: addindex 345228463 Trimebutine
```
```
For index : Trimebutine=345228463
```
* 39133-31-8 -> 39133-31-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimebutine not found on commonchemistry - Trimebutine

* No ChemSpiderID

* PubChem: 5573

* No InChI

* No SMILES
Trimecaine (10406)
```
Botcommand: addindex 312075227 Trimecaine
```
```
For index : Trimecaine=312075227
```
* 616-68-2 -> 616-68-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimecaine not found on commonchemistry - Trimecaine

* No ChemSpiderID

* PubChem: 12028

* No InChI

* SMILES: CCN(CC)CC(=O)NC1=C(C=C(C=C1C)C)C
Trimegestone (10407)
```
Botcommand: addindex 354096798 Trimegestone
```
```
For index : Trimegestone=354096798
```
* 74513-62-5 -> 74513-62-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimegestone not found on commonchemistry - Trimegestone

* No ChemSpiderID

* PubChem: 68926

* No InChI

* SMILES: C[C@@H](C(=O)[C@]1(CC[C@@H]2[C@@]1(CCC3=C4CCC(=O)C=C4CC[C@@H]23)C)C)O
Trimellitic_anhydride_chloride (10408)
```
Botcommand: addindex 348592014 Trimellitic_anhydride_chloride
```
```
For index : Trimellitic_anhydride_chloride=348592014
```
* 1204-28-0 -> 1204-28-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimellitic+anhydride+chloride not found on commonchemistry - Trimellitic+anhydride+chloride

* No ChemSpiderID

* PubChem: 70998

* No InChI

* SMILES: C1=CC2=C(C=C1C(=O)Cl)C(=O)OC2=O
Trimeperidine (10409)
```
Botcommand: addindex 360918852 Trimeperidine
```
```
For index : Trimeperidine=360918852
```
* 64-39-1 -> 64-39-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimeperidine not found on commonchemistry - Trimeperidine

* No ChemSpiderID

* PubChem: 6148

* No InChI

* No SMILES
Trimetaphan_camsilate (10411)
```
Botcommand: addindex 351652360 Trimetaphan_camsilate
```
```
For index : Trimetaphan_camsilate=351652360
```
* 7187-66-8 -> 7187-66-8 - NOT VERIFIED

* CAS found on commonchemistry - 7187-66-8 - name not in list
All names: [[Thieno[1',2':1,2]thieno[3,4-d]imidazol-5-ium, decahydro-2-oxo-1,3-bis(phenylmethyl)-]]

* Trimetaphan+camsilate not found on commonchemistry - Trimetaphan+camsilate

* No ChemSpiderID

* PubChem: 23576

* No InChI

* No SMILES
Trimetazidine (10412)
```
Botcommand: addindex 351550843 Trimetazidine
```
```
For index : Trimetazidine=351550843
```
* 5011-34-7 -> 5011-34-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimetazidine not found on commonchemistry - Trimetazidine

* No ChemSpiderID

* PubChem: 21109

* No InChI

* No SMILES
Trimethadione (10413)
```
Botcommand: addindex 355948248 Trimethadione
```
```
For index : Trimethadione=355948248
```
* 127-48-0 -> 127-48-0 - NOT VERIFIED

* CAS found on commonchemistry - 127-48-0 - name in list
All names: 2,4-Oxazolidinedione, 3,5,5-trimethyl-, 3,3,5-Trimethyl-2,4-diketooxazolidine, 3,5,5-Trimethyl-2,4-oxazolidinedione, Absentol, Edion, Epidione, Epixal, Minoaleviatin, NSC 15799, NSC 169503, Petidion, Petidon, Petilep, Pitmal, Ptimal, Tridion, Tridione, Tridone, Trimedal, trimetadiona, Trimetadione, Trimethadion, Trimethadion, trimethadione, Trimethin, Trimetin, Trioxanona, Troxidone

* Trimethadione found on commonchemistry - Trimethadione
* 127-48-0 (exact match) Matches CAS (127-48-0) on page
Name in list

All names: 2,4-Oxazolidinedione, 3,5,5-trimethyl-, 3,3,5-Trimethyl-2,4-diketooxazolidine, 3,5,5-Trimethyl-2,4-oxazolidinedione, Absentol, Edion, Epidione, Epixal, Minoaleviatin, NSC 15799, NSC 169503, Petidion, Petidon, Petilep, Pitmal, Ptimal, Tridion, Tridione, Tridone, Trimedal, trimetadiona, Trimetadione, Trimethadion, Trimethadion, [[trimethadione]], Trimethin, Trimetin, Trioxanona, Troxidone

* No ChemSpiderID

* PubChem: 5576

* No InChI

* No SMILES
Trimethoprim (10415)
```
Botcommand: addindex 359721538 Trimethoprim
```
```
For index : Trimethoprim=359721538
```
* 738-70-5 -> 738-70-5 - NOT VERIFIED

* CAS found on commonchemistry - 738-70-5 - name in list
All names: 2,4-Diamino-5-(3',4',5'-trimethoxybenzyl)pyrimidine, 2,4-Diamino-5-(3,4,5-trimethoxybenzyl)pyrimidine, [[2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]-]], [[5-[(3,4,5-Trimethoxyphenyl)methyl]-2,4-pyrimidinediamine]], BW 56-72, Instalac, Monotrim, NIH 204, NSC 106568, Proloprim, Pyrimidine, 2,4-diamino-5-(3,4,5-trimethoxybenzyl)-, Syraprim, Tiempe, Trimanyl, Trimethioprim, trimethoprim, trimethoprime, Trimetoprim, trimetoprima, Trimogal, Trimopan, Trimpex, Triprim, Uretrim, Wellcoprim

* Trimethoprim found on commonchemistry - Trimethoprim
* 738-70-5 (Formula: C14H18N4O3; Name: 2,4-Pyrimidinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]-) Matches CAS (738-70-5) on page

* 8064-90-2 (Formula: C14H18N4O3.C10H11N3O3S; Name: Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)-, mixt. with 5-[(3,4,5-trimethoxyphenyl)methyl]-2,4-pyrimidinediamine)

* ChemSpiderID: 5376 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5578

* No InChI - (ChemSpider: | InChI=InChI=1/C14H18N4O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15/h5-7H,4H2,1-3H3,(H4,15,16,17,18) )

* No SMILES - (ChemSpider: | smiles=n1c(N)c(cnc1N)Cc2cc(OC)c(OC)c(OC)c2 )
Trimethylarsine (10422)
```
Botcommand: addindex 306112347 Trimethylarsine
```
```
For index : Trimethylarsine=306112347
```
* 593-88-4 -> 593-88-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimethylarsine not found on commonchemistry - Trimethylarsine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trimethyldiphenylpropylamine (10423)

* No CASNo

* Trimethyldiphenylpropylamine not found on commonchemistry - Trimethyldiphenylpropylamine

* No ChemSpiderID

* PubChem: 30966

* No InChI

* No SMILES
Trimethylolethane_trinitrate (10428)
```
Botcommand: addindex 316641755 Trimethylolethane_trinitrate
```
```
For index : Trimethylolethane_trinitrate=316641755
```
* 3032-55-1 -> 3032-55-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimethylolethane+trinitrate not found on commonchemistry - Trimethylolethane+trinitrate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O
Trimethylolpropane_phosphite (10430)
```
Botcommand: addindex 300776701 Trimethylolpropane_phosphite
```
```
For index : Trimethylolpropane_phosphite=300776701
```
* 824-11-3 -> 824-11-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimethylolpropane+phosphite not found on commonchemistry - Trimethylolpropane+phosphite

* No ChemSpiderID

* No PubChem

* InChI: 1/C6H11O3P/c1/h2-5H2,1H3

* SMILES: CCC1(CO2)COP2OC1
Trimethylsilanol (10432)
```
Botcommand: addindex 341493337 Trimethylsilanol
```
```
For index : Trimethylsilanol=341493337
```
* 1066-40-6 -> 1066-40-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimethylsilanol found on commonchemistry - Trimethylsilanol
* 27607-77-8 (exact match)
Name in list

All names: METHANESULFONATE, TRIMETHYLSILYL TRIFLUORO-, Methanesulfonic acid, 1,1,1-trifluoro-, trimethylsilyl ester, Methanesulfonic acid, trifluoro-, trimethylsilyl ester, trifluorometanosulfonato de trimetilsililo, Trifluoromethanesulfonate de trimethylsilyle, Trifluoromethanesulfonic acid trimethylsilyl ester, [[trimethylsilanol trifluoromethanesulfonate]], Trimethylsilyl triflate, Trimethylsilyl trifluoromethanesulfonate, trimethylsilyl trifluoromethanesulphonate, Trimethylsilyl trifluoromethylsulfonate, Trimethylsilyltrifluormethansulfonat

* No ChemSpiderID

* PubChem: 66110

* No InChI

* SMILES: C[Si](C)(C)O
Trimethylsilyl_propionate (10436)
```
Botcommand: addindex 350765868 Trimethylsilyl_propionate
```
```
For index : Trimethylsilyl_propionate=350765868
```
* 16844-98-7 -> 16844-98-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimethylsilyl+propionate not found on commonchemistry - Trimethylsilyl+propionate

* No ChemSpiderID

* PubChem: 3780334

* No InChI

* SMILES: C[Si](C)(C)CCC(=O)[O-]
Trimethylsilyldiazomethane (10438)
```
Botcommand: addindex 360678527 Trimethylsilyldiazomethane
```
```
For index : Trimethylsilyldiazomethane=360678527
```
* 18107-18-1 -> 18107-18-1 - NOT VERIFIED

* CAS found on commonchemistry - 18107-18-1 - name in list
All names: Diazo((trimethylsilyl))methane, Diazomethyltrimethyl silane, Formaldehyde, 1-(trimethylsilyl)-, one, Silane, (diazomethyl)trimethyl-, Trimethylsilyldiazomethane

* Trimethylsilyldiazomethane found on commonchemistry - Trimethylsilyldiazomethane
* 18107-18-1 (exact match) Matches CAS (18107-18-1) on page
Name in list

All names: Diazo((trimethylsilyl))methane, Diazomethyltrimethyl silane, Formaldehyde, 1-(trimethylsilyl)-, one, Silane, (diazomethyl)trimethyl-, [[trimethylsilyldiazomethane]]

* No ChemSpiderID

* PubChem: 167693

* No InChI

* SMILES: C[Si](C)(C)C=[N+]=[N-]
Trimethylstibine (10439)
```
Botcommand: addindex 333590124 Trimethylstibine
```
```
For index : Trimethylstibine=333590124
```
* 594-10-5 -> 594-10-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimethylstibine not found on commonchemistry - Trimethylstibine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trimetozine (10441)
```
Botcommand: addindex 345622013 Trimetozine
```
```
For index : Trimetozine=345622013
```
* 635-41-6 -> 635-41-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimetozine not found on commonchemistry - Trimetozine

* No ChemSpiderID

* PubChem: 12478

* No InChI

* No SMILES
Trimyristin (10444)
```
Botcommand: addindex 355819283 Trimyristin
```
```
For index : Trimyristin=355819283
```
* 555-45-3 -> 555-45-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Trimyristin not found on commonchemistry - Trimyristin

* No ChemSpiderID

* PubChem: 11148

* No InChI

* SMILES: CCCCCCCCCCCCCC(=O)OCC (COC(=O)CCCCCCCCCCCCC)O C(=O)CCCCCCCCCCCCC
Trioctylmethylammonium_bis(trifluoromethylsulfonyl)imide (10447)
```
Botcommand: addindex 327541992 Trioctylmethylammonium_bis(trifluoromethylsulfonyl)imide
```
```
For index : Trioctylmethylammonium_bis(trifluoromethylsulfonyl)imide=327541992
```
* 375395-33-8 -> 375395-33-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Trioctylmethylammonium+bis+trifluoromethylsulfonyl+imide not found on commonchemistry - Trioctylmethylammonium+bis+trifluoromethylsulfonyl+imide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=S([N-]S(=O)(C(F)(F)F)=O)(C(F)(F)F)=O.CCCCCCCC[N+](CCCCCCCC)(C)CCCCCCCC
Trional (10450)
```
Botcommand: addindex 320277390 Trional
```
```
For index : Trional=320277390
```
* 76-20-0 -> 76-20-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Trional not found on commonchemistry - Trional

* No ChemSpiderID

* PubChem: 6433

* No InChI

* No SMILES

10451 to 10500[edit]

Triosmium_dodecacarbonyl (10451)
```
Botcommand: addindex 295828034 Triosmium_dodecacarbonyl
```
```
For index : Triosmium_dodecacarbonyl=295828034
```
* 15696-40-9 -> 15696-40-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Triosmium+dodecacarbonyl not found on commonchemistry - Triosmium+dodecacarbonyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trioxifene (10452)
```
Botcommand: addindex 356553454 Trioxifene
```
```
For index : Trioxifene=356553454
```
* 63619-84-1 -> 63619-84-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Trioxifene not found on commonchemistry - Trioxifene

* ChemSpiderID: 45471 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 50139

* No InChI - (ChemSpider: | InChI=InChI=1/C30H31NO3/c1-33-25-13-8-23(9-14-25)28-17-12-22-6-2-3-7-27(22)29(28)30(32)24-10-15-26(16-11-24)34-21-20-31-18-4-5-19-31/h2-3,6-11,13-16H,4-5,12,17-21H2,1H3 )

* No SMILES - (ChemSpider: | smiles=O=C(C=3c1ccccc1CCC=3c2ccc(OC)cc2)c5ccc(OCCN4CCCC4)cc5 )
Trioxsalen (10453)
```
Botcommand: addindex 361205006 Trioxsalen
```
```
For index : Trioxsalen=361205006
```
* 3902-71-4 -> 3902-71-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Trioxsalen not found on commonchemistry - Trioxsalen

* No ChemSpiderID

* PubChem: 5585

* No InChI

* SMILES: CC1=CC(=O)OC2=C1C=C3C=C(OC3=C2C)C
Tripamide (10454)
```
Botcommand: addindex 315871469 Tripamide
```
```
For index : Tripamide=315871469
```
* 73803-48-2 -> 73803-48-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tripamide not found on commonchemistry - Tripamide

* No ChemSpiderID

* PubChem: 636401

* No InChI

* No SMILES
Triphenylborane (10460)
```
Botcommand: addindex 287781760 Triphenylborane
```
```
For index : Triphenylborane=287781760
```
* 960-71-4 -> 960-71-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Triphenylborane not found on commonchemistry - Triphenylborane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triphenylmethyl_hexafluorophosphate (10465)
```
Botcommand: addindex 358126904 Triphenylmethyl_hexafluorophosphate
```
```
For index : Triphenylmethyl_hexafluorophosphate=358126904
```
* 437-17-2 -> 437-17-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Triphenylmethyl+hexafluorophosphate not found on commonchemistry - Triphenylmethyl+hexafluorophosphate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triphenylphosphine_dichloride (10467)
```
Botcommand: addindex 360130922 Triphenylphosphine_dichloride
```
```
For index : Triphenylphosphine_dichloride=360130922
```
* 2526-64-9 -> 2526-64-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Triphenylphosphine+dichloride not found on commonchemistry - Triphenylphosphine+dichloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triphenylphosphine_sulfide (10469)
```
Botcommand: addindex 266346891 Triphenylphosphine_sulfide
```
```
For index : Triphenylphosphine_sulfide=266346891
```
* 3878-45-3 -> 3878-45-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Triphenylphosphine+sulfide not found on commonchemistry - Triphenylphosphine+sulfide

* No ChemSpiderID

* PubChem: 19758

* No InChI

* SMILES: C1=CC=C(C=C1)P(=S)(C2=CC=CC=C2)C3=CC=CC=C3
Triphenyltin_hydride (10473)
```
Botcommand: addindex 354766692 Triphenyltin_hydride
```
```
For index : Triphenyltin_hydride=354766692
```
* 892-20-6 -> 892-20-6 - NOT VERIFIED

* CAS found on commonchemistry - 892-20-6 - name in list
All names: hidruro de trifenilestano, hydrure de triphenyletain, Stannane, triphenyl-, Tin, triphenyl-, hydride, Triphenylstannane, Triphenylstannyl hydride, triphenyltin hydride, Triphenylzinnhydrid

* Triphenyltin+hydride found on commonchemistry - Triphenyltin+hydride
* 892-20-6 (exact match) Matches CAS (892-20-6) on page
Name in list

All names: hidruro de trifenilestano, hydrure de triphenyletain, Stannane, triphenyl-, Tin, triphenyl-, hydride, Triphenylstannane, Triphenylstannyl hydride, [[triphenyltin hydride]], Triphenylzinnhydrid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: [H][Sn](C2=CC=CC=C2)(C3=CC=CC=C3)C1=CC=CC=C1
Triphos (10474)
```
Botcommand: addindex 362694385 Triphos
```
```
For index : Triphos=362694385
```
* 22031-12-5 -> 22031-12-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Triphos found on commonchemistry - Triphos
* 53-57-6 (Formula: C21H30N7O17P3; Name: Adenosine 5'-(trihydrogen diphosphate), 2'-(dihydrogen phosphate),P'â†’5'-ester with 1,4-dihydro-1-Î²-D-ribofuranosyl-3-pyridinecarboxamide)

* 53-59-8 (Formula: C21H28N7O17P3; Name: Adenosine 5'-(trihydrogen diphosphate), 2'-(dihydrogen phosphate),P'â†’5'-ester with 3-(aminocarbonyl)-1-Î²-D-ribofuranosylpyridinium, inner salt)

* 56-65-5 (Formula: C10H16N5O13P3; Name: Adenosine 5'-(tetrahydrogen triphosphate))

* 63-39-8 (Formula: C9H15N2O15P3; Name: Uridine 5'-(tetrahydrogen triphosphate))

* 65-47-4 (Formula: C9H16N3O14P3; Name: Cytidine 5'-(tetrahydrogen triphosphate))

* 86-01-1 (Formula: C10H16N5O14P3; Name: Guanosine 5'-(tetrahydrogen triphosphate))

* 132-06-9 (Formula: C10H15N4O14P3; Name: Inosine 5'-(tetrahydrogen triphosphate))

* 365-08-2 (Formula: C10H17N2O14P3; Name: Thymidine 5'-(tetrahydrogen triphosphate))

* 940-71-6 (Formula: Cl6N3P3; Name: 1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4,6,6-hexachloro-2,2,4,4,6,6-hexahydro-)

* 1927-31-7 (Formula: C10H16N5O12P3; Name: Adenosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triphosgene (10475)

* No CASNo

* Triphosgene found on commonchemistry - Triphosgene
* 32315-10-9 (Formula: C3Cl6O3; Name: Methanol, trichloro-, carbonate (2:1))

* 24936-68-3 (Formula: (C16H14O3)n; Name: Poly[oxycarbonyloxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene])

* 25135-52-8 (Formula: (C19H18O3)n; Name: Poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene))

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triptane (10479)
```
Botcommand: addindex 356145399 Triptane
```
```
For index : Triptane=356145399
```
* 464-06-2 -> 464-06-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Triptane not found on commonchemistry - Triptane

* ChemSpiderID: 9649 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C7H16/c1-6(2)7(3,4)5/h6H,1-5H3 )

* No SMILES - (ChemSpider: | SMILES=CC(C)C(C)(C)C )
Triptorelin (10480)
```
Botcommand: addindex 352955624 Triptorelin
```
```
For index : Triptorelin=352955624
```
* 57773-63-4 -> 57773-63-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Triptorelin not found on commonchemistry - Triptorelin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Triptycene (10481)
```
Botcommand: addindex 354956653 Triptycene
```
```
For index : Triptycene=354956653
```
* 477-75-8 -> 477-75-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Triptycene not found on commonchemistry - Triptycene

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C12=CC=CC=C1C3C5=C<br />(C=CC=C5)C2C4=C3C=CC=C4
Tris(2-chloroethyl)amine (10485)
```
Botcommand: addindex 346266246 Tris(2-chloroethyl)amine
```
```
For index : Tris(2-chloroethyl)amine=346266246
```
* 555-77-1 -> 555-77-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tris+chloroethyl+amine not found on commonchemistry - Tris+chloroethyl+amine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: ClCCN(CCCl)CCCl
Tris(acetylacetonato)_iron(III) (10487)
```
Botcommand: addindex 360714897 Tris(acetylacetonato)_iron(III)
```
```
For index : Tris(acetylacetonato)_iron(III)=360714897
```
* 14024-18-1 -> 14024-18-1 - NOT VERIFIED

* CAS found on commonchemistry - 14024-18-1 - name not in list
All names: (Acetylacetonato)iron(III), Acetope Fe(II), ACETYLACETONATE, IRON (III), Ferric acetylacetonate, Ferric tris(acetoacetonate), Ferric tris(acetylacetonate), Iron acetylacetonate, Iron triacetylacetonate, Iron tris(2,4-pentanedionate), Iron tris(acetoacetonate), Iron tris(acetylacetonate), Iron(3+) acetylacetonate, Iron(III) acetylacetonate, IRON, TRIS(2,4-PENTANDIONATO-O,O')-, Iron, tris(2,4-pentanedionato)-, Iron, tris(2,4-pentanedionato-O,O')-, (OC-6-11)-, Iron, tris(2,4-pentanedionato-O,O')-, (OC-6-11)-, Iron, tris(2,4-pentanedionato-ÎºO,ÎºO')-, (OC-6-11)-, Iron, tris(2,4-pentanedionato-ÎºO2,ÎºO4)-, (OC-6-11)-, Nacem Iron, NSC 43622, Tris(2,4-pentanedionato)iron, Tris(acetylacetonato)iron, Tris(acetylacetone)iron, Tris(pentan-2,4-dionato)eisen(II), Tris(pentane-2,4-dionato)fer(II), tris(pentane-2,4-dionato)iron(II), tris(pentano-2,4-dionato)hierro(II)

* Tris+acetylacetonato+iron+III not found on commonchemistry - Tris+acetylacetonato+iron+III

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tris(bipyridine)ruthenium(II)_chloride (10488)
```
Botcommand: addindex 349372798 Tris(bipyridine)ruthenium(II)_chloride
```
```
For index : Tris(bipyridine)ruthenium(II)_chloride=349372798
```
* 14323-06-9 -> 14323-06-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tris+bipyridine+ruthenium+II+chloride not found on commonchemistry - Tris+bipyridine+ruthenium+II+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tris(dibenzylideneacetone)dipalladium(0) (10489)
```
Botcommand: addindex 347506878 Tris(dibenzylideneacetone)dipalladium(0)
```
```
For index : Tris(dibenzylideneacetone)dipalladium(0)=347506878
```
* 51364-51-3 -> 51364-51-3 - NOT VERIFIED

* CAS found on commonchemistry - 51364-51-3 - name not in list
All names: [[Palladium, tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]di-]], [[Palladium, tris[Î¼-[(1,2-Î·:4,5-Î·)-1,5-diphenyl-1,4-pentadien-3-one]]di-, (all-E)-]], Pd2(DBA)3, Tris(dibenzylideneacetone)dipalladium, Tris(dibenzylideneacetonyl)bis-palladium, [[Tris[(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]dipalladium]], [[Tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]dipalladium]], [[tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]dipalladium [Pd2(dba)3]]]

* Tris+dibenzylideneacetone+dipalladium not found on commonchemistry - Tris+dibenzylideneacetone+dipalladium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tris(ethylenediamine)cobalt(III)_chloride (10490)
```
Botcommand: addindex 336602834 Tris(ethylenediamine)cobalt(III)_chloride
```
```
For index : Tris(ethylenediamine)cobalt(III)_chloride=336602834
```
* 207802-43-5 -> 207802-43-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tris+ethylenediamine+cobalt+III+chloride not found on commonchemistry - Tris+ethylenediamine+cobalt+III+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tris(pentafluorophenyl)boron (10491)
```
Botcommand: addindex 357887421 Tris(pentafluorophenyl)boron
```
```
For index : Tris(pentafluorophenyl)boron=357887421
```
* 1109-15-5 -> 1109-15-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tris+pentafluorophenyl+boron not found on commonchemistry - Tris+pentafluorophenyl+boron

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tris-(Benzyltriazolylmethyl)amine (10492)

* No CASNo

* Tris+Benzyltriazolylmethyl+amine not found on commonchemistry - Tris+Benzyltriazolylmethyl+amine

* ChemSpiderID: 9378431 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 11203363

* InChI: InChI=1S/C30H30N10/c1-4-10-25(11-5-1)16-38-22-28(31-34-38)19-37(20-29-23-39(35-32-29)17-26-12-6-2-7-13-26)21-30-24-40(36-33-30)18-27-14-8-3-9-15-27/h1-15,22-24H,16-21H2 - (ChemSpider: | InChI=InChI=1/C30H30N10/c1-4-10-25(11-5-1)16-38-22-28(31-34-38)19-37(20-29-23-39(35-32-29)17-26-12-6-2-7-13-26)21-30-24-40(36-33-30)18-27-14-8-3-9-15-27/h1-15,22-24H,16-21H2 )

* SMILES: n1nc(cn1Cc2ccccc2)CN(Cc3nnn(c3)Cc4ccccc4)Cc5nnn(c5)Cc6ccccc6 - (ChemSpider: | SMILES=n1nc(cn1Cc2ccccc2)CN(Cc3nnn(c3)Cc4ccccc4)Cc5nnn(c5)Cc6ccccc6 )
Trisescaline (10493)
```
Botcommand: addindex 346976558 Trisescaline
```
```
For index : Trisescaline=346976558
```
* 90109-63-0 -> 90109-63-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Trisescaline not found on commonchemistry - Trisescaline

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCOc1c(cc(cc1OCC)CCN)OCC
Tritiated_water (10496)
```
Botcommand: addindex 363044453 Tritiated_water
```
```
For index : Tritiated_water=363044453
```
* 14940-65-9 -> 14940-65-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tritiated+water not found on commonchemistry - Tritiated+water

* No ChemSpiderID

* PubChem: 104752

* No InChI

* No SMILES
Tritoqualine (10498)
```
Botcommand: addindex 347188226 Tritoqualine
```
```
For index : Tritoqualine=347188226
```
* 14504-73-5 -> 14504-73-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tritoqualine not found on commonchemistry - Tritoqualine

* ChemSpiderID: 65119 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 72145

* No InChI - (ChemSpider: | InChI=InChI=1/C26H32N2O8/c1-6-31-23-17-16(18(27)24(32-7-2)25(23)33-8-3)26(29)36-21(17)19-15-13(9-10-28(19)4)11-14-20(22(15)30-5)35-12-34-14/h11,19,21H,6-10,12,27H2,1-5H3 )

* No SMILES - (ChemSpider: | smiles=O=C2OC(c1c(OCC)c(OCC)c(OCC)c(N)c12)C5N(C)CCc4c5c(OC)c3OCOc3c4 )
Triuranium_octoxide (10499)
```
Botcommand: addindex 362605634 Triuranium_octoxide
```
```
For index : Triuranium_octoxide=362605634
```
* 1317-99-3 -> 1317-99-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Triuranium+octoxide found on commonchemistry - Triuranium+octoxide
* 1344-59-8 (exact match)
Name in list

All names: C.I. 77919, octaoxido de triuranio, Octaoxyde de triuranium, triuranium octaoxide, [[triuranium octoxide]], Triuranium oxide, Triuranoctaoxid, Uranium octaoxide, Uranium oxide, Uranium oxide (U3O8), Uranyl Uranate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Trizivir (10500)
* No CASNo

* Trizivir not found on commonchemistry - Trizivir

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES