<- User:Beetstra/listing39 - User:Beetstra/Validation - User:Beetstra/listing41 ->

Data[edit]

9751 to 9800[edit]

Tebufenpyrad (9752)
```
Botcommand: addindex 343108523 Tebufenpyrad
```
```
For index : Tebufenpyrad=343108523
```
* 119168-77-3 -> 119168-77-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tebufenpyrad not found on commonchemistry - Tebufenpyrad

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_exametazime (9754)
* No CASNo

* Technetium+mTc+exametazime not found on commonchemistry - Technetium+mTc+exametazime

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_fanolesomab (9755)
```
Botcommand: addindex 345962054 Technetium_(99mTc)_fanolesomab
```
```
For index : Technetium_(99mTc)_fanolesomab=345962054
```
* 225239-31-6 -> 225239-31-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+fanolesomab not found on commonchemistry - Technetium+mTc+fanolesomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_medronic_acid (9756)

* No CASNo

* Technetium+mTc+medronic+acid not found on commonchemistry - Technetium+mTc+medronic+acid

* No ChemSpiderID

* PubChem: 157443

* No InChI

* No SMILES
Technetium_(99mTc)_nofetumomab_merpentan (9757)
```
Botcommand: addindex 351378863 Technetium_(99mTc)_nofetumomab_merpentan
```
```
For index : Technetium_(99mTc)_nofetumomab_merpentan=351378863
```
* 165942-79-0 -> 165942-79-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+nofetumomab+merpentan not found on commonchemistry - Technetium+mTc+nofetumomab+merpentan

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_pintumomab (9758)
```
Botcommand: addindex 353962788 Technetium_(99mTc)_pintumomab
```
```
For index : Technetium_(99mTc)_pintumomab=353962788
```
* 157476-76-1 -> 157476-76-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+pintumomab not found on commonchemistry - Technetium+mTc+pintumomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_sestamibi (9759)
File:Tc99m-sestamibi.jpgâ€Ž
```
Botcommand: addindex 362686970 Technetium_(99mTc)_sestamibi
```
```
For index : Technetium_(99mTc)_sestamibi=362686970
```
* 109581-73-9 -> 109581-73-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+sestamibi not found on commonchemistry - Technetium+mTc+sestamibi

* No ChemSpiderID

* PubChem: 5384

* No InChI

* No SMILES
Technetium_(99mTc)_sulesomab (9760)
```
Botcommand: addindex 354119044 Technetium_(99mTc)_sulesomab
```
```
For index : Technetium_(99mTc)_sulesomab=354119044
```
* 167747-19-5 -> 167747-19-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+sulesomab not found on commonchemistry - Technetium+mTc+sulesomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_tetrofosmin (9761)
```
Botcommand: addindex 353621362 Technetium_(99mTc)_tetrofosmin
```
```
For index : Technetium_(99mTc)_tetrofosmin=353621362
```
* 127455-27-0 -> 127455-27-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+tetrofosmin not found on commonchemistry - Technetium+mTc+tetrofosmin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium_(99mTc)_votumumab (9762)
```
Botcommand: addindex 354566171 Technetium_(99mTc)_votumumab
```
```
For index : Technetium_(99mTc)_votumumab=354566171
```
* 148189-70-2 -> 148189-70-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+mTc+votumumab not found on commonchemistry - Technetium+mTc+votumumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium(IV)_chloride (9763)
```
Botcommand: addindex 333704180 Technetium(IV)_chloride
```
```
For index : Technetium(IV)_chloride=333704180
```
* 14215-13-5 -> 14215-13-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+IV+chloride not found on commonchemistry - Technetium+IV+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium(VI)_fluoride (9764)
```
Botcommand: addindex 364355482 Technetium(VI)_fluoride
```
```
For index : Technetium(VI)_fluoride=364355482
```
* 13842-93-8 -> 13842-93-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Technetium+VI+fluoride not found on commonchemistry - Technetium+VI+fluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Technetium(VII)_oxide (9765)

* No CASNo

* Technetium+VII+oxide not found on commonchemistry - Technetium+VII+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Techtochrysin (9766)
```
Botcommand: addindex 346665853 Techtochrysin
```
```
For index : Techtochrysin=346665853
```
* 520-28-5 -> 520-28-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Techtochrysin not found on commonchemistry - Techtochrysin

* No ChemSpiderID

* PubChem: 5281954

* No InChI

* SMILES: COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O
Teclozan (9767)
* No CASNo

* Teclozan not found on commonchemistry - Teclozan

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tectoridin (9768)
```
Botcommand: addindex 350356520 Tectoridin
```
```
For index : Tectoridin=350356520
```
* 611-40-5 -> 611-40-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tectoridin not found on commonchemistry - Tectoridin

* No ChemSpiderID

* PubChem: 5281810

* No InChI

* SMILES: COC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O
Tectorigenin (9769)
```
Botcommand: addindex 350355619 Tectorigenin
```
```
For index : Tectorigenin=350355619
```
* 48-77-6 -> 48-77-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tectorigenin not found on commonchemistry - Tectorigenin

* No ChemSpiderID

* PubChem: 5281811

* No InChI

* SMILES: COC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)O
Tedisamil (9770)
```
Botcommand: addindex 351655512 Tedisamil
```
```
For index : Tedisamil=351655512
```
* 90961-53-8 -> 90961-53-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tedisamil not found on commonchemistry - Tedisamil

* No ChemSpiderID

* PubChem: 65825

* No InChI

* No SMILES
Tefibazumab (9771)
```
Botcommand: addindex 354123073 Tefibazumab
```
```
For index : Tefibazumab=354123073
```
* 521079-87-8 -> 521079-87-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tefibazumab not found on commonchemistry - Tefibazumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Teflic_acid (9772)

* No CASNo

* Teflic+acid not found on commonchemistry - Teflic+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tegaserod (9774)
```
Botcommand: addindex 350091744 Tegaserod
```
```
For index : Tegaserod=350091744
```
* 189188-57-6 -> 189188-57-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tegaserod not found on commonchemistry - Tegaserod

* No ChemSpiderID

* PubChem: 6918369 

* No InChI

* No SMILES
Teicoplanin (9775)
```
Botcommand: addindex 361514929 Teicoplanin
```
```
For index : Teicoplanin=361514929
```
* 61036-62-2 -> 61036-62-2 - NOT VERIFIED

* CAS found on commonchemistry - 61036-62-2 - name in list
All names: Antibiotic 8327A, Antibiotic MDL 507, MDL 507, Targocid, Teichomycin, Teicoplanin

* Teicoplanin found on commonchemistry - Teicoplanin
* 61036-62-2 (exact match) Matches CAS (61036-62-2) on page
Name in list

All names: Antibiotic 8327A, Antibiotic MDL 507, MDL 507, Targocid, Teichomycin, [[teicoplanin]]

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Telaprevir (9776)
* No CASNo

* Telaprevir not found on commonchemistry - Telaprevir

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Telavancin (9777)
```
Botcommand: addindex 362800341 Telavancin
```
```
For index : Telavancin=362800341
```
* 372151-71-8 -> 372151-71-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Telavancin not found on commonchemistry - Telavancin

* No ChemSpiderID

* PubChem: 3081362

* No InChI

* No SMILES
Telcagepant (9779)
```
Botcommand: addindex 360225390 Telcagepant
```
```
For index : Telcagepant=360225390
```
* 781649-09-0 -> 781649-09-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Telcagepant not found on commonchemistry - Telcagepant

* No ChemSpiderID

* PubChem: 11319053

* No InChI

* No SMILES
Telenzepine (9780)
```
Botcommand: addindex 348274680 Telenzepine
```
```
For index : Telenzepine=348274680
```
* 80880-90-6 -> 80880-90-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Telenzepine not found on commonchemistry - Telenzepine

* ChemSpiderID: 5194 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5387

* No InChI - (ChemSpider: | InChI=InChI=1/C19H22N4O2S/c1-13-18-14(12-26-13)19(25)20-15-5-3-4-6-16(15)23(18)17(24)11-22-9-7-21(2)8-10-22/h3-6,12H,7-11H2,1-2H3,(H,20,25) )

* No SMILES - (ChemSpider: | smiles=O=C(N1c3c(C(=O)Nc2c1cccc2)csc3C)CN4CCN(C)CC4 )
Telimomab_aritox (9781)
```
Botcommand: addindex 345252021 Telimomab_aritox
```
```
For index : Telimomab_aritox=345252021
```
* 117305-33-6 -> 117305-33-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Telimomab+aritox not found on commonchemistry - Telimomab+aritox

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Telithromycin (9782)
```
Botcommand: addindex 364091710 Telithromycin
```
```
For index : Telithromycin=364091710
```
* 191114-48-4 -> 191114-48-4 - NOT VERIFIED

* CAS found on commonchemistry - 191114-48-4 - name not in list
All names: [[Erythromycin, 3-de[(2,6-dideoxy-3-C-methyl-3-O-methyl-Î±-L-ribo-hexopyranosyl)oxy]-11,12-dideoxy-6-O-methyl-3-oxo-12,11-[oxycarbonyl[[4-[4-(3-pyridinyl)-1H-imidazol-1-yl]butyl]imino]]-]]

* Telithromycin not found on commonchemistry - Telithromycin

* No ChemSpiderID

* PubChem: 5462516

* No InChI

* No SMILES
Tellimagrandin_II (9783)
```
Botcommand: addindex 348928017 Tellimagrandin_II
```
```
For index : Tellimagrandin_II=348928017
```
* 58970-75-5 -> 58970-75-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellimagrandin+II not found on commonchemistry - Tellimagrandin+II

* No ChemSpiderID

* PubChem: 442679

* No InChI

* SMILES: C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O1)O)O)O)O)O)O
Telluric_acid (9784)
```
Botcommand: addindex 364472920 Telluric_acid
```
```
For index : Telluric_acid=364472920
```
* 7803-68-1 -> 7803-68-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Telluric+acid not found on commonchemistry - Telluric+acid

* No ChemSpiderID

* PubChem: 62686

* No InChI

* No SMILES
Tellurium_dibromide (9785)
```
Botcommand: addindex 311206706 Tellurium_dibromide
```
```
For index : Tellurium_dibromide=311206706
```
* 7789-54-0 -> 7789-54-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+dibromide not found on commonchemistry - Tellurium+dibromide

* No ChemSpiderID

* PubChem: 6365207

* No InChI

* No SMILES
Tellurium_dichloride (9786)
```
Botcommand: addindex 344886127 Tellurium_dichloride
```
```
For index : Tellurium_dichloride=344886127
```
* 10025-71-5 -> 10025-71-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+dichloride not found on commonchemistry - Tellurium+dichloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tellurium_hexafluoride (9788)
```
Botcommand: addindex 364330318 Tellurium_hexafluoride
```
```
For index : Tellurium_hexafluoride=364330318
```
* 7783-80-4 -> 7783-80-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+hexafluoride not found on commonchemistry - Tellurium+hexafluoride

* No ChemSpiderID

* PubChem: 24559

* No InChI

* SMILES: xxxxx
Tellurium_tetrabromide (9789)
```
Botcommand: addindex 311207121 Tellurium_tetrabromide
```
```
For index : Tellurium_tetrabromide=311207121
```
* 10031-27-3 -> 10031-27-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+tetrabromide not found on commonchemistry - Tellurium+tetrabromide

* No ChemSpiderID

* PubChem: 82311

* No InChI

* No SMILES
Tellurium_tetrachloride (9790)
```
Botcommand: addindex 359831669 Tellurium_tetrachloride
```
```
For index : Tellurium_tetrachloride=359831669
```
* 10026-07-0 -> 10026-07-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+tetrachloride not found on commonchemistry - Tellurium+tetrachloride

* No ChemSpiderID

* PubChem: 61443

* No InChI

* No SMILES
Tellurium_tetrafluoride (9791)
```
Botcommand: addindex 311208167 Tellurium_tetrafluoride
```
```
For index : Tellurium_tetrafluoride=311208167
```
* 15192-26-4 -> 15192-26-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+tetrafluoride not found on commonchemistry - Tellurium+tetrafluoride

* No ChemSpiderID

* PubChem: 167258

* No InChI

* No SMILES
Tellurium_tetraiodide (9792)
```
Botcommand: addindex 311946425 Tellurium_tetraiodide
```
```
For index : Tellurium_tetraiodide=311946425
```
* 7790-48-9 -> 7790-48-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+tetraiodide not found on commonchemistry - Tellurium+tetraiodide

* No ChemSpiderID

* PubChem: 82255

* No InChI

* No SMILES
Tellurium_trioxide (9793)
```
Botcommand: addindex 311946178 Tellurium_trioxide
```
```
For index : Tellurium_trioxide=311946178
```
* 13451-18-8 -> 13451-18-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tellurium+trioxide not found on commonchemistry - Tellurium+trioxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tellurous_acid (9794)
* No CASNo

* Tellurous+acid not found on commonchemistry - Tellurous+acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Telomestatin (9796)
```
Botcommand: addindex 356551204 Telomestatin
```
```
For index : Telomestatin=356551204
```
* 265114-54-3 -> 265114-54-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Telomestatin not found on commonchemistry - Telomestatin

* No ChemSpiderID

* PubChem: 11954679

* No InChI

* SMILES: CC1=C(C2=NC(C3=NC(C4=NC(C5=NC(C6=NC(C7=NC(C8=N[C@@]9([H])CS8)=CO7)=CO6)=CO5)=CO4)=CO3)=C(C)O2)N=C9O1
Temafloxacin (9797)

* No CASNo

* Temafloxacin not found on commonchemistry - Temafloxacin

* No ChemSpiderID

* PubChem: 60021

* No InChI

* No SMILES
Temefos (9799)
```
Botcommand: addindex 358340034 Temefos
```
```
For index : Temefos=358340034
```
* 3383-96-8 -> 3383-96-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Temefos not found on commonchemistry - Temefos

* No ChemSpiderID

* PubChem: 5392

* No InChI

* No SMILES
Temocapril (9800)
```
Botcommand: addindex 336769684 Temocapril
```
```
For index : Temocapril=336769684
```
* 111902-57-9 -> 111902-57-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Temocapril not found on commonchemistry - Temocapril

* No ChemSpiderID

* PubChem: 71323

* No InChI

* No SMILES

9801 to 9850[edit]

Temocillin (9801)
```
Botcommand: addindex 304603642 Temocillin
```
```
For index : Temocillin=304603642
```
* 66148-78-5 -> 66148-78-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Temocillin not found on commonchemistry - Temocillin

* No ChemSpiderID

* PubChem: 171758

* No InChI

* No SMILES
Temoporfin (9802)
```
Botcommand: addindex 281331649 Temoporfin
```
```
For index : Temoporfin=281331649
```
* 122341-38-2 -> 122341-38-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Temoporfin not found on commonchemistry - Temoporfin

* No ChemSpiderID

* PubChem: 60751

* No InChI

* No SMILES
Template_talk:Drugbox (9805)
```
Botcommand: addindex 365290713 Template_talk:Drugbox
```
```
For index : Template_talk:Drugbox=365290713
```
* 142583-61-1 -> 142583-61-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Template+talk:Drugbox not found on commonchemistry - Template+talk:Drugbox

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Template_talk:Drugbox/Archive_4 (9806)
* No CASNo

* Template+talk:Drugbox+Archive not found on commonchemistry - Template+talk:Drugbox+Archive

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Template_talk:Px (9807)
* No CASNo

* Template+talk:Px not found on commonchemistry - Template+talk:Px

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Template:Chembox/testcases (9811)
```
Botcommand: addindex 343509849 Template:Chembox/testcases
```
```
For index : Template:Chembox/testcases=343509849
```
* 7487-88-9 -> 7487-88-9 - NOT VERIFIED

* CAS found on commonchemistry - 7487-88-9 - name not in list
All names: Arrosalt 2327, Epsom salt, Epsom salts, Magnesium sulfate, Magnesium sulfate (1:1), MAGNESIUM SULFATE ANHYDROUS, magnesium sulphate, Magnesium Sulphate A.R., Magnesiumsulfat, MANGANESIUM SULFATE, Mg-OK, MG-OK 100, MN 00, MN 30, OT-S, OT-S (drying agent), Sulfate de magnesium, sulfato de magnesio, SULFURIC ACID MAGNESIUM SALT, Sulfuric acid magnesium salt (1:1), Sulfuric acid, magnesium salt (1:1), Tomix OT

* Template:Chembox+testcases not found on commonchemistry - Template:Chembox+testcases

* ChemSpiderID: 22515 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 24083

* No InChI - (ChemSpider: | InChI=InChI=1/Mg.H2O4S/c;1-5(2,3)4/h;(H2,1,2,3,4)/q+2;/p-2 )

* No SMILES - (ChemSpider: | SMILES=[Mg+2].[O-]S([O-])(=O)=O )
Template:Drugbox/doc (9813)
* No CASNo

* Template:Drugbox+doc not found on commonchemistry - Template:Drugbox+doc

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Template:Drugbox/testcases (9815)
```
Botcommand: addindex 363183957 Template:Drugbox/testcases
```
```
For index : Template:Drugbox/testcases=363183957
```
* 165800-03-3 -> 165800-03-3 - NOT VERIFIED

* CAS found on commonchemistry - 165800-03-3 - name not in list
All names: [[Acetamide, N-[[(5S)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxo-5-oxazolidinyl]methyl]-]]

* Template:Drugbox+testcases not found on commonchemistry - Template:Drugbox+testcases

* ChemSpiderID: 390139 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 441401

* No InChI - (ChemSpider: | InChI=InChI=1/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3 )
Temsirolimus (9816)
```
Botcommand: addindex 345366034 Temsirolimus
```
```
For index : Temsirolimus=345366034
```
* 162635-04-3 -> 162635-04-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Temsirolimus not found on commonchemistry - Temsirolimus

* No ChemSpiderID

* PubChem: 6918289

* No InChI

* No SMILES
Tenatoprazole (9817)
```
Botcommand: addindex 364844473 Tenatoprazole
```
```
For index : Tenatoprazole=364844473
```
* 113712-98-4 -> 113712-98-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tenatoprazole not found on commonchemistry - Tenatoprazole

* No ChemSpiderID

* PubChem: 636411

* No InChI

* No SMILES
Tenatumomab (9818)
* No CASNo

* Tenatumomab not found on commonchemistry - Tenatumomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tenecteplase (9819)
File:Tenecteplase.png
```
Botcommand: addindex 352337859 Tenecteplase
```
```
For index : Tenecteplase=352337859
```
* 105857-23-6 -> 105857-23-6 - NOT VERIFIED

* CAS found on commonchemistry - 105857-23-6 - name not in list
All names: Plasminogen activator, (human tissue-type protein moiety)

* Tenecteplase not found on commonchemistry - Tenecteplase

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Teneliximab (9820)
```
Botcommand: addindex 354149645 Teneliximab
```
```
For index : Teneliximab=354149645
```
* 299423-37-3 -> 299423-37-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Teneliximab not found on commonchemistry - Teneliximab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tenidap (9821)

* No CASNo

* Tenidap not found on commonchemistry - Tenidap

* No ChemSpiderID

* PubChem: 60712

* No InChI

* No SMILES
Tenitramine (9823)
```
Botcommand: addindex 322698868 Tenitramine
```
```
For index : Tenitramine=322698868
```
* 21946-79-2 -> 21946-79-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tenitramine not found on commonchemistry - Tenitramine

* No ChemSpiderID

* PubChem: 168009

* No InChI

* SMILES: C(CN(CCO[N+](=O)[O-])CCO[N+](=O)[O-])N(CCO[N+](=O)[O-])CCO[N+](=O)[O-]
Tenocyclidine (9824)
```
Botcommand: addindex 353424675 Tenocyclidine
```
```
For index : Tenocyclidine=353424675
```
* 21500-98-1 -> 21500-98-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tenocyclidine not found on commonchemistry - Tenocyclidine

* No ChemSpiderID

* PubChem: 62751

* No InChI

* No SMILES
Tenofovir/emtricitabine (9826)
* No CASNo

* Tenofovir+emtricitabine not found on commonchemistry - Tenofovir+emtricitabine

* No ChemSpiderID

* PubChem: 11954236

* No InChI

* No SMILES
Tenonitrozole (9827)
```
Botcommand: addindex 346985215 Tenonitrozole
```
```
For index : Tenonitrozole=346985215
```
* 3810-35-3 -> 3810-35-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tenonitrozole not found on commonchemistry - Tenonitrozole

* No ChemSpiderID

* PubChem: 19646

* No InChI

* No SMILES
Tenoxicam (9828)

* No CASNo

* Tenoxicam found on commonchemistry - Tenoxicam
* 59804-37-4 (exact match)
Name in list

All names: [[2H-Thieno[2,3-e]-1,2-thiazine-3-carboxamide, 4-hydroxy-2-methyl-N-2-pyridinyl-, 1,1-dioxide]], [[4-Hydroxy-2-methyl-N-2-pyrimidinyl-2H-thieno[2,3-e]-1,2-thiazine-3-carboxamide 1,1-dioxide]], Alganex, Dolmen, Liman, Mobiflex, Rexalgan, Ro 12-0068, [[tenoxicam]], Tilatil, Tilcotil

* No ChemSpiderID

* PubChem: 5282194

* No InChI

* No SMILES
Tentoxin (9829)
```
Botcommand: addindex 266732549 Tentoxin
```
```
For index : Tentoxin=266732549
```
* 28540-82-1 -> 28540-82-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tentoxin not found on commonchemistry - Tentoxin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tenuazonic_acid (9830)
```
Botcommand: addindex 347846320 Tenuazonic_acid
```
```
For index : Tenuazonic_acid=347846320
```
* 610-88-8 -> 610-88-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tenuazonic+acid not found on commonchemistry - Tenuazonic+acid

* No ChemSpiderID

* PubChem: 101949

* No InChI

* SMILES: CCC(C)C1C(=O)C(=C(N1)O)C(=O)C
Tephrosin (9831)
```
Botcommand: addindex 352692740 Tephrosin
```
```
For index : Tephrosin=352692740
```
* 76-80-2 -> 76-80-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tephrosin not found on commonchemistry - Tephrosin

* No ChemSpiderID

* PubChem: 114909

* No InChI

* SMILES: CC1(C=CC2=C(O1)C=CC3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@]4(C3=O)O)OC)OC)C
Teplizumab (9832)
```
Botcommand: addindex 359928440 Teplizumab
```
```
For index : Teplizumab=359928440
```
* 876387-05-2 -> 876387-05-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Teplizumab not found on commonchemistry - Teplizumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tepoxalin (9833)

* No CASNo

* Tepoxalin not found on commonchemistry - Tepoxalin

* No ChemSpiderID

* PubChem: 59757

* No InChI

* No SMILES
Teprenone (9834)
```
Botcommand: addindex 355908631 Teprenone
```
```
For index : Teprenone=355908631
```
* 6809-52-5 -> 6809-52-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Teprenone not found on commonchemistry - Teprenone

* No ChemSpiderID

* PubChem: 5282199

* No InChI

* No SMILES
Terbium_silicide (9837)
* No CASNo

* Terbium+silicide not found on commonchemistry - Terbium+silicide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Terbium(III)_bromide (9838)
File:Terbium(III) bromide.jpg
```
Botcommand: addindex 312039144 Terbium(III)_bromide
```
```
For index : Terbium(III)_bromide=312039144
```
* 14456-47-4 -> 14456-47-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Terbium+III+bromide not found on commonchemistry - Terbium+III+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Terbium(III)_chloride (9839)
```
Botcommand: addindex 312039212 Terbium(III)_chloride
```
```
For index : Terbium(III)_chloride=312039212
```
* 10042-88-3 -> 10042-88-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Terbium+III+chloride not found on commonchemistry - Terbium+III+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Terbium(III)_iodide (9840)
File:Terbium(III) iodide.jpg
```
Botcommand: addindex 312039368 Terbium(III)_iodide
```
```
For index : Terbium(III)_iodide=312039368
```
* 13813-40-6 -> 13813-40-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Terbium+III+iodide not found on commonchemistry - Terbium+III+iodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Terbium(III,IV)_oxide (9842)
```
Botcommand: addindex 351357532 Terbium(III,IV)_oxide
```
```
For index : Terbium(III,IV)_oxide=351357532
```
* 12037-01-3 -> 12037-01-3 - NOT VERIFIED

* CAS found on commonchemistry - 12037-01-3 - name not in list
All names: heptaoxido de tetraterbio, Heptaoxyde de tetraterbium, Terbium oxide, Terbium oxide (Tb2O3.5), Terbium oxide (Tb4O7), Terbium oxide (TbO1.75), Terbium peroxide, tetraterbium heptaoxide, Tetraterbium heptoxide, Tetraterbiumheptaoxid

* Terbium+III+IV+oxide not found on commonchemistry - Terbium+III+IV+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Terbogrel (9843)
```
Botcommand: addindex 361650547 Terbogrel
```
```
For index : Terbogrel=361650547
```
* 149979-74-8 -> 149979-74-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Terbogrel not found on commonchemistry - Terbogrel

* ChemSpiderID: 4952549 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6449876

* InChI: InChI=1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ - (ChemSpider: | InChI=InChI=1/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ )

* SMILES: N#CN\C(=N/C(C)(C)C)Nc2cccc(C(=C/CCCC(=O)O)\c1cccnc1)c2 - (ChemSpider: | SMILES=N#CN\C(=N/C(C)(C)C)Nc2cccc(C(=C/CCCC(=O)O)\c1cccnc1)c2 )
Terguride (9850)
```
Botcommand: addindex 363446250 Terguride
```
```
For index : Terguride=363446250
```
* 37686-84-3 -> 37686-84-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Terguride not found on commonchemistry - Terguride

* No ChemSpiderID

* PubChem: 443951

* No InChI

* No SMILES

9851 to 9900[edit]

Teriflunomide (9851)
```
Botcommand: addindex 364715951 Teriflunomide
```
```
For index : Teriflunomide=364715951
```
* 163451-81-8 -> 163451-81-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Teriflunomide not found on commonchemistry - Teriflunomide

* No ChemSpiderID

* PubChem: 5479847

* No InChI

* No SMILES
Teriparatide (9852)
```
Botcommand: addindex 362220505 Teriparatide
```
```
For index : Teriparatide=362220505
```
* 52232-67-4 -> 52232-67-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Teriparatide not found on commonchemistry - Teriparatide

* No ChemSpiderID

* PubChem: 16133850

* No InChI

* No SMILES
Terizidone (9853)
```
Botcommand: addindex 355466586 Terizidone
```
```
For index : Terizidone=355466586
```
* 25683-71-0 -> 25683-71-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Terizidone not found on commonchemistry - Terizidone

* No ChemSpiderID

* PubChem: 65720

* No InChI

* No SMILES
Terlipressin (9854)
```
Botcommand: addindex 326151666 Terlipressin
```
```
For index : Terlipressin=326151666
```
* 14636-12-5 -> 14636-12-5 - NOT VERIFIED

* CAS found on commonchemistry - 14636-12-5 - name in list
All names: [[[N-Î±-Triglycyl-8-lysine]-vasopressin]], 1-Triglycyl-8-lysine vasopressin, Glycylpressin, Glypressin, [[NÎ±-Glycyl-glycyl-glycyl-[8-lysine]-vasopressin]], NÎ±-Glycyl-glycyl-glycyl-lysine-vasopressin, NÎ±-Glycylglycylglycyl-vasopressin, NÎ±-Gly-Gly-Gly-8-Lys-vasopressin, Remestyp, terlipressin, terlipressina, terlipressine, Triglycyl-8-lysine-vasopressin, Vasopressin, N-(glycylglycylglycyl)-8-L-lysine-, [[Vasopressin, N-[N-(N-glycylglycyl)glycyl]-8-L-lysine-]]

* Terlipressin found on commonchemistry - Terlipressin
* 14636-12-5 (exact match) Matches CAS (14636-12-5) on page
Name in list

All names: [[[N-Î±-Triglycyl-8-lysine]-vasopressin]], 1-Triglycyl-8-lysine vasopressin, Glycylpressin, Glypressin, [[NÎ±-Glycyl-glycyl-glycyl-[8-lysine]-vasopressin]], NÎ±-Glycyl-glycyl-glycyl-lysine-vasopressin, NÎ±-Glycylglycylglycyl-vasopressin, NÎ±-Gly-Gly-Gly-8-Lys-vasopressin, Remestyp, [[terlipressin]], [[terlipressina]], [[terlipressine]], Triglycyl-8-lysine-vasopressin, Vasopressin, N-(glycylglycylglycyl)-8-L-lysine-, [[Vasopressin, N-[N-(N-glycylglycyl)glycyl]-8-L-lysine-]]

* No ChemSpiderID

* PubChem: 72081

* No InChI

* No SMILES
Terodiline (9855)

* No CASNo

* Terodiline not found on commonchemistry - Terodiline

* No ChemSpiderID

* PubChem: 23480

* No InChI

* No SMILES
Terphenyl (9856)
```
Botcommand: addindex 359676874 Terphenyl
```
```
For index : Terphenyl=359676874
```
* 92-94-4 -> 92-94-4 - NOT VERIFIED

* CAS found on commonchemistry - 92-94-4 - name in list
All names: 1,1':4',1''-Terphenyl, 1,1':4',1''-Terphenyl, 1,1':4',1''-Terphenyl, 1,1'-Biphenyl, 4-phenyl-, 1,4-Diphenylbenzene, 1,4-DIPHENYLBENZOL, 4-Phenyl-1,1'-biphenyl, 4-Phenylbiphenyl, NSC 6810, p-Diphenylbenzene, p-Phenylene trimer, PT, p-terfenilo, p-terphenyl, p-Terphenyle, PTP, p-Triphenyl, Santowax P, T 3203, TP, TP (scintillator)

* Terphenyl found on commonchemistry - Terphenyl
* 26140-60-3 (Formula: C18H14; Name: Terphenyl)

* 84-15-1 (Formula: C18H14; Name: 1,1':2',1-Terphenyl)

* 92-06-8 (Formula: C18H14; Name: 1,1':3',1-Terphenyl)

* 92-94-4 (Formula: C18H14; Name: 1,1':4',1-Terphenyl) Matches CAS (92-94-4) on page

* 166663-25-8 (Formula: C58H73N7O17; Name: Echinocandin B, 1-[(4R,5R)-4,5-dihydroxy-N2-[[4-(pentyloxy)[1,1':4',1-terphenyl]-4-yl]carbonyl]-L-ornithine]-)

* No ChemSpiderID

* PubChem: 7115

* No InChI

* SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3
Tert-Amyl_chloride (9860)
```
Botcommand: addindex 337730192 Tert-Amyl_chloride
```
```
For index : Tert-Amyl_chloride=337730192
```
* 594-36-5 -> 594-36-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tert+Amyl+chloride not found on commonchemistry - Tert+Amyl+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCC(C)(Cl)C
Tert-Amyl_methyl_ether (9861)
```
Botcommand: addindex 356375003 Tert-Amyl_methyl_ether
```
```
For index : Tert-Amyl_methyl_ether=356375003
```
* 994-05-8 -> 994-05-8 - NOT VERIFIED

* CAS found on commonchemistry - 994-05-8 - name in list
All names: 1,1-Dimethylpropyl methyl ether, 2-Methoxy-2-methylbutan, 2-Methoxy-2-methylbutane, 2-Methyl-2-methoxy butane, 2-Methyl-2-methoxybutane, 2-metil-2-metoxibutano, Butane, 2-methoxy-2-methyl-, Butane,2-methoxy-2-methyl-, Ether, methyl tert-pentyl, Methyl 1,1-dimethylpropyl ether, Methyl tert-amyl ether, Methyl tertiary amyl ether, Methyl tert-pentyl ether, TAME, TAME (ether), t-Amyl methyl ether, tert-Amyl methyl ether, tert-Pentyl methyl ether

* Tert+Amyl+methyl+ether not found on commonchemistry - Tert+Amyl+methyl+ether

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tert-Butyl_bromide (9864)
```
Botcommand: addindex 351858201 Tert-Butyl_bromide
```
```
For index : Tert-Butyl_bromide=351858201
```
* 507-19-7 -> 507-19-7 - NOT VERIFIED

* CAS found on commonchemistry - 507-19-7 - name in list
All names: 1,1-Dimethylethyl bromide, 2-Brom-2-methylpropan, 2-Bromo-2-methylpropane, 2-bromo-2-metilpropano, 2-Bromoisobutane, 2-Methyl-2-bromopropane, BROMIDE BUTYL TERTIARY, Bromotrimethylmethane, NSC 8418, Propane, 2-bromo-2-methyl-, tert-Butyl bromide, Trimethylbromomethane, UN 2342

* Tert+Butyl+bromide not found on commonchemistry - Tert+Butyl+bromide

* No ChemSpiderID

* PubChem: 24848212

* No InChI

* SMILES: CC(C)(C)Br
Tert-Butylhydroquinone (9869)
```
Botcommand: addindex 361744622 Tert-Butylhydroquinone
```
```
For index : Tert-Butylhydroquinone=361744622
```
* 1948-33-0 -> 1948-33-0 - NOT VERIFIED

* CAS found on commonchemistry - 1948-33-0 - name in list
All names: 1,4-Benzenediol, 2-(1,1-dimethylethyl)-, 2-(1,1-Dimethylethyl)-1,4-benzenediol, 2-(1,1-Dimethylethyl)hydroquinone, 2-(tert-Butyl)-p-hydroquinone, 2-t-Butylhydroquinone, 2-terc-butilhidroquinona, 2-tert-Butyl-1,4-benzenediol, 2-tert-Butyl-1,4-dihydroxybenzene, 2-tert-Butyl-1,4-hydroquinone, 2-tert-Butylhydrochinon, 2-tert-Butylhydroquinone, Banox 20BA, HYDROQUINONE, T-BUTYL-, Hydroquinone, tert-butyl-, Keniox 20, MC-TB 20, Mono-tert-butylhydroquinone, MONOTERTIARY BUTYL HYDROQUINONE, Mono-tertiarybutylhydroquinone, MTBHQ, NSC 4972, TBHQ, t-Butylhydroquinone, Tenox 20, Tenox TBHQ, TERT.-BUTYLHYDROCHINON, TERT-BUTYL HYDROQUINONE, tert-Butyl-1,4-benzenediol, tert-Butyldihydroxybenzene, TERT-BUTYLHYDROQUINONE

* Tert+Butylhydroquinone not found on commonchemistry - Tert+Butylhydroquinone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C)(C)c1cc(O)ccc1O
Tertatolol (9871)
```
Botcommand: addindex 360225192 Tertatolol
```
```
For index : Tertatolol=360225192
```
* 34784-64-0 -> 34784-64-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tertatolol not found on commonchemistry - Tertatolol

* No ChemSpiderID

* PubChem: 36920

* No InChI

* No SMILES
Terthiophene (9872)
```
Botcommand: addindex 316315919 Terthiophene
```
```
For index : Terthiophene=316315919
```
* 1081-34-1 -> 1081-34-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Terthiophene not found on commonchemistry - Terthiophene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Terutroban (9873)

* No CASNo

* Terutroban not found on commonchemistry - Terutroban

* No ChemSpiderID

* PubChem: 23674098

* No InChI

* No SMILES
Tesaglitazar (9874)
```
Botcommand: addindex 341835026 Tesaglitazar
```
```
For index : Tesaglitazar=341835026
```
* 251565-85-2 -> 251565-85-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tesaglitazar not found on commonchemistry - Tesaglitazar

* No ChemSpiderID

* PubChem: 208901

* No InChI

* No SMILES
Tesetaxel (9875)
```
Botcommand: addindex 355277765 Tesetaxel
```
```
For index : Tesetaxel=355277765
```
* 333754-36-2 -> 333754-36-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tesetaxel not found on commonchemistry - Tesetaxel

* No ChemSpiderID

* PubChem: 6918574

* No InChI

* No SMILES
Tesofensine (9876)
```
Botcommand: addindex 363021407 Tesofensine
```
```
For index : Tesofensine=363021407
```
* 402856-42-2 -> 402856-42-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tesofensine not found on commonchemistry - Tesofensine

* No ChemSpiderID

* PubChem: 11370864

* No InChI

* No SMILES
Testosterone_undecanoate (9879)
```
Botcommand: addindex 358766152 Testosterone_undecanoate
```
```
For index : Testosterone_undecanoate=358766152
```
* 5949-44-0 -> 5949-44-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Testosterone+undecanoate not found on commonchemistry - Testosterone+undecanoate

* ChemSpiderID: 43121994 - UNKNOWN

* PubChem: 65157

* No InChI

* No SMILES
Tetanus_vaccine (9880)
* No CASNo

* Tetanus+vaccine not found on commonchemistry - Tetanus+vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetra-tert-butylethylene (9884)
```
Botcommand: addindex 327183048 Tetra-tert-butylethylene
```
```
For index : Tetra-tert-butylethylene=327183048
```
* 75245-23-7 -> 75245-23-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetra+tert+butylethylene not found on commonchemistry - Tetra+tert+butylethylene

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C)(C)C(C(C)(C)C)=C(C(C)(C)C)C(C)(C)C
Tetra-tert-butylmethane (9885)
```
Botcommand: addindex 358231823 Tetra-tert-butylmethane
```
```
For index : Tetra-tert-butylmethane=358231823
```
* 4103-17-7 -> 4103-17-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetra+tert+butylmethane not found on commonchemistry - Tetra+tert+butylmethane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CC(C)(C)C(C(C)(C)C)(C(C)(C)C)C(C)(C)C
Tetraacetylethylenediamine (9886)
```
Botcommand: addindex 306607222 Tetraacetylethylenediamine
```
```
For index : Tetraacetylethylenediamine=306607222
```
* 10543-57-4 -> 10543-57-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraacetylethylenediamine not found on commonchemistry - Tetraacetylethylenediamine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: S=O=C(C)N(C(C)=O)CCN(C(C)=O)C(C)=O
Tetraazidomethane (9887)
```
Botcommand: addindex 316642147 Tetraazidomethane
```
```
For index : Tetraazidomethane=316642147
```
* 869384-16-7 -> 869384-16-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraazidomethane not found on commonchemistry - Tetraazidomethane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: [N-]=[N+]=NC(N=[N+]=[N-])(N=[N+]=[N-])N=[N+]=[N-]
Tetraborane (9889)
```
Botcommand: addindex 265746936 Tetraborane
```
```
For index : Tetraborane=265746936
```
* 18283-93-7 -> 18283-93-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraborane not found on commonchemistry - Tetraborane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrabromoethane (9891)
```
Botcommand: addindex 330437575 Tetrabromoethane
```
```
For index : Tetrabromoethane=330437575
```
* 79-27-6 -> 79-27-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrabromoethane not found on commonchemistry - Tetrabromoethane

* No ChemSpiderID

* PubChem: 6588

* No InChI

* SMILES: C(C(Br)Br)(Br)Br
Tetracarbon_dioxide (9896)

* No CASNo

* Tetracarbon+dioxide not found on commonchemistry - Tetracarbon+dioxide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C=C=C=C=O
Tetracarbonylhydrocobalt (9897)
```
Botcommand: addindex 361578359 Tetracarbonylhydrocobalt
```
```
For index : Tetracarbonylhydrocobalt=361578359
```
* 16842-03-8 -> 16842-03-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetracarbonylhydrocobalt not found on commonchemistry - Tetracarbonylhydrocobalt

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrachloro-m-xylene (9899)
```
Botcommand: addindex 272070036 Tetrachloro-m-xylene
```
```
For index : Tetrachloro-m-xylene=272070036
```
* 877-09-8 -> 877-09-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrachloro+m+xylene not found on commonchemistry - Tetrachloro+m+xylene

* No ChemSpiderID

* PubChem: 70139

* No InChI

* SMILES: Cc1c(Cl)c(C)c(Cl)c(Cl)c1Cl

9901 to 9950[edit]

Tetrachlorodecaoxide (9901)
File:Tetrachlorodecaoxide.png
```
Botcommand: addindex 351491335 Tetrachlorodecaoxide
```
```
For index : Tetrachlorodecaoxide=351491335
```
* 92047-76-2 -> 92047-76-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrachlorodecaoxide not found on commonchemistry - Tetrachlorodecaoxide

* No ChemSpiderID

* PubChem: 3000391

* No InChI

* No SMILES
Tetracosactide (9903)
```
Botcommand: addindex 317347848 Tetracosactide
```
```
For index : Tetracosactide=317347848
```
* 16960-16-0 -> 16960-16-0 - NOT VERIFIED

* CAS found on commonchemistry - 16960-16-0 - name in list
All names: (1-24)Î±-ACTH, 10: PN: WO03051390 PAGE: 52 claimed protein, 1-24 ACTH (human), 1-24 corticotropin (human), 20: PN: WO2006052468 SEQID: 2 claimed sequence, 2136: PN: WO03060071 SEQID: 2198 unclaimed, 4: PN: WO2004045592 SEQID: 3 unclaimed sequence, 8: PN: WO0069900 SEQID: 7 unclaimed sequence, ACTH1-24, Actholain, ACTHÎ±1-24, Adrenocorticotropin(1-24), Ba 30920, Ba 36716, Corticotropin-(1-24), Cortrophin S, Cortrosinta, Cortrosyn, Cosyntropin, Human ACTH (1-24), L-Proline, L-seryl-L-tyrosyl-L-seryl-L-methionyl-L-glutamyl-L-Î±-histidyl-L-phenylalanyl-L-arginyl-L-tryptophylglycyl-L-lysyl-L-prolyl-L-valylglycyl-L-lysyl-L-lysyl-L-arginyl-L-arginyl-L-prolyl-L-valyl-L-lysyl-L-valyl-L-tyrosyl-, Nuvacthen Depot, PN: WO9952928 SEQID: 9 claimed protein, Porcine ACTH (1-24), Synacthen, Synacthene, Synacthene-retard, Synecthen, Tetracosactid, Tetracosactid, tetracosactida, tetracosactide, Tetracosactrin, Tetracosapeptide, Î±1-24-ACTH, Î±1-24-Adrenocorticotropic hormone, Î±1-24-Corticotropin, Î²1-24-ACTH, Î²1-24-Corticotropin, Î²1-24-Tetracosactide, Î²-Corticotrophin-(1-24)-tetracosapeptide

* Tetracosactide found on commonchemistry - Tetracosactide
* 16960-16-0 (exact match) Matches CAS (16960-16-0) on page
Name in list

All names: (1-24)Î±-ACTH, 10: PN: WO03051390 PAGE: 52 claimed protein, 1-24 ACTH (human), 1-24 corticotropin (human), 20: PN: WO2006052468 SEQID: 2 claimed sequence, 2136: PN: WO03060071 SEQID: 2198 unclaimed, 4: PN: WO2004045592 SEQID: 3 unclaimed sequence, 8: PN: WO0069900 SEQID: 7 unclaimed sequence, ACTH1-24, Actholain, ACTHÎ±1-24, Adrenocorticotropin(1-24), Ba 30920, Ba 36716, Corticotropin-(1-24), Cortrophin S, Cortrosinta, Cortrosyn, Cosyntropin, Human ACTH (1-24), L-Proline, L-seryl-L-tyrosyl-L-seryl-L-methionyl-L-glutamyl-L-Î±-histidyl-L-phenylalanyl-L-arginyl-L-tryptophylglycyl-L-lysyl-L-prolyl-L-valylglycyl-L-lysyl-L-lysyl-L-arginyl-L-arginyl-L-prolyl-L-valyl-L-lysyl-L-valyl-L-tyrosyl-, Nuvacthen Depot, PN: WO9952928 SEQID: 9 claimed protein, Porcine ACTH (1-24), Synacthen, Synacthene, Synacthene-retard, Synecthen, Tetracosactid, Tetracosactid, tetracosactida, [[tetracosactide]], Tetracosactrin, Tetracosapeptide, Î±1-24-ACTH, Î±1-24-Adrenocorticotropic hormone, Î±1-24-Corticotropin, Î²1-24-ACTH, Î²1-24-Corticotropin, [[Î²1-24-tetracosactide]], Î²-Corticotrophin-(1-24)-tetracosapeptide

* No ChemSpiderID

* PubChem: 16129617

* No InChI

* No SMILES
Tetraethylammonium (9910)
```
Botcommand: addindex 329678726 Tetraethylammonium
```
```
For index : Tetraethylammonium=329678726
```
* 66-40-0 -> 66-40-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraethylammonium found on commonchemistry - Tetraethylammonium
* 56-34-8 (Formula: C8H20N.Cl; Name: Ethanaminium, N,N,N-triethyl-, chloride)

* 68-05-3 (Formula: C8H20N.I; Name: Ethanaminium, N,N,N-triethyl-, iodide)

* 71-91-0 (Formula: C8H20N.Br; Name: Ethanaminium, N,N,N-triethyl-, bromide)

* 77-98-5 (Formula: C8H20N.HO; Name: Ethanaminium, N,N,N-triethyl-, hydroxide)

* 429-06-1 (Formula: C8H20N.BF4; Name: Ethanaminium, N,N,N-triethyl-, tetrafluoroborate(1-))

* 2567-83-1 (Formula: C8H20N.ClO4; Name: Ethanaminium, N,N,N-triethyl-, perchlorate)

* No ChemSpiderID

* PubChem: 5413

* No InChI

* SMILES: CC[N+](CC)(CC)CC
Tetraethylgermanium (9912)
```
Botcommand: addindex 280148188 Tetraethylgermanium
```
```
For index : Tetraethylgermanium=280148188
```
* 597-63-7 -> 597-63-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraethylgermanium not found on commonchemistry - Tetraethylgermanium

* ChemSpiderID: 11211 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C8H20Ge/c1-5-9(6-2,7-3)8-4/h5-8H2,1-4H3 )

* No SMILES - (ChemSpider: | SMILES=CC[Ge](CC)(CC)CC )
Tetrafluorohydrazine (9914)
```
Botcommand: addindex 329718136 Tetrafluorohydrazine
```
```
For index : Tetrafluorohydrazine=329718136
```
* 10036-47-2 -> 10036-47-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrafluorohydrazine not found on commonchemistry - Tetrafluorohydrazine

* No ChemSpiderID

* No PubChem

* InChI: 1/F4N2/c1

* SMILES: FN(F)N(F)F
Tetragalacturonic_acid_hydroxymethylester (9916)
```
Botcommand: addindex 316571592 Tetragalacturonic_acid_hydroxymethylester
```
```
For index : Tetragalacturonic_acid_hydroxymethylester=316571592
```
* 53008-15-4 -> 53008-15-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetragalacturonic+acid+hydroxymethylester not found on commonchemistry - Tetragalacturonic+acid+hydroxymethylester

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C(O)OC(=O)[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@@H]([C@H]([C@H](O[C@@H]2C(=O)OCO)O[C@@H]3[C@@H]([C@H]([C@H](O[C@@H]3C(=O)OCO)O[C@@H]4[C@@H]([C@H]([C@H](O[C@@H]4C(=O)OCO)O)O)O)O)O)O)O)O)O)O
Tetrahydrocannabinol-C4 (9919)

* No CASNo

* Tetrahydrocannabinol+C not found on commonchemistry - Tetrahydrocannabinol+C

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrahydrocannabivarin (9920)
```
Botcommand: addindex 355278909 Tetrahydrocannabivarin
```
```
For index : Tetrahydrocannabivarin=355278909
```
* 28172-17-0 -> 28172-17-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrocannabivarin not found on commonchemistry - Tetrahydrocannabivarin

* ChemSpiderID: 31500 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 34180

* No InChI - (ChemSpider: | InChI=InChI=1/C19H26O2/c1-5-6-13-10-16(20)18-14-9-12(2)7-8-15(14)19(3,4)21-17(18)11-13/h9-11,14-15,20H,5-8H2,1-4H3 )

* No SMILES - (ChemSpider: | smiles=Oc2cc(cc1OC(C3CC/C(=C\C3c12)C)(C)C)CCC )
Tetrahydrocortisol (9921)
```
Botcommand: addindex 289350854 Tetrahydrocortisol
```
```
For index : Tetrahydrocortisol=289350854
```
* 53-02-1 -> 53-02-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrocortisol not found on commonchemistry - Tetrahydrocortisol

* No ChemSpiderID

* PubChem: 5864

* No InChI

* SMILES: C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O)O
Tetrahydrocortisone (9922)
```
Botcommand: addindex 282989104 Tetrahydrocortisone
```
```
For index : Tetrahydrocortisone=282989104
```
* 53-05-4 -> 53-05-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrocortisone not found on commonchemistry - Tetrahydrocortisone

* No ChemSpiderID

* PubChem: 5866

* No InChI

* SMILES: C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O
Tetrahydrodeoxycorticosterone (9923)
```
Botcommand: addindex 343027095 Tetrahydrodeoxycorticosterone
```
```
For index : Tetrahydrodeoxycorticosterone=343027095
```
* 567-03-3 -> 567-03-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrodeoxycorticosterone not found on commonchemistry - Tetrahydrodeoxycorticosterone

* No ChemSpiderID

* PubChem: 91475

* No InChI

* No SMILES
Tetrahydrofolic_acid (9924)
```
Botcommand: addindex 325427698 Tetrahydrofolic_acid
```
```
For index : Tetrahydrofolic_acid=325427698
```
* 29347-89-5 -> 29347-89-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrofolic+acid found on commonchemistry - Tetrahydrofolic+acid
* 135-16-0 (Formula: C19H23N7O6; Name: L-Glutamic acid, N-[4-[[(2-amino-1,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-)

* 58-05-9 (Formula: C20H23N7O7; Name: L-Glutamic acid, N-[4-[[(2-amino-5-formyl-1,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-)

* No ChemSpiderID

* PubChem: 1129

* No InChI

* No SMILES
Tetrahydrogestrinone (9926)
```
Botcommand: addindex 364095306 Tetrahydrogestrinone
```
```
For index : Tetrahydrogestrinone=364095306
```
* 618903-56-3 -> 618903-56-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrogestrinone not found on commonchemistry - Tetrahydrogestrinone

* ChemSpiderID: 20581259 - UNKNOWN

* No PubChem

* No InChI

* No SMILES
Tetrahydroharman (9927)
```
Botcommand: addindex 325097168 Tetrahydroharman
```
```
For index : Tetrahydroharman=325097168
```
* 2506-10-17 -> 2506-10-17 - NOT VERIFIED

* The CAS number '2506-10-17' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Tetrahydroharman not found on commonchemistry - Tetrahydroharman

* No ChemSpiderID

* PubChem: 91522

* No InChI

* SMILES: CC1C2=C(CCN1) C3=CC=CC=C3N2<ref name="PubChem"/>
Tetrahydromethanopterin (9929)

* No CASNo

* Tetrahydromethanopterin not found on commonchemistry - Tetrahydromethanopterin

* No ChemSpiderID

* PubChem: 5459995

* No InChI

* No SMILES
Tetrahydropalmatine (9930)
```
Botcommand: addindex 359683388 Tetrahydropalmatine
```
```
For index : Tetrahydropalmatine=359683388
```
* 10097-84-4 -> 10097-84-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydropalmatine not found on commonchemistry - Tetrahydropalmatine

* No ChemSpiderID

* PubChem: 72301

* No InChI

* No SMILES
Tetrahydroxy-1,4-benzoquinone (9933)
```
Botcommand: addindex 352536104 Tetrahydroxy-1,4-benzoquinone
```
```
For index : Tetrahydroxy-1,4-benzoquinone=352536104
```
* 319-89-1 -> 319-89-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydroxy+benzoquinone not found on commonchemistry - Tetrahydroxy+benzoquinone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(C(O)=C1O)C(O)=C(O)C1=O
Tetrahydroxy-1,4-benzoquinone_biscarbonate (9934)

* No CASNo

* Tetrahydroxy+benzoquinone+biscarbonate not found on commonchemistry - Tetrahydroxy+benzoquinone+biscarbonate

* No ChemSpiderID

* PubChem: 13382131

* No InChI

* SMILES: C12=C(C(=O)C3=C(C1=O)OC(=O)O3)OC(=O)O2
Tetrahydroxy-1,4-benzoquinone_bisoxalate (9935)

* No CASNo

* Tetrahydroxy+benzoquinone+bisoxalate not found on commonchemistry - Tetrahydroxy+benzoquinone+bisoxalate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C1C(OC2=O)=C(OC2=O)C(C3=C1OC(C(O3)=O)=O)=O
Tetrahydrozoline (9936)
```
Botcommand: addindex 361358300 Tetrahydrozoline
```
```
For index : Tetrahydrozoline=361358300
```
* 84-22-0 -> 84-22-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrahydrozoline not found on commonchemistry - Tetrahydrozoline

* No ChemSpiderID

* PubChem: 5419

* No InChI

* SMILES: C1CC(C2=CC=CC=C2C1)C3=NCCN3
Tetrairidium_dodecacarbonyl (9937)
```
Botcommand: addindex 328703188 Tetrairidium_dodecacarbonyl
```
```
For index : Tetrairidium_dodecacarbonyl=328703188
```
* 18827-81-1 -> 18827-81-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrairidium+dodecacarbonyl not found on commonchemistry - Tetrairidium+dodecacarbonyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrakis(acetonitrile)copper(I)_hexafluorophosphate (9938)
```
Botcommand: addindex 361591534 Tetrakis(acetonitrile)copper(I)_hexafluorophosphate
```
```
For index : Tetrakis(acetonitrile)copper(I)_hexafluorophosphate=361591534
```
* 64443-05-6 -> 64443-05-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrakis+acetonitrile+copper+I+hexafluorophosphate not found on commonchemistry - Tetrakis+acetonitrile+copper+I+hexafluorophosphate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrakis(dimethylamido)titanium (9939)
```
Botcommand: addindex 348610289 Tetrakis(dimethylamido)titanium
```
```
For index : Tetrakis(dimethylamido)titanium=348610289
```
* 3275-24-9 -> 3275-24-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrakis+dimethylamido+titanium not found on commonchemistry - Tetrakis+dimethylamido+titanium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrakis(hydroxymethyl)phosphonium_chloride (9940)
```
Botcommand: addindex 352687126 Tetrakis(hydroxymethyl)phosphonium_chloride
```
```
For index : Tetrakis(hydroxymethyl)phosphonium_chloride=352687126
```
* 124-64-1 -> 124-64-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrakis+hydroxymethyl+phosphonium+chloride not found on commonchemistry - Tetrakis+hydroxymethyl+phosphonium+chloride

* No ChemSpiderID

* PubChem: 31298

* No InChI

* No SMILES
Tetrakis(triphenylphosphine)platinum(0) (9942)
```
Botcommand: addindex 346383471 Tetrakis(triphenylphosphine)platinum(0)
```
```
For index : Tetrakis(triphenylphosphine)platinum(0)=346383471
```
* 14221-02-4 -> 14221-02-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrakis+triphenylphosphine+platinum not found on commonchemistry - Tetrakis+triphenylphosphine+platinum

* No ChemSpiderID

* PubChem: 11979705

* No InChI

* No SMILES
Tetralinylaminopropane (9944)
```
Botcommand: addindex 359719098 Tetralinylaminopropane
```
```
For index : Tetralinylaminopropane=359719098
```
* ? -> ? - NOT VERIFIED

* The CAS number '?' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Tetralinylaminopropane not found on commonchemistry - Tetralinylaminopropane

* ChemSpiderID: 23204045 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 14964398

* No InChI - (ChemSpider: | InChI=InChI=1/C13H19N/c1-10(14)8-11-6-7-12-4-2-3-5-13(12)9-11/h6-7,9-10H,2-5,8,14H2,1H3 )

* No SMILES - (ChemSpider: | smiles=CC(Cc1ccc2c(c1)CCCC2)N )
Tetralone (9945)
```
Botcommand: addindex 361749842 Tetralone
```
```
For index : Tetralone=361749842
```
* 529-34-0 -> 529-34-0 - NOT VERIFIED

* CAS found on commonchemistry - 529-34-0 - name in list
All names: 1(2H)-Naphthalenone, 3,4-dihydro-, 1,2,3,4-tetrahidronaftalen-1-ona, 1,2,3,4-Tetrahydro-1-oxonaphthalene, 1,2,3,4-Tetrahydronaphtalen-1-one, 1,2,3,4-tetrahydronaphtalene-1-one, 1,2,3,4-tetrahydronaphthalen-1-one, 1,2,3,4-Tetrahydronaphthalin-1-on, 1-Oxo-1,2,3,4-tetrahydronaphthalene, 1-Oxotetralin, 1-TETRALON, 1-Tetralone, 3,4-Dihydro-1(2H)-naphthalenone, 3,4-Dihydro-2H-naphthalen-1-one, 3,4-Dihydronaphthalen-1(2H)-one, NAPHTHALEN-1-ONE, 1,2,3,4-TETRAHYDRO-, NSC 5171, Î±-Tetralon, Î±-Tetralone

* Tetralone found on commonchemistry - Tetralone
* 529-34-0 (exact match) Matches CAS (529-34-0) on page
Name in list

All names: 1(2H)-Naphthalenone, 3,4-dihydro-, 1,2,3,4-tetrahidronaftalen-1-ona, 1,2,3,4-Tetrahydro-1-oxonaphthalene, 1,2,3,4-Tetrahydronaphtalen-1-one, 1,2,3,4-tetrahydronaphtalene-1-one, 1,2,3,4-tetrahydronaphthalen-1-one, 1,2,3,4-Tetrahydronaphthalin-1-on, 1-Oxo-1,2,3,4-tetrahydronaphthalene, 1-Oxotetralin, 1-TETRALON, [[1-tetralone]], 3,4-Dihydro-1(2H)-naphthalenone, 3,4-Dihydro-2H-naphthalen-1-one, 3,4-Dihydronaphthalen-1(2H)-one, NAPHTHALEN-1-ONE, 1,2,3,4-TETRAHYDRO-, NSC 5171, Î±-Tetralon, [[Î±-tetralone]]

* No ChemSpiderID

* PubChem: 10724

* No InChI

* SMILES: C1CC2=CC=CC=C2C(=O)C1
Tetramethrin (9946)
```
Botcommand: addindex 352895695 Tetramethrin
```
```
For index : Tetramethrin=352895695
```
* 7696-12-0 -> 7696-12-0 - NOT VERIFIED

* CAS found on commonchemistry - 7696-12-0 - name in list
All names: (1,3,4,5,6,7-Hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate, (1-Cyclohexene-1,2-dicarboximido)methyl chrysanthemate, (1-Cyclohexene-1,2-dicarboximido)methyl chrysanthemumate, 2,2-Dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic acid (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester, 3,4,5,6-Tetrahydrophthalimidomethyl (1RS)-cis-trans-chrysanthemate, Bioneo-Pynamin, Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester, Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester, Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methylpropenyl)-, ester with N-(hydroxymethyl)-1-cyclohexene-1,2-dicarboximide, d-Tetramethrin, D-TETRAMETHRIN, Insectol, N-(3,4,5,6-tetrahydrophthalimide methyl-d,l-cis,trans-crysanthemate, NEOPYNAMIN, Neo-Pynamin, Neo-Pynamin Forte, Phthalthrin, Pibutox, Pion 1, Pyrethrol L, tetramethrin, tetramethrine, tetrametrin

* Tetramethrin found on commonchemistry - Tetramethrin
* 7696-12-0 (exact match) Matches CAS (7696-12-0) on page
Name in list

All names: (1,3,4,5,6,7-Hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate, (1-Cyclohexene-1,2-dicarboximido)methyl chrysanthemate, (1-Cyclohexene-1,2-dicarboximido)methyl chrysanthemumate, 2,2-Dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic acid (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester, 3,4,5,6-Tetrahydrophthalimidomethyl (1RS)-cis-trans-chrysanthemate, Bioneo-Pynamin, Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester, Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester, Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methylpropenyl)-, ester with N-(hydroxymethyl)-1-cyclohexene-1,2-dicarboximide, [[d-tetramethrin]], [[D-tetramethrin]], Insectol, N-(3,4,5,6-tetrahydrophthalimide methyl-d,l-cis,trans-crysanthemate, NEOPYNAMIN, Neo-Pynamin, Neo-Pynamin Forte, Phthalthrin, Pibutox, Pion 1, Pyrethrol L, [[tetramethrin]], [[tetramethrine]], tetrametrin

* No ChemSpiderID

* No PubChem

* InChI: InChI=1/C19H25NO4/c1-11(2)9-14-15 (19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13 (12)17(20)22/h9,14-15H,5-8,10H2,1-4H3

* SMILES: CC(=CC1C(C1(C)C)C(=O) OCN2C(=O)C3=C(C2=O)CCCC3)C
Tetramethylammonium_pentafluoroxenate (9950)

* No CASNo

* Tetramethylammonium+pentafluoroxenate not found on commonchemistry - Tetramethylammonium+pentafluoroxenate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

9951 to 10000[edit]

Tetramethylazodicarboxamide (9951)
```
Botcommand: addindex 326346384 Tetramethylazodicarboxamide
```
```
For index : Tetramethylazodicarboxamide=326346384
```
* 10465-78-8 -> 10465-78-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetramethylazodicarboxamide not found on commonchemistry - Tetramethylazodicarboxamide

* No ChemSpiderID

* PubChem: 4278

* No InChI

* SMILES: CN(C)C(=O)N=NC(=O)N(C)C
Tetramethylbutane (9952)
```
Botcommand: addindex 356145413 Tetramethylbutane
```
```
For index : Tetramethylbutane=356145413
```
* 594-82-1 -> 594-82-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetramethylbutane not found on commonchemistry - Tetramethylbutane

* No ChemSpiderID

* PubChem: 11675

* No InChI

* SMILES: CC(C)(C)C(C)(C)C
Tetramethylenedisulfotetramine (9953)
```
Botcommand: addindex 364269283 Tetramethylenedisulfotetramine
```
```
For index : Tetramethylenedisulfotetramine=364269283
```
* 80-12-6 -> 80-12-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetramethylenedisulfotetramine not found on commonchemistry - Tetramethylenedisulfotetramine

* No ChemSpiderID

* PubChem: 64148

* No InChI

* SMILES: C1N2CN3CN(S2(=O)=O)CN1S3(=O)=O
Tetramethylsuccinonitrile (9956)
```
Botcommand: addindex 272070079 Tetramethylsuccinonitrile
```
```
For index : Tetramethylsuccinonitrile=272070079
```
* 3333-52-6 -> 3333-52-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetramethylsuccinonitrile not found on commonchemistry - Tetramethylsuccinonitrile

* No ChemSpiderID

* PubChem: 18745

* No InChI

* SMILES: CC(C)(C#N)C(C)(C)C#N
Tetramminecopper(II)_sulfate (9958)
```
Botcommand: addindex 365237522 Tetramminecopper(II)_sulfate
```
```
For index : Tetramminecopper(II)_sulfate=365237522
```
* 14283-05-7 -> 14283-05-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetramminecopper+II+sulfate not found on commonchemistry - Tetramminecopper+II+sulfate

* No ChemSpiderID

* PubChem: 61513

* No InChI

* No SMILES
Tetrandrine (9959)
```
Botcommand: addindex 343862342 Tetrandrine
```
```
For index : Tetrandrine=343862342
```
* 518-34-3 -> 518-34-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrandrine not found on commonchemistry - Tetrandrine

* No ChemSpiderID

* PubChem: 73078

* No InChI

* SMILES: CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC
Tetraoctylammonium_bromide (9961)
```
Botcommand: addindex 265732647 Tetraoctylammonium_bromide
```
```
For index : Tetraoctylammonium_bromide=265732647
```
* 14866-33-2 -> 14866-33-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraoctylammonium+bromide not found on commonchemistry - Tetraoctylammonium+bromide

* No ChemSpiderID

* PubChem: 2734117

* No InChI

* SMILES: CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Br-]
Tetraphenyl_butadiene (9962)
```
Botcommand: addindex 333544114 Tetraphenyl_butadiene
```
```
For index : Tetraphenyl_butadiene=333544114
```
* 1450-63-1 -> 1450-63-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraphenyl+butadiene not found on commonchemistry - Tetraphenyl+butadiene

* ChemSpiderID: 66678 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 74060

* No InChI - (ChemSpider: | InChI=InChI=1/C28H22/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22H )

* No SMILES - (ChemSpider: | SMILES=C(\C=C(/c1ccccc1)c2ccccc2)=C(\c3ccccc3)c4ccccc4 )
Tetraphenylborate (9963)
```
Botcommand: addindex 361494789 Tetraphenylborate
```
```
For index : Tetraphenylborate=361494789
```
* 4358-26-3 -> 4358-26-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraphenylborate found on commonchemistry - Tetraphenylborate
* 143-66-8 (exact match)
Name in list

All names: Borate(1-), tetraphenyl sodium, Borate(1-), tetraphenyl-, sodium, Borate(1-), tetraphenyl-, sodium (1:1), Kalibor, Kalignost, Kariporu K, Natriumtetraphenylborat, Sodium tetrakis(phenyl) borate, [[sodium tetraphenylborate]], [[Sodium tetraphenylborate (NaPh4B)]], [[Sodium tetraphenylborate(1-)]], Sodium tetraphenylboride, Sodium tetraphenylboride(1-), SODIUM TETRAPHENYLBORON, [[Sodiumtetraphenylborate]], tetrafenilborato de sodio, Tetraphenyl boron sodium salt, Tetraphenyl sodium borate, [[tetraphenylborate de sodium]], TETRAPHENYLBORON SODIUM

* No ChemSpiderID

* PubChem: 8934

* No InChI

* SMILES: [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Tetraphenylcyclopentadienone (9964)
```
Botcommand: addindex 357263413 Tetraphenylcyclopentadienone
```
```
For index : Tetraphenylcyclopentadienone=357263413
```
* 479-33-4 -> 479-33-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraphenylcyclopentadienone not found on commonchemistry - Tetraphenylcyclopentadienone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C2C(=C(C(=C2c1ccccc1) c3ccccc)c4ccccc4)c5ccccc5
Tetraphenylene (9965)
```
Botcommand: addindex 333107346 Tetraphenylene
```
```
For index : Tetraphenylene=333107346
```
* 212-74-8 -> 212-74-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraphenylene not found on commonchemistry - Tetraphenylene

* No ChemSpiderID

* PubChem: 2724868

* No InChI

* SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3 C4=CC=CC=C4C5=CC=CC=C25
Tetraphenylmethane (9966)
```
Botcommand: addindex 305999045 Tetraphenylmethane
```
```
For index : Tetraphenylmethane=305999045
```
* 630-76-2 -> 630-76-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraphenylmethane not found on commonchemistry - Tetraphenylmethane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: c1ccccc1C(c2ccccc2)(c3ccccc3)c4ccccc4
Tetraphenylphosphonium_chloride (9967)
```
Botcommand: addindex 325144071 Tetraphenylphosphonium_chloride
```
```
For index : Tetraphenylphosphonium_chloride=325144071
```
* 2001-45-8 -> 2001-45-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetraphenylphosphonium+chloride not found on commonchemistry - Tetraphenylphosphonium+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetraphenylporphine_sulfonate (9968)

* No CASNo

* Tetraphenylporphine+sulfonate not found on commonchemistry - Tetraphenylporphine+sulfonate

* No ChemSpiderID

* PubChem: 49561

* No InChI

* No SMILES
Tetrapropylammonium_perruthenate (9970)
```
Botcommand: addindex 304988940 Tetrapropylammonium_perruthenate
```
```
For index : Tetrapropylammonium_perruthenate=304988940
```
* 114615-82-6 -> 114615-82-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrapropylammonium+perruthenate not found on commonchemistry - Tetrapropylammonium+perruthenate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCC[N+](CCC)(CCC)CCC.O=[Ru](=O)([O-])=O
Tetrarhodium_dodecacarbonyl (9971)
```
Botcommand: addindex 356772166 Tetrarhodium_dodecacarbonyl
```
```
For index : Tetrarhodium_dodecacarbonyl=356772166
```
* 19584-30-6 -> 19584-30-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrarhodium+dodecacarbonyl not found on commonchemistry - Tetrarhodium+dodecacarbonyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrasodium_tris(bathophenanthroline_disulfonate)ruthenium(II) (9973)
```
Botcommand: addindex 354611099 Tetrasodium_tris(bathophenanthroline_disulfonate)ruthenium(II)
```
```
For index : Tetrasodium_tris(bathophenanthroline_disulfonate)ruthenium(II)=354611099
```
* 301206-84-8 -> 301206-84-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrasodium+tris+bathophenanthroline+disulfonate+ruthenium+II not found on commonchemistry - Tetrasodium+tris+bathophenanthroline+disulfonate+ruthenium+II

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetrasulfur_tetranitride (9974)
```
Botcommand: addindex 338371293 Tetrasulfur_tetranitride
```
```
For index : Tetrasulfur_tetranitride=338371293
```
* 28950-34-7 -> 28950-34-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrasulfur+tetranitride not found on commonchemistry - Tetrasulfur+tetranitride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tetratriacontanoic_acid (9976)
```
Botcommand: addindex 350293549 Tetratriacontanoic_acid
```
```
For index : Tetratriacontanoic_acid=350293549
```
* 506-50-3 -> 506-50-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetratriacontanoic+acid not found on commonchemistry - Tetratriacontanoic+acid

* No ChemSpiderID

* PubChem: 94485

* No InChI

* SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O
Tetraxenonogold(II) (9977)

* No CASNo

* Tetraxenonogold+II not found on commonchemistry - Tetraxenonogold+II

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: XeAu(Xe)(Xe)Xe
Tetrazene (9978)
```
Botcommand: addindex 349966987 Tetrazene
```
```
For index : Tetrazene=349966987
```
* 54410-57-0 -> 54410-57-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrazene not found on commonchemistry - Tetrazene

* No ChemSpiderID

* PubChem: 5463295

* No InChI

* SMILES: N=NNN
Tetrazene_explosive (9979)
```
Botcommand: addindex 356322365 Tetrazene_explosive
```
```
For index : Tetrazene_explosive=356322365
```
* 31330-63-9 -> 31330-63-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrazene+explosive not found on commonchemistry - Tetrazene+explosive

* No ChemSpiderID

* PubChem: 5486788

* No InChI

* SMILES: N=C(N)N(N)/N=N/C1=NNN=N1
Tetrazepam (9980)
```
Botcommand: addindex 345312492 Tetrazepam
```
```
For index : Tetrazepam=345312492
```
* 10379-14-3 -> 10379-14-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrazepam not found on commonchemistry - Tetrazepam

* ChemSpiderID: 23551 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 25215

* No InChI - (ChemSpider: | InChI=InChI=1/C16H17ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h5,7-9H,2-4,6,10H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Clc3cc\1c(N(C(=O)C/N=C/1/C2=C/CCCC2)C)cc3 )
Tetrazolylglycine (9983)
```
Botcommand: addindex 343719700 Tetrazolylglycine
```
```
For index : Tetrazolylglycine=343719700
```
* 138199-51-6 -> 138199-51-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetrazolylglycine not found on commonchemistry - Tetrazolylglycine

* No ChemSpiderID

* PubChem: 126383

* No InChI

* SMILES: C1(=NNN=N1)C(C(=O)O)N
Tetrodotoxin (9984)
```
Botcommand: addindex 363571857 Tetrodotoxin
```
```
For index : Tetrodotoxin=363571857
```
* 4368-28-9 -> 4368-28-9 - NOT VERIFIED

* CAS found on commonchemistry - 4368-28-9 - name in list
All names: (-)-Tetrodotoxin, [[[4R-(4Î±,4aÎ±,5Î±,7Î±,9Î±,10Î±,10aÎ²,11S*,12S*)]-Octahydro-12-(hydroxymethyl)-2-imino-5,9:7,10a-dimethano-10aH-[1,3]dioxocino[6,5-d]pyrimidine-4,7,10,11,12-pentol]], [[5,9:7,10a-Dimethano-10aH-[1,3]dioxocino[6,5-d]pyrimidine-4,7,10,11,12-pentol, 2-amino-1,4,4a,5,9,10-hexahydro-12-(hydroxymethyl)-, (4R,4aR,5R,7S,9S,10S,10aR,11S,12S)-]], [[5,9:7,10a-Dimethano-10aH-[1,3]dioxocino[6,5-d]pyrimidine-4,7,10,11,12-pentol, octahydro-12-(hydroxymethyl)-2-imino-, [4R-(4Î±,4aÎ±,5Î±,7Î±,9Î±,10Î±,10aÎ²,11S*,12S*)]-]], 8a(1H)-Quinazolineorthoglycolic acid, octahydro-4,5,6,7,8-pentahydroxy-6-(hydroxymethyl)-2-imino-, cyclic 8a,5:8a,7-ester, Araregai toxin, Babylonia japonica toxin 1, BJT 1, Maculotoxin, Spheroidine, Tarichatoxin, Tetrodotoxin, tetrodotoxina, tetrodotoxine, Tetrodotoxine, TTX

* Tetrodotoxin found on commonchemistry - Tetrodotoxin
* 4368-28-9 (exact match) Matches CAS (4368-28-9) on page
Name in list

All names: [[(-)-tetrodotoxin]], [[[4R-(4Î±,4aÎ±,5Î±,7Î±,9Î±,10Î±,10aÎ²,11S*,12S*)]-Octahydro-12-(hydroxymethyl)-2-imino-5,9:7,10a-dimethano-10aH-[1,3]dioxocino[6,5-d]pyrimidine-4,7,10,11,12-pentol]], [[5,9:7,10a-Dimethano-10aH-[1,3]dioxocino[6,5-d]pyrimidine-4,7,10,11,12-pentol, 2-amino-1,4,4a,5,9,10-hexahydro-12-(hydroxymethyl)-, (4R,4aR,5R,7S,9S,10S,10aR,11S,12S)-]], [[5,9:7,10a-Dimethano-10aH-[1,3]dioxocino[6,5-d]pyrimidine-4,7,10,11,12-pentol, octahydro-12-(hydroxymethyl)-2-imino-, [4R-(4Î±,4aÎ±,5Î±,7Î±,9Î±,10Î±,10aÎ²,11S*,12S*)]-]], 8a(1H)-Quinazolineorthoglycolic acid, octahydro-4,5,6,7,8-pentahydroxy-6-(hydroxymethyl)-2-imino-, cyclic 8a,5:8a,7-ester, Araregai toxin, Babylonia japonica toxin 1, BJT 1, Maculotoxin, Spheroidine, Tarichatoxin, [[tetrodotoxin]], [[tetrodotoxina]], [[tetrodotoxine]], [[tetrodotoxine]], TTX

* No ChemSpiderID

* PubChem: 20382

* No InChI

* SMILES: C([C@@]1([C@@H]2[C@@H]3[C@H](N=C(N[C@@] 34C([C@@H]1O[C@@]([C@H]4O)(O2)O)O)N)O)O)O
Tetronal (9985)
```
Botcommand: addindex 320542245 Tetronal
```
```
For index : Tetronal=320542245
```
* 2217-59-6 -> 2217-59-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetronal not found on commonchemistry - Tetronal

* No ChemSpiderID

* PubChem: 75197

* No InChI

* No SMILES
Tetroxoprim (9986)
```
Botcommand: addindex 346984299 Tetroxoprim
```
```
For index : Tetroxoprim=346984299
```
* 53808-87-0 -> 53808-87-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetroxoprim not found on commonchemistry - Tetroxoprim

* No ChemSpiderID

* PubChem: 65450

* No InChI

* No SMILES
Tetuin (9988)
```
Botcommand: addindex 364810383 Tetuin
```
```
For index : Tetuin=364810383
```
* 28279-72-3 -> 28279-72-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Tetuin not found on commonchemistry - Tetuin

* No ChemSpiderID

* PubChem: 5321896

* No InChI

* SMILES: <nowiki>C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)OC4C(C(C(C(O4)CO)O)O)O)O</nowiki>
Texas_Red (9989)
```
Botcommand: addindex 365191708 Texas_Red
```
```
For index : Texas_Red=365191708
```
* 82354-19-6 -> 82354-19-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Texas+Red not found on commonchemistry - Texas+Red

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Tezacitabine (9990)
```
Botcommand: addindex 270070158 Tezacitabine
```
```
For index : Tezacitabine=270070158
```
* 130306-02-4 -> 130306-02-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Tezacitabine not found on commonchemistry - Tezacitabine

* No ChemSpiderID

* PubChem: 6435808

* No InChI

* SMILES: OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)/C([C@@H]1O)=C/F
Tezampanel (9991)
```
Botcommand: addindex 335224488 Tezampanel
```
```
For index : Tezampanel=335224488
```
* 150131-78-5 -> 150131-78-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Tezampanel not found on commonchemistry - Tezampanel

* No ChemSpiderID

* PubChem: 127894

* No InChI

* No SMILES
Tezosentan (9992)

* No CASNo

* Tezosentan not found on commonchemistry - Tezosentan

* No ChemSpiderID

* PubChem: 151174

* No InChI

* No SMILES
Thallium_azide (9994)

* No CASNo

* Thallium+azide not found on commonchemistry - Thallium+azide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium_triiodide (9995)
```
Botcommand: addindex 348427966 Thallium_triiodide
```
```
For index : Thallium_triiodide=348427966
```
* 60488-29-1 -> 60488-29-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+triiodide not found on commonchemistry - Thallium+triiodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium(I)_carbonate (9997)
File:Thallium(I) carbonate.jpg
```
Botcommand: addindex 313577483 Thallium(I)_carbonate
```
```
For index : Thallium(I)_carbonate=313577483
```
* 6533-73-9 -> 6533-73-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+carbonate not found on commonchemistry - Thallium+I+carbonate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Thallium(I)_fluoride (9999)
```
Botcommand: addindex 333685374 Thallium(I)_fluoride
```
```
For index : Thallium(I)_fluoride=333685374
```
* 7789-27-7 -> 7789-27-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+fluoride not found on commonchemistry - Thallium+I+fluoride

* No ChemSpiderID

* PubChem: 24864844

* No InChI

* No SMILES
Thallium(I)_hydroxide (10000)
```
Botcommand: addindex 356772321 Thallium(I)_hydroxide
```
```
For index : Thallium(I)_hydroxide=356772321
```
* 12026-06-1 -> 12026-06-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Thallium+I+hydroxide not found on commonchemistry - Thallium+I+hydroxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES